| 1 | n/a | # |
|---|
| 2 | n/a | # turtle.py: a Tkinter based turtle graphics module for Python |
|---|
| 3 | n/a | # Version 1.0.1 - 24. 9. 2009 |
|---|
| 4 | n/a | # |
|---|
| 5 | n/a | # Copyright (C) 2006 - 2010 Gregor Lingl |
|---|
| 6 | n/a | # email: glingl@aon.at |
|---|
| 7 | n/a | # |
|---|
| 8 | n/a | # This software is provided 'as-is', without any express or implied |
|---|
| 9 | n/a | # warranty. In no event will the authors be held liable for any damages |
|---|
| 10 | n/a | # arising from the use of this software. |
|---|
| 11 | n/a | # |
|---|
| 12 | n/a | # Permission is granted to anyone to use this software for any purpose, |
|---|
| 13 | n/a | # including commercial applications, and to alter it and redistribute it |
|---|
| 14 | n/a | # freely, subject to the following restrictions: |
|---|
| 15 | n/a | # |
|---|
| 16 | n/a | # 1. The origin of this software must not be misrepresented; you must not |
|---|
| 17 | n/a | # claim that you wrote the original software. If you use this software |
|---|
| 18 | n/a | # in a product, an acknowledgment in the product documentation would be |
|---|
| 19 | n/a | # appreciated but is not required. |
|---|
| 20 | n/a | # 2. Altered source versions must be plainly marked as such, and must not be |
|---|
| 21 | n/a | # misrepresented as being the original software. |
|---|
| 22 | n/a | # 3. This notice may not be removed or altered from any source distribution. |
|---|
| 23 | n/a | |
|---|
| 24 | n/a | |
|---|
| 25 | n/a | """ |
|---|
| 26 | n/a | Turtle graphics is a popular way for introducing programming to |
|---|
| 27 | n/a | kids. It was part of the original Logo programming language developed |
|---|
| 28 | n/a | by Wally Feurzig and Seymour Papert in 1966. |
|---|
| 29 | n/a | |
|---|
| 30 | n/a | Imagine a robotic turtle starting at (0, 0) in the x-y plane. Give it |
|---|
| 31 | n/a | the command turtle.forward(15), and it moves (on-screen!) 15 pixels in |
|---|
| 32 | n/a | the direction it is facing, drawing a line as it moves. Give it the |
|---|
| 33 | n/a | command turtle.left(25), and it rotates in-place 25 degrees clockwise. |
|---|
| 34 | n/a | |
|---|
| 35 | n/a | By combining together these and similar commands, intricate shapes and |
|---|
| 36 | n/a | pictures can easily be drawn. |
|---|
| 37 | n/a | |
|---|
| 38 | n/a | ----- turtle.py |
|---|
| 39 | n/a | |
|---|
| 40 | n/a | This module is an extended reimplementation of turtle.py from the |
|---|
| 41 | n/a | Python standard distribution up to Python 2.5. (See: http://www.python.org) |
|---|
| 42 | n/a | |
|---|
| 43 | n/a | It tries to keep the merits of turtle.py and to be (nearly) 100% |
|---|
| 44 | n/a | compatible with it. This means in the first place to enable the |
|---|
| 45 | n/a | learning programmer to use all the commands, classes and methods |
|---|
| 46 | n/a | interactively when using the module from within IDLE run with |
|---|
| 47 | n/a | the -n switch. |
|---|
| 48 | n/a | |
|---|
| 49 | n/a | Roughly it has the following features added: |
|---|
| 50 | n/a | |
|---|
| 51 | n/a | - Better animation of the turtle movements, especially of turning the |
|---|
| 52 | n/a | turtle. So the turtles can more easily be used as a visual feedback |
|---|
| 53 | n/a | instrument by the (beginning) programmer. |
|---|
| 54 | n/a | |
|---|
| 55 | n/a | - Different turtle shapes, gif-images as turtle shapes, user defined |
|---|
| 56 | n/a | and user controllable turtle shapes, among them compound |
|---|
| 57 | n/a | (multicolored) shapes. Turtle shapes can be stretched and tilted, which |
|---|
| 58 | n/a | makes turtles very versatile geometrical objects. |
|---|
| 59 | n/a | |
|---|
| 60 | n/a | - Fine control over turtle movement and screen updates via delay(), |
|---|
| 61 | n/a | and enhanced tracer() and speed() methods. |
|---|
| 62 | n/a | |
|---|
| 63 | n/a | - Aliases for the most commonly used commands, like fd for forward etc., |
|---|
| 64 | n/a | following the early Logo traditions. This reduces the boring work of |
|---|
| 65 | n/a | typing long sequences of commands, which often occur in a natural way |
|---|
| 66 | n/a | when kids try to program fancy pictures on their first encounter with |
|---|
| 67 | n/a | turtle graphics. |
|---|
| 68 | n/a | |
|---|
| 69 | n/a | - Turtles now have an undo()-method with configurable undo-buffer. |
|---|
| 70 | n/a | |
|---|
| 71 | n/a | - Some simple commands/methods for creating event driven programs |
|---|
| 72 | n/a | (mouse-, key-, timer-events). Especially useful for programming games. |
|---|
| 73 | n/a | |
|---|
| 74 | n/a | - A scrollable Canvas class. The default scrollable Canvas can be |
|---|
| 75 | n/a | extended interactively as needed while playing around with the turtle(s). |
|---|
| 76 | n/a | |
|---|
| 77 | n/a | - A TurtleScreen class with methods controlling background color or |
|---|
| 78 | n/a | background image, window and canvas size and other properties of the |
|---|
| 79 | n/a | TurtleScreen. |
|---|
| 80 | n/a | |
|---|
| 81 | n/a | - There is a method, setworldcoordinates(), to install a user defined |
|---|
| 82 | n/a | coordinate-system for the TurtleScreen. |
|---|
| 83 | n/a | |
|---|
| 84 | n/a | - The implementation uses a 2-vector class named Vec2D, derived from tuple. |
|---|
| 85 | n/a | This class is public, so it can be imported by the application programmer, |
|---|
| 86 | n/a | which makes certain types of computations very natural and compact. |
|---|
| 87 | n/a | |
|---|
| 88 | n/a | - Appearance of the TurtleScreen and the Turtles at startup/import can be |
|---|
| 89 | n/a | configured by means of a turtle.cfg configuration file. |
|---|
| 90 | n/a | The default configuration mimics the appearance of the old turtle module. |
|---|
| 91 | n/a | |
|---|
| 92 | n/a | - If configured appropriately the module reads in docstrings from a docstring |
|---|
| 93 | n/a | dictionary in some different language, supplied separately and replaces |
|---|
| 94 | n/a | the English ones by those read in. There is a utility function |
|---|
| 95 | n/a | write_docstringdict() to write a dictionary with the original (English) |
|---|
| 96 | n/a | docstrings to disc, so it can serve as a template for translations. |
|---|
| 97 | n/a | |
|---|
| 98 | n/a | Behind the scenes there are some features included with possible |
|---|
| 99 | n/a | extensions in in mind. These will be commented and documented elsewhere. |
|---|
| 100 | n/a | |
|---|
| 101 | n/a | """ |
|---|
| 102 | n/a | |
|---|
| 103 | n/a | _ver = "turtle 1.0b1 - for Python 2.6 - 30. 5. 2008, 18:08" |
|---|
| 104 | n/a | |
|---|
| 105 | n/a | #print _ver |
|---|
| 106 | n/a | |
|---|
| 107 | n/a | import Tkinter as TK |
|---|
| 108 | n/a | import types |
|---|
| 109 | n/a | import math |
|---|
| 110 | n/a | import time |
|---|
| 111 | n/a | import os |
|---|
| 112 | n/a | |
|---|
| 113 | n/a | from os.path import isfile, split, join |
|---|
| 114 | n/a | from copy import deepcopy |
|---|
| 115 | n/a | |
|---|
| 116 | n/a | from math import * ## for compatibility with old turtle module |
|---|
| 117 | n/a | |
|---|
| 118 | n/a | _tg_classes = ['ScrolledCanvas', 'TurtleScreen', 'Screen', |
|---|
| 119 | n/a | 'RawTurtle', 'Turtle', 'RawPen', 'Pen', 'Shape', 'Vec2D'] |
|---|
| 120 | n/a | _tg_screen_functions = ['addshape', 'bgcolor', 'bgpic', 'bye', |
|---|
| 121 | n/a | 'clearscreen', 'colormode', 'delay', 'exitonclick', 'getcanvas', |
|---|
| 122 | n/a | 'getshapes', 'listen', 'mode', 'onkey', 'onscreenclick', 'ontimer', |
|---|
| 123 | n/a | 'register_shape', 'resetscreen', 'screensize', 'setup', |
|---|
| 124 | n/a | 'setworldcoordinates', 'title', 'tracer', 'turtles', 'update', |
|---|
| 125 | n/a | 'window_height', 'window_width'] |
|---|
| 126 | n/a | _tg_turtle_functions = ['back', 'backward', 'begin_fill', 'begin_poly', 'bk', |
|---|
| 127 | n/a | 'circle', 'clear', 'clearstamp', 'clearstamps', 'clone', 'color', |
|---|
| 128 | n/a | 'degrees', 'distance', 'dot', 'down', 'end_fill', 'end_poly', 'fd', |
|---|
| 129 | n/a | 'fill', 'fillcolor', 'forward', 'get_poly', 'getpen', 'getscreen', |
|---|
| 130 | n/a | 'getturtle', 'goto', 'heading', 'hideturtle', 'home', 'ht', 'isdown', |
|---|
| 131 | n/a | 'isvisible', 'left', 'lt', 'onclick', 'ondrag', 'onrelease', 'pd', |
|---|
| 132 | n/a | 'pen', 'pencolor', 'pendown', 'pensize', 'penup', 'pos', 'position', |
|---|
| 133 | n/a | 'pu', 'radians', 'right', 'reset', 'resizemode', 'rt', |
|---|
| 134 | n/a | 'seth', 'setheading', 'setpos', 'setposition', 'settiltangle', |
|---|
| 135 | n/a | 'setundobuffer', 'setx', 'sety', 'shape', 'shapesize', 'showturtle', |
|---|
| 136 | n/a | 'speed', 'st', 'stamp', 'tilt', 'tiltangle', 'towards', 'tracer', |
|---|
| 137 | n/a | 'turtlesize', 'undo', 'undobufferentries', 'up', 'width', |
|---|
| 138 | n/a | 'window_height', 'window_width', 'write', 'xcor', 'ycor'] |
|---|
| 139 | n/a | _tg_utilities = ['write_docstringdict', 'done', 'mainloop'] |
|---|
| 140 | n/a | _math_functions = ['acos', 'asin', 'atan', 'atan2', 'ceil', 'cos', 'cosh', |
|---|
| 141 | n/a | 'e', 'exp', 'fabs', 'floor', 'fmod', 'frexp', 'hypot', 'ldexp', 'log', |
|---|
| 142 | n/a | 'log10', 'modf', 'pi', 'pow', 'sin', 'sinh', 'sqrt', 'tan', 'tanh'] |
|---|
| 143 | n/a | |
|---|
| 144 | n/a | __all__ = (_tg_classes + _tg_screen_functions + _tg_turtle_functions + |
|---|
| 145 | n/a | _tg_utilities + _math_functions) |
|---|
| 146 | n/a | |
|---|
| 147 | n/a | _alias_list = ['addshape', 'backward', 'bk', 'fd', 'ht', 'lt', 'pd', 'pos', |
|---|
| 148 | n/a | 'pu', 'rt', 'seth', 'setpos', 'setposition', 'st', |
|---|
| 149 | n/a | 'turtlesize', 'up', 'width'] |
|---|
| 150 | n/a | |
|---|
| 151 | n/a | _CFG = {"width" : 0.5, # Screen |
|---|
| 152 | n/a | "height" : 0.75, |
|---|
| 153 | n/a | "canvwidth" : 400, |
|---|
| 154 | n/a | "canvheight": 300, |
|---|
| 155 | n/a | "leftright": None, |
|---|
| 156 | n/a | "topbottom": None, |
|---|
| 157 | n/a | "mode": "standard", # TurtleScreen |
|---|
| 158 | n/a | "colormode": 1.0, |
|---|
| 159 | n/a | "delay": 10, |
|---|
| 160 | n/a | "undobuffersize": 1000, # RawTurtle |
|---|
| 161 | n/a | "shape": "classic", |
|---|
| 162 | n/a | "pencolor" : "black", |
|---|
| 163 | n/a | "fillcolor" : "black", |
|---|
| 164 | n/a | "resizemode" : "noresize", |
|---|
| 165 | n/a | "visible" : True, |
|---|
| 166 | n/a | "language": "english", # docstrings |
|---|
| 167 | n/a | "exampleturtle": "turtle", |
|---|
| 168 | n/a | "examplescreen": "screen", |
|---|
| 169 | n/a | "title": "Python Turtle Graphics", |
|---|
| 170 | n/a | "using_IDLE": False |
|---|
| 171 | n/a | } |
|---|
| 172 | n/a | |
|---|
| 173 | n/a | ##print "cwd:", os.getcwd() |
|---|
| 174 | n/a | ##print "__file__:", __file__ |
|---|
| 175 | n/a | ## |
|---|
| 176 | n/a | ##def show(dictionary): |
|---|
| 177 | n/a | ## print "==========================" |
|---|
| 178 | n/a | ## for key in sorted(dictionary.keys()): |
|---|
| 179 | n/a | ## print key, ":", dictionary[key] |
|---|
| 180 | n/a | ## print "==========================" |
|---|
| 181 | n/a | ## print |
|---|
| 182 | n/a | |
|---|
| 183 | n/a | def config_dict(filename): |
|---|
| 184 | n/a | """Convert content of config-file into dictionary.""" |
|---|
| 185 | n/a | f = open(filename, "r") |
|---|
| 186 | n/a | cfglines = f.readlines() |
|---|
| 187 | n/a | f.close() |
|---|
| 188 | n/a | cfgdict = {} |
|---|
| 189 | n/a | for line in cfglines: |
|---|
| 190 | n/a | line = line.strip() |
|---|
| 191 | n/a | if not line or line.startswith("#"): |
|---|
| 192 | n/a | continue |
|---|
| 193 | n/a | try: |
|---|
| 194 | n/a | key, value = line.split("=") |
|---|
| 195 | n/a | except: |
|---|
| 196 | n/a | print "Bad line in config-file %s:\n%s" % (filename,line) |
|---|
| 197 | n/a | continue |
|---|
| 198 | n/a | key = key.strip() |
|---|
| 199 | n/a | value = value.strip() |
|---|
| 200 | n/a | if value in ["True", "False", "None", "''", '""']: |
|---|
| 201 | n/a | value = eval(value) |
|---|
| 202 | n/a | else: |
|---|
| 203 | n/a | try: |
|---|
| 204 | n/a | if "." in value: |
|---|
| 205 | n/a | value = float(value) |
|---|
| 206 | n/a | else: |
|---|
| 207 | n/a | value = int(value) |
|---|
| 208 | n/a | except: |
|---|
| 209 | n/a | pass # value need not be converted |
|---|
| 210 | n/a | cfgdict[key] = value |
|---|
| 211 | n/a | return cfgdict |
|---|
| 212 | n/a | |
|---|
| 213 | n/a | def readconfig(cfgdict): |
|---|
| 214 | n/a | """Read config-files, change configuration-dict accordingly. |
|---|
| 215 | n/a | |
|---|
| 216 | n/a | If there is a turtle.cfg file in the current working directory, |
|---|
| 217 | n/a | read it from there. If this contains an importconfig-value, |
|---|
| 218 | n/a | say 'myway', construct filename turtle_mayway.cfg else use |
|---|
| 219 | n/a | turtle.cfg and read it from the import-directory, where |
|---|
| 220 | n/a | turtle.py is located. |
|---|
| 221 | n/a | Update configuration dictionary first according to config-file, |
|---|
| 222 | n/a | in the import directory, then according to config-file in the |
|---|
| 223 | n/a | current working directory. |
|---|
| 224 | n/a | If no config-file is found, the default configuration is used. |
|---|
| 225 | n/a | """ |
|---|
| 226 | n/a | default_cfg = "turtle.cfg" |
|---|
| 227 | n/a | cfgdict1 = {} |
|---|
| 228 | n/a | cfgdict2 = {} |
|---|
| 229 | n/a | if isfile(default_cfg): |
|---|
| 230 | n/a | cfgdict1 = config_dict(default_cfg) |
|---|
| 231 | n/a | #print "1. Loading config-file %s from: %s" % (default_cfg, os.getcwd()) |
|---|
| 232 | n/a | if "importconfig" in cfgdict1: |
|---|
| 233 | n/a | default_cfg = "turtle_%s.cfg" % cfgdict1["importconfig"] |
|---|
| 234 | n/a | try: |
|---|
| 235 | n/a | head, tail = split(__file__) |
|---|
| 236 | n/a | cfg_file2 = join(head, default_cfg) |
|---|
| 237 | n/a | except: |
|---|
| 238 | n/a | cfg_file2 = "" |
|---|
| 239 | n/a | if isfile(cfg_file2): |
|---|
| 240 | n/a | #print "2. Loading config-file %s:" % cfg_file2 |
|---|
| 241 | n/a | cfgdict2 = config_dict(cfg_file2) |
|---|
| 242 | n/a | ## show(_CFG) |
|---|
| 243 | n/a | ## show(cfgdict2) |
|---|
| 244 | n/a | _CFG.update(cfgdict2) |
|---|
| 245 | n/a | ## show(_CFG) |
|---|
| 246 | n/a | ## show(cfgdict1) |
|---|
| 247 | n/a | _CFG.update(cfgdict1) |
|---|
| 248 | n/a | ## show(_CFG) |
|---|
| 249 | n/a | |
|---|
| 250 | n/a | try: |
|---|
| 251 | n/a | readconfig(_CFG) |
|---|
| 252 | n/a | except: |
|---|
| 253 | n/a | print "No configfile read, reason unknown" |
|---|
| 254 | n/a | |
|---|
| 255 | n/a | |
|---|
| 256 | n/a | class Vec2D(tuple): |
|---|
| 257 | n/a | """A 2 dimensional vector class, used as a helper class |
|---|
| 258 | n/a | for implementing turtle graphics. |
|---|
| 259 | n/a | May be useful for turtle graphics programs also. |
|---|
| 260 | n/a | Derived from tuple, so a vector is a tuple! |
|---|
| 261 | n/a | |
|---|
| 262 | n/a | Provides (for a, b vectors, k number): |
|---|
| 263 | n/a | a+b vector addition |
|---|
| 264 | n/a | a-b vector subtraction |
|---|
| 265 | n/a | a*b inner product |
|---|
| 266 | n/a | k*a and a*k multiplication with scalar |
|---|
| 267 | n/a | |a| absolute value of a |
|---|
| 268 | n/a | a.rotate(angle) rotation |
|---|
| 269 | n/a | """ |
|---|
| 270 | n/a | def __new__(cls, x, y): |
|---|
| 271 | n/a | return tuple.__new__(cls, (x, y)) |
|---|
| 272 | n/a | def __add__(self, other): |
|---|
| 273 | n/a | return Vec2D(self[0]+other[0], self[1]+other[1]) |
|---|
| 274 | n/a | def __mul__(self, other): |
|---|
| 275 | n/a | if isinstance(other, Vec2D): |
|---|
| 276 | n/a | return self[0]*other[0]+self[1]*other[1] |
|---|
| 277 | n/a | return Vec2D(self[0]*other, self[1]*other) |
|---|
| 278 | n/a | def __rmul__(self, other): |
|---|
| 279 | n/a | if isinstance(other, int) or isinstance(other, float): |
|---|
| 280 | n/a | return Vec2D(self[0]*other, self[1]*other) |
|---|
| 281 | n/a | def __sub__(self, other): |
|---|
| 282 | n/a | return Vec2D(self[0]-other[0], self[1]-other[1]) |
|---|
| 283 | n/a | def __neg__(self): |
|---|
| 284 | n/a | return Vec2D(-self[0], -self[1]) |
|---|
| 285 | n/a | def __abs__(self): |
|---|
| 286 | n/a | return (self[0]**2 + self[1]**2)**0.5 |
|---|
| 287 | n/a | def rotate(self, angle): |
|---|
| 288 | n/a | """rotate self counterclockwise by angle |
|---|
| 289 | n/a | """ |
|---|
| 290 | n/a | perp = Vec2D(-self[1], self[0]) |
|---|
| 291 | n/a | angle = angle * math.pi / 180.0 |
|---|
| 292 | n/a | c, s = math.cos(angle), math.sin(angle) |
|---|
| 293 | n/a | return Vec2D(self[0]*c+perp[0]*s, self[1]*c+perp[1]*s) |
|---|
| 294 | n/a | def __getnewargs__(self): |
|---|
| 295 | n/a | return (self[0], self[1]) |
|---|
| 296 | n/a | def __repr__(self): |
|---|
| 297 | n/a | return "(%.2f,%.2f)" % self |
|---|
| 298 | n/a | |
|---|
| 299 | n/a | |
|---|
| 300 | n/a | ############################################################################## |
|---|
| 301 | n/a | ### From here up to line : Tkinter - Interface for turtle.py ### |
|---|
| 302 | n/a | ### May be replaced by an interface to some different graphics toolkit ### |
|---|
| 303 | n/a | ############################################################################## |
|---|
| 304 | n/a | |
|---|
| 305 | n/a | ## helper functions for Scrolled Canvas, to forward Canvas-methods |
|---|
| 306 | n/a | ## to ScrolledCanvas class |
|---|
| 307 | n/a | |
|---|
| 308 | n/a | def __methodDict(cls, _dict): |
|---|
| 309 | n/a | """helper function for Scrolled Canvas""" |
|---|
| 310 | n/a | baseList = list(cls.__bases__) |
|---|
| 311 | n/a | baseList.reverse() |
|---|
| 312 | n/a | for _super in baseList: |
|---|
| 313 | n/a | __methodDict(_super, _dict) |
|---|
| 314 | n/a | for key, value in cls.__dict__.items(): |
|---|
| 315 | n/a | if type(value) == types.FunctionType: |
|---|
| 316 | n/a | _dict[key] = value |
|---|
| 317 | n/a | |
|---|
| 318 | n/a | def __methods(cls): |
|---|
| 319 | n/a | """helper function for Scrolled Canvas""" |
|---|
| 320 | n/a | _dict = {} |
|---|
| 321 | n/a | __methodDict(cls, _dict) |
|---|
| 322 | n/a | return _dict.keys() |
|---|
| 323 | n/a | |
|---|
| 324 | n/a | __stringBody = ( |
|---|
| 325 | n/a | 'def %(method)s(self, *args, **kw): return ' + |
|---|
| 326 | n/a | 'self.%(attribute)s.%(method)s(*args, **kw)') |
|---|
| 327 | n/a | |
|---|
| 328 | n/a | def __forwardmethods(fromClass, toClass, toPart, exclude = ()): |
|---|
| 329 | n/a | """Helper functions for Scrolled Canvas, used to forward |
|---|
| 330 | n/a | ScrolledCanvas-methods to Tkinter.Canvas class. |
|---|
| 331 | n/a | """ |
|---|
| 332 | n/a | _dict = {} |
|---|
| 333 | n/a | __methodDict(toClass, _dict) |
|---|
| 334 | n/a | for ex in _dict.keys(): |
|---|
| 335 | n/a | if ex[:1] == '_' or ex[-1:] == '_': |
|---|
| 336 | n/a | del _dict[ex] |
|---|
| 337 | n/a | for ex in exclude: |
|---|
| 338 | n/a | if ex in _dict: |
|---|
| 339 | n/a | del _dict[ex] |
|---|
| 340 | n/a | for ex in __methods(fromClass): |
|---|
| 341 | n/a | if ex in _dict: |
|---|
| 342 | n/a | del _dict[ex] |
|---|
| 343 | n/a | |
|---|
| 344 | n/a | for method, func in _dict.items(): |
|---|
| 345 | n/a | d = {'method': method, 'func': func} |
|---|
| 346 | n/a | if type(toPart) == types.StringType: |
|---|
| 347 | n/a | execString = \ |
|---|
| 348 | n/a | __stringBody % {'method' : method, 'attribute' : toPart} |
|---|
| 349 | n/a | exec execString in d |
|---|
| 350 | n/a | fromClass.__dict__[method] = d[method] |
|---|
| 351 | n/a | |
|---|
| 352 | n/a | |
|---|
| 353 | n/a | class ScrolledCanvas(TK.Frame): |
|---|
| 354 | n/a | """Modeled after the scrolled canvas class from Grayons's Tkinter book. |
|---|
| 355 | n/a | |
|---|
| 356 | n/a | Used as the default canvas, which pops up automatically when |
|---|
| 357 | n/a | using turtle graphics functions or the Turtle class. |
|---|
| 358 | n/a | """ |
|---|
| 359 | n/a | def __init__(self, master, width=500, height=350, |
|---|
| 360 | n/a | canvwidth=600, canvheight=500): |
|---|
| 361 | n/a | TK.Frame.__init__(self, master, width=width, height=height) |
|---|
| 362 | n/a | self._rootwindow = self.winfo_toplevel() |
|---|
| 363 | n/a | self.width, self.height = width, height |
|---|
| 364 | n/a | self.canvwidth, self.canvheight = canvwidth, canvheight |
|---|
| 365 | n/a | self.bg = "white" |
|---|
| 366 | n/a | self._canvas = TK.Canvas(master, width=width, height=height, |
|---|
| 367 | n/a | bg=self.bg, relief=TK.SUNKEN, borderwidth=2) |
|---|
| 368 | n/a | self.hscroll = TK.Scrollbar(master, command=self._canvas.xview, |
|---|
| 369 | n/a | orient=TK.HORIZONTAL) |
|---|
| 370 | n/a | self.vscroll = TK.Scrollbar(master, command=self._canvas.yview) |
|---|
| 371 | n/a | self._canvas.configure(xscrollcommand=self.hscroll.set, |
|---|
| 372 | n/a | yscrollcommand=self.vscroll.set) |
|---|
| 373 | n/a | self.rowconfigure(0, weight=1, minsize=0) |
|---|
| 374 | n/a | self.columnconfigure(0, weight=1, minsize=0) |
|---|
| 375 | n/a | self._canvas.grid(padx=1, in_ = self, pady=1, row=0, |
|---|
| 376 | n/a | column=0, rowspan=1, columnspan=1, sticky='news') |
|---|
| 377 | n/a | self.vscroll.grid(padx=1, in_ = self, pady=1, row=0, |
|---|
| 378 | n/a | column=1, rowspan=1, columnspan=1, sticky='news') |
|---|
| 379 | n/a | self.hscroll.grid(padx=1, in_ = self, pady=1, row=1, |
|---|
| 380 | n/a | column=0, rowspan=1, columnspan=1, sticky='news') |
|---|
| 381 | n/a | self.reset() |
|---|
| 382 | n/a | self._rootwindow.bind('<Configure>', self.onResize) |
|---|
| 383 | n/a | |
|---|
| 384 | n/a | def reset(self, canvwidth=None, canvheight=None, bg = None): |
|---|
| 385 | n/a | """Adjust canvas and scrollbars according to given canvas size.""" |
|---|
| 386 | n/a | if canvwidth: |
|---|
| 387 | n/a | self.canvwidth = canvwidth |
|---|
| 388 | n/a | if canvheight: |
|---|
| 389 | n/a | self.canvheight = canvheight |
|---|
| 390 | n/a | if bg: |
|---|
| 391 | n/a | self.bg = bg |
|---|
| 392 | n/a | self._canvas.config(bg=bg, |
|---|
| 393 | n/a | scrollregion=(-self.canvwidth//2, -self.canvheight//2, |
|---|
| 394 | n/a | self.canvwidth//2, self.canvheight//2)) |
|---|
| 395 | n/a | self._canvas.xview_moveto(0.5*(self.canvwidth - self.width + 30) / |
|---|
| 396 | n/a | self.canvwidth) |
|---|
| 397 | n/a | self._canvas.yview_moveto(0.5*(self.canvheight- self.height + 30) / |
|---|
| 398 | n/a | self.canvheight) |
|---|
| 399 | n/a | self.adjustScrolls() |
|---|
| 400 | n/a | |
|---|
| 401 | n/a | |
|---|
| 402 | n/a | def adjustScrolls(self): |
|---|
| 403 | n/a | """ Adjust scrollbars according to window- and canvas-size. |
|---|
| 404 | n/a | """ |
|---|
| 405 | n/a | cwidth = self._canvas.winfo_width() |
|---|
| 406 | n/a | cheight = self._canvas.winfo_height() |
|---|
| 407 | n/a | self._canvas.xview_moveto(0.5*(self.canvwidth-cwidth)/self.canvwidth) |
|---|
| 408 | n/a | self._canvas.yview_moveto(0.5*(self.canvheight-cheight)/self.canvheight) |
|---|
| 409 | n/a | if cwidth < self.canvwidth or cheight < self.canvheight: |
|---|
| 410 | n/a | self.hscroll.grid(padx=1, in_ = self, pady=1, row=1, |
|---|
| 411 | n/a | column=0, rowspan=1, columnspan=1, sticky='news') |
|---|
| 412 | n/a | self.vscroll.grid(padx=1, in_ = self, pady=1, row=0, |
|---|
| 413 | n/a | column=1, rowspan=1, columnspan=1, sticky='news') |
|---|
| 414 | n/a | else: |
|---|
| 415 | n/a | self.hscroll.grid_forget() |
|---|
| 416 | n/a | self.vscroll.grid_forget() |
|---|
| 417 | n/a | |
|---|
| 418 | n/a | def onResize(self, event): |
|---|
| 419 | n/a | """self-explanatory""" |
|---|
| 420 | n/a | self.adjustScrolls() |
|---|
| 421 | n/a | |
|---|
| 422 | n/a | def bbox(self, *args): |
|---|
| 423 | n/a | """ 'forward' method, which canvas itself has inherited... |
|---|
| 424 | n/a | """ |
|---|
| 425 | n/a | return self._canvas.bbox(*args) |
|---|
| 426 | n/a | |
|---|
| 427 | n/a | def cget(self, *args, **kwargs): |
|---|
| 428 | n/a | """ 'forward' method, which canvas itself has inherited... |
|---|
| 429 | n/a | """ |
|---|
| 430 | n/a | return self._canvas.cget(*args, **kwargs) |
|---|
| 431 | n/a | |
|---|
| 432 | n/a | def config(self, *args, **kwargs): |
|---|
| 433 | n/a | """ 'forward' method, which canvas itself has inherited... |
|---|
| 434 | n/a | """ |
|---|
| 435 | n/a | self._canvas.config(*args, **kwargs) |
|---|
| 436 | n/a | |
|---|
| 437 | n/a | def bind(self, *args, **kwargs): |
|---|
| 438 | n/a | """ 'forward' method, which canvas itself has inherited... |
|---|
| 439 | n/a | """ |
|---|
| 440 | n/a | self._canvas.bind(*args, **kwargs) |
|---|
| 441 | n/a | |
|---|
| 442 | n/a | def unbind(self, *args, **kwargs): |
|---|
| 443 | n/a | """ 'forward' method, which canvas itself has inherited... |
|---|
| 444 | n/a | """ |
|---|
| 445 | n/a | self._canvas.unbind(*args, **kwargs) |
|---|
| 446 | n/a | |
|---|
| 447 | n/a | def focus_force(self): |
|---|
| 448 | n/a | """ 'forward' method, which canvas itself has inherited... |
|---|
| 449 | n/a | """ |
|---|
| 450 | n/a | self._canvas.focus_force() |
|---|
| 451 | n/a | |
|---|
| 452 | n/a | __forwardmethods(ScrolledCanvas, TK.Canvas, '_canvas') |
|---|
| 453 | n/a | |
|---|
| 454 | n/a | |
|---|
| 455 | n/a | class _Root(TK.Tk): |
|---|
| 456 | n/a | """Root class for Screen based on Tkinter.""" |
|---|
| 457 | n/a | def __init__(self): |
|---|
| 458 | n/a | TK.Tk.__init__(self) |
|---|
| 459 | n/a | |
|---|
| 460 | n/a | def setupcanvas(self, width, height, cwidth, cheight): |
|---|
| 461 | n/a | self._canvas = ScrolledCanvas(self, width, height, cwidth, cheight) |
|---|
| 462 | n/a | self._canvas.pack(expand=1, fill="both") |
|---|
| 463 | n/a | |
|---|
| 464 | n/a | def _getcanvas(self): |
|---|
| 465 | n/a | return self._canvas |
|---|
| 466 | n/a | |
|---|
| 467 | n/a | def set_geometry(self, width, height, startx, starty): |
|---|
| 468 | n/a | self.geometry("%dx%d%+d%+d"%(width, height, startx, starty)) |
|---|
| 469 | n/a | |
|---|
| 470 | n/a | def ondestroy(self, destroy): |
|---|
| 471 | n/a | self.wm_protocol("WM_DELETE_WINDOW", destroy) |
|---|
| 472 | n/a | |
|---|
| 473 | n/a | def win_width(self): |
|---|
| 474 | n/a | return self.winfo_screenwidth() |
|---|
| 475 | n/a | |
|---|
| 476 | n/a | def win_height(self): |
|---|
| 477 | n/a | return self.winfo_screenheight() |
|---|
| 478 | n/a | |
|---|
| 479 | n/a | Canvas = TK.Canvas |
|---|
| 480 | n/a | |
|---|
| 481 | n/a | |
|---|
| 482 | n/a | class TurtleScreenBase(object): |
|---|
| 483 | n/a | """Provide the basic graphics functionality. |
|---|
| 484 | n/a | Interface between Tkinter and turtle.py. |
|---|
| 485 | n/a | |
|---|
| 486 | n/a | To port turtle.py to some different graphics toolkit |
|---|
| 487 | n/a | a corresponding TurtleScreenBase class has to be implemented. |
|---|
| 488 | n/a | """ |
|---|
| 489 | n/a | |
|---|
| 490 | n/a | @staticmethod |
|---|
| 491 | n/a | def _blankimage(): |
|---|
| 492 | n/a | """return a blank image object |
|---|
| 493 | n/a | """ |
|---|
| 494 | n/a | img = TK.PhotoImage(width=1, height=1) |
|---|
| 495 | n/a | img.blank() |
|---|
| 496 | n/a | return img |
|---|
| 497 | n/a | |
|---|
| 498 | n/a | @staticmethod |
|---|
| 499 | n/a | def _image(filename): |
|---|
| 500 | n/a | """return an image object containing the |
|---|
| 501 | n/a | imagedata from a gif-file named filename. |
|---|
| 502 | n/a | """ |
|---|
| 503 | n/a | return TK.PhotoImage(file=filename) |
|---|
| 504 | n/a | |
|---|
| 505 | n/a | def __init__(self, cv): |
|---|
| 506 | n/a | self.cv = cv |
|---|
| 507 | n/a | if isinstance(cv, ScrolledCanvas): |
|---|
| 508 | n/a | w = self.cv.canvwidth |
|---|
| 509 | n/a | h = self.cv.canvheight |
|---|
| 510 | n/a | else: # expected: ordinary TK.Canvas |
|---|
| 511 | n/a | w = int(self.cv.cget("width")) |
|---|
| 512 | n/a | h = int(self.cv.cget("height")) |
|---|
| 513 | n/a | self.cv.config(scrollregion = (-w//2, -h//2, w//2, h//2 )) |
|---|
| 514 | n/a | self.canvwidth = w |
|---|
| 515 | n/a | self.canvheight = h |
|---|
| 516 | n/a | self.xscale = self.yscale = 1.0 |
|---|
| 517 | n/a | |
|---|
| 518 | n/a | def _createpoly(self): |
|---|
| 519 | n/a | """Create an invisible polygon item on canvas self.cv) |
|---|
| 520 | n/a | """ |
|---|
| 521 | n/a | return self.cv.create_polygon((0, 0, 0, 0, 0, 0), fill="", outline="") |
|---|
| 522 | n/a | |
|---|
| 523 | n/a | def _drawpoly(self, polyitem, coordlist, fill=None, |
|---|
| 524 | n/a | outline=None, width=None, top=False): |
|---|
| 525 | n/a | """Configure polygonitem polyitem according to provided |
|---|
| 526 | n/a | arguments: |
|---|
| 527 | n/a | coordlist is sequence of coordinates |
|---|
| 528 | n/a | fill is filling color |
|---|
| 529 | n/a | outline is outline color |
|---|
| 530 | n/a | top is a boolean value, which specifies if polyitem |
|---|
| 531 | n/a | will be put on top of the canvas' displaylist so it |
|---|
| 532 | n/a | will not be covered by other items. |
|---|
| 533 | n/a | """ |
|---|
| 534 | n/a | cl = [] |
|---|
| 535 | n/a | for x, y in coordlist: |
|---|
| 536 | n/a | cl.append(x * self.xscale) |
|---|
| 537 | n/a | cl.append(-y * self.yscale) |
|---|
| 538 | n/a | self.cv.coords(polyitem, *cl) |
|---|
| 539 | n/a | if fill is not None: |
|---|
| 540 | n/a | self.cv.itemconfigure(polyitem, fill=fill) |
|---|
| 541 | n/a | if outline is not None: |
|---|
| 542 | n/a | self.cv.itemconfigure(polyitem, outline=outline) |
|---|
| 543 | n/a | if width is not None: |
|---|
| 544 | n/a | self.cv.itemconfigure(polyitem, width=width) |
|---|
| 545 | n/a | if top: |
|---|
| 546 | n/a | self.cv.tag_raise(polyitem) |
|---|
| 547 | n/a | |
|---|
| 548 | n/a | def _createline(self): |
|---|
| 549 | n/a | """Create an invisible line item on canvas self.cv) |
|---|
| 550 | n/a | """ |
|---|
| 551 | n/a | return self.cv.create_line(0, 0, 0, 0, fill="", width=2, |
|---|
| 552 | n/a | capstyle = TK.ROUND) |
|---|
| 553 | n/a | |
|---|
| 554 | n/a | def _drawline(self, lineitem, coordlist=None, |
|---|
| 555 | n/a | fill=None, width=None, top=False): |
|---|
| 556 | n/a | """Configure lineitem according to provided arguments: |
|---|
| 557 | n/a | coordlist is sequence of coordinates |
|---|
| 558 | n/a | fill is drawing color |
|---|
| 559 | n/a | width is width of drawn line. |
|---|
| 560 | n/a | top is a boolean value, which specifies if polyitem |
|---|
| 561 | n/a | will be put on top of the canvas' displaylist so it |
|---|
| 562 | n/a | will not be covered by other items. |
|---|
| 563 | n/a | """ |
|---|
| 564 | n/a | if coordlist is not None: |
|---|
| 565 | n/a | cl = [] |
|---|
| 566 | n/a | for x, y in coordlist: |
|---|
| 567 | n/a | cl.append(x * self.xscale) |
|---|
| 568 | n/a | cl.append(-y * self.yscale) |
|---|
| 569 | n/a | self.cv.coords(lineitem, *cl) |
|---|
| 570 | n/a | if fill is not None: |
|---|
| 571 | n/a | self.cv.itemconfigure(lineitem, fill=fill) |
|---|
| 572 | n/a | if width is not None: |
|---|
| 573 | n/a | self.cv.itemconfigure(lineitem, width=width) |
|---|
| 574 | n/a | if top: |
|---|
| 575 | n/a | self.cv.tag_raise(lineitem) |
|---|
| 576 | n/a | |
|---|
| 577 | n/a | def _delete(self, item): |
|---|
| 578 | n/a | """Delete graphics item from canvas. |
|---|
| 579 | n/a | If item is"all" delete all graphics items. |
|---|
| 580 | n/a | """ |
|---|
| 581 | n/a | self.cv.delete(item) |
|---|
| 582 | n/a | |
|---|
| 583 | n/a | def _update(self): |
|---|
| 584 | n/a | """Redraw graphics items on canvas |
|---|
| 585 | n/a | """ |
|---|
| 586 | n/a | self.cv.update() |
|---|
| 587 | n/a | |
|---|
| 588 | n/a | def _delay(self, delay): |
|---|
| 589 | n/a | """Delay subsequent canvas actions for delay ms.""" |
|---|
| 590 | n/a | self.cv.after(delay) |
|---|
| 591 | n/a | |
|---|
| 592 | n/a | def _iscolorstring(self, color): |
|---|
| 593 | n/a | """Check if the string color is a legal Tkinter color string. |
|---|
| 594 | n/a | """ |
|---|
| 595 | n/a | try: |
|---|
| 596 | n/a | rgb = self.cv.winfo_rgb(color) |
|---|
| 597 | n/a | ok = True |
|---|
| 598 | n/a | except TK.TclError: |
|---|
| 599 | n/a | ok = False |
|---|
| 600 | n/a | return ok |
|---|
| 601 | n/a | |
|---|
| 602 | n/a | def _bgcolor(self, color=None): |
|---|
| 603 | n/a | """Set canvas' backgroundcolor if color is not None, |
|---|
| 604 | n/a | else return backgroundcolor.""" |
|---|
| 605 | n/a | if color is not None: |
|---|
| 606 | n/a | self.cv.config(bg = color) |
|---|
| 607 | n/a | self._update() |
|---|
| 608 | n/a | else: |
|---|
| 609 | n/a | return self.cv.cget("bg") |
|---|
| 610 | n/a | |
|---|
| 611 | n/a | def _write(self, pos, txt, align, font, pencolor): |
|---|
| 612 | n/a | """Write txt at pos in canvas with specified font |
|---|
| 613 | n/a | and color. |
|---|
| 614 | n/a | Return text item and x-coord of right bottom corner |
|---|
| 615 | n/a | of text's bounding box.""" |
|---|
| 616 | n/a | x, y = pos |
|---|
| 617 | n/a | x = x * self.xscale |
|---|
| 618 | n/a | y = y * self.yscale |
|---|
| 619 | n/a | anchor = {"left":"sw", "center":"s", "right":"se" } |
|---|
| 620 | n/a | item = self.cv.create_text(x-1, -y, text = txt, anchor = anchor[align], |
|---|
| 621 | n/a | fill = pencolor, font = font) |
|---|
| 622 | n/a | x0, y0, x1, y1 = self.cv.bbox(item) |
|---|
| 623 | n/a | self.cv.update() |
|---|
| 624 | n/a | return item, x1-1 |
|---|
| 625 | n/a | |
|---|
| 626 | n/a | ## def _dot(self, pos, size, color): |
|---|
| 627 | n/a | ## """may be implemented for some other graphics toolkit""" |
|---|
| 628 | n/a | |
|---|
| 629 | n/a | def _onclick(self, item, fun, num=1, add=None): |
|---|
| 630 | n/a | """Bind fun to mouse-click event on turtle. |
|---|
| 631 | n/a | fun must be a function with two arguments, the coordinates |
|---|
| 632 | n/a | of the clicked point on the canvas. |
|---|
| 633 | n/a | num, the number of the mouse-button defaults to 1 |
|---|
| 634 | n/a | """ |
|---|
| 635 | n/a | if fun is None: |
|---|
| 636 | n/a | self.cv.tag_unbind(item, "<Button-%s>" % num) |
|---|
| 637 | n/a | else: |
|---|
| 638 | n/a | def eventfun(event): |
|---|
| 639 | n/a | x, y = (self.cv.canvasx(event.x)/self.xscale, |
|---|
| 640 | n/a | -self.cv.canvasy(event.y)/self.yscale) |
|---|
| 641 | n/a | fun(x, y) |
|---|
| 642 | n/a | self.cv.tag_bind(item, "<Button-%s>" % num, eventfun, add) |
|---|
| 643 | n/a | |
|---|
| 644 | n/a | def _onrelease(self, item, fun, num=1, add=None): |
|---|
| 645 | n/a | """Bind fun to mouse-button-release event on turtle. |
|---|
| 646 | n/a | fun must be a function with two arguments, the coordinates |
|---|
| 647 | n/a | of the point on the canvas where mouse button is released. |
|---|
| 648 | n/a | num, the number of the mouse-button defaults to 1 |
|---|
| 649 | n/a | |
|---|
| 650 | n/a | If a turtle is clicked, first _onclick-event will be performed, |
|---|
| 651 | n/a | then _onscreensclick-event. |
|---|
| 652 | n/a | """ |
|---|
| 653 | n/a | if fun is None: |
|---|
| 654 | n/a | self.cv.tag_unbind(item, "<Button%s-ButtonRelease>" % num) |
|---|
| 655 | n/a | else: |
|---|
| 656 | n/a | def eventfun(event): |
|---|
| 657 | n/a | x, y = (self.cv.canvasx(event.x)/self.xscale, |
|---|
| 658 | n/a | -self.cv.canvasy(event.y)/self.yscale) |
|---|
| 659 | n/a | fun(x, y) |
|---|
| 660 | n/a | self.cv.tag_bind(item, "<Button%s-ButtonRelease>" % num, |
|---|
| 661 | n/a | eventfun, add) |
|---|
| 662 | n/a | |
|---|
| 663 | n/a | def _ondrag(self, item, fun, num=1, add=None): |
|---|
| 664 | n/a | """Bind fun to mouse-move-event (with pressed mouse button) on turtle. |
|---|
| 665 | n/a | fun must be a function with two arguments, the coordinates of the |
|---|
| 666 | n/a | actual mouse position on the canvas. |
|---|
| 667 | n/a | num, the number of the mouse-button defaults to 1 |
|---|
| 668 | n/a | |
|---|
| 669 | n/a | Every sequence of mouse-move-events on a turtle is preceded by a |
|---|
| 670 | n/a | mouse-click event on that turtle. |
|---|
| 671 | n/a | """ |
|---|
| 672 | n/a | if fun is None: |
|---|
| 673 | n/a | self.cv.tag_unbind(item, "<Button%s-Motion>" % num) |
|---|
| 674 | n/a | else: |
|---|
| 675 | n/a | def eventfun(event): |
|---|
| 676 | n/a | try: |
|---|
| 677 | n/a | x, y = (self.cv.canvasx(event.x)/self.xscale, |
|---|
| 678 | n/a | -self.cv.canvasy(event.y)/self.yscale) |
|---|
| 679 | n/a | fun(x, y) |
|---|
| 680 | n/a | except: |
|---|
| 681 | n/a | pass |
|---|
| 682 | n/a | self.cv.tag_bind(item, "<Button%s-Motion>" % num, eventfun, add) |
|---|
| 683 | n/a | |
|---|
| 684 | n/a | def _onscreenclick(self, fun, num=1, add=None): |
|---|
| 685 | n/a | """Bind fun to mouse-click event on canvas. |
|---|
| 686 | n/a | fun must be a function with two arguments, the coordinates |
|---|
| 687 | n/a | of the clicked point on the canvas. |
|---|
| 688 | n/a | num, the number of the mouse-button defaults to 1 |
|---|
| 689 | n/a | |
|---|
| 690 | n/a | If a turtle is clicked, first _onclick-event will be performed, |
|---|
| 691 | n/a | then _onscreensclick-event. |
|---|
| 692 | n/a | """ |
|---|
| 693 | n/a | if fun is None: |
|---|
| 694 | n/a | self.cv.unbind("<Button-%s>" % num) |
|---|
| 695 | n/a | else: |
|---|
| 696 | n/a | def eventfun(event): |
|---|
| 697 | n/a | x, y = (self.cv.canvasx(event.x)/self.xscale, |
|---|
| 698 | n/a | -self.cv.canvasy(event.y)/self.yscale) |
|---|
| 699 | n/a | fun(x, y) |
|---|
| 700 | n/a | self.cv.bind("<Button-%s>" % num, eventfun, add) |
|---|
| 701 | n/a | |
|---|
| 702 | n/a | def _onkey(self, fun, key): |
|---|
| 703 | n/a | """Bind fun to key-release event of key. |
|---|
| 704 | n/a | Canvas must have focus. See method listen |
|---|
| 705 | n/a | """ |
|---|
| 706 | n/a | if fun is None: |
|---|
| 707 | n/a | self.cv.unbind("<KeyRelease-%s>" % key, None) |
|---|
| 708 | n/a | else: |
|---|
| 709 | n/a | def eventfun(event): |
|---|
| 710 | n/a | fun() |
|---|
| 711 | n/a | self.cv.bind("<KeyRelease-%s>" % key, eventfun) |
|---|
| 712 | n/a | |
|---|
| 713 | n/a | def _listen(self): |
|---|
| 714 | n/a | """Set focus on canvas (in order to collect key-events) |
|---|
| 715 | n/a | """ |
|---|
| 716 | n/a | self.cv.focus_force() |
|---|
| 717 | n/a | |
|---|
| 718 | n/a | def _ontimer(self, fun, t): |
|---|
| 719 | n/a | """Install a timer, which calls fun after t milliseconds. |
|---|
| 720 | n/a | """ |
|---|
| 721 | n/a | if t == 0: |
|---|
| 722 | n/a | self.cv.after_idle(fun) |
|---|
| 723 | n/a | else: |
|---|
| 724 | n/a | self.cv.after(t, fun) |
|---|
| 725 | n/a | |
|---|
| 726 | n/a | def _createimage(self, image): |
|---|
| 727 | n/a | """Create and return image item on canvas. |
|---|
| 728 | n/a | """ |
|---|
| 729 | n/a | return self.cv.create_image(0, 0, image=image) |
|---|
| 730 | n/a | |
|---|
| 731 | n/a | def _drawimage(self, item, (x, y), image): |
|---|
| 732 | n/a | """Configure image item as to draw image object |
|---|
| 733 | n/a | at position (x,y) on canvas) |
|---|
| 734 | n/a | """ |
|---|
| 735 | n/a | self.cv.coords(item, (x * self.xscale, -y * self.yscale)) |
|---|
| 736 | n/a | self.cv.itemconfig(item, image=image) |
|---|
| 737 | n/a | |
|---|
| 738 | n/a | def _setbgpic(self, item, image): |
|---|
| 739 | n/a | """Configure image item as to draw image object |
|---|
| 740 | n/a | at center of canvas. Set item to the first item |
|---|
| 741 | n/a | in the displaylist, so it will be drawn below |
|---|
| 742 | n/a | any other item .""" |
|---|
| 743 | n/a | self.cv.itemconfig(item, image=image) |
|---|
| 744 | n/a | self.cv.tag_lower(item) |
|---|
| 745 | n/a | |
|---|
| 746 | n/a | def _type(self, item): |
|---|
| 747 | n/a | """Return 'line' or 'polygon' or 'image' depending on |
|---|
| 748 | n/a | type of item. |
|---|
| 749 | n/a | """ |
|---|
| 750 | n/a | return self.cv.type(item) |
|---|
| 751 | n/a | |
|---|
| 752 | n/a | def _pointlist(self, item): |
|---|
| 753 | n/a | """returns list of coordinate-pairs of points of item |
|---|
| 754 | n/a | Example (for insiders): |
|---|
| 755 | n/a | >>> from turtle import * |
|---|
| 756 | n/a | >>> getscreen()._pointlist(getturtle().turtle._item) |
|---|
| 757 | n/a | [(0.0, 9.9999999999999982), (0.0, -9.9999999999999982), |
|---|
| 758 | n/a | (9.9999999999999982, 0.0)] |
|---|
| 759 | n/a | >>> """ |
|---|
| 760 | n/a | cl = self.cv.coords(item) |
|---|
| 761 | n/a | pl = [(cl[i], -cl[i+1]) for i in range(0, len(cl), 2)] |
|---|
| 762 | n/a | return pl |
|---|
| 763 | n/a | |
|---|
| 764 | n/a | def _setscrollregion(self, srx1, sry1, srx2, sry2): |
|---|
| 765 | n/a | self.cv.config(scrollregion=(srx1, sry1, srx2, sry2)) |
|---|
| 766 | n/a | |
|---|
| 767 | n/a | def _rescale(self, xscalefactor, yscalefactor): |
|---|
| 768 | n/a | items = self.cv.find_all() |
|---|
| 769 | n/a | for item in items: |
|---|
| 770 | n/a | coordinates = self.cv.coords(item) |
|---|
| 771 | n/a | newcoordlist = [] |
|---|
| 772 | n/a | while coordinates: |
|---|
| 773 | n/a | x, y = coordinates[:2] |
|---|
| 774 | n/a | newcoordlist.append(x * xscalefactor) |
|---|
| 775 | n/a | newcoordlist.append(y * yscalefactor) |
|---|
| 776 | n/a | coordinates = coordinates[2:] |
|---|
| 777 | n/a | self.cv.coords(item, *newcoordlist) |
|---|
| 778 | n/a | |
|---|
| 779 | n/a | def _resize(self, canvwidth=None, canvheight=None, bg=None): |
|---|
| 780 | n/a | """Resize the canvas the turtles are drawing on. Does |
|---|
| 781 | n/a | not alter the drawing window. |
|---|
| 782 | n/a | """ |
|---|
| 783 | n/a | # needs amendment |
|---|
| 784 | n/a | if not isinstance(self.cv, ScrolledCanvas): |
|---|
| 785 | n/a | return self.canvwidth, self.canvheight |
|---|
| 786 | n/a | if canvwidth is canvheight is bg is None: |
|---|
| 787 | n/a | return self.cv.canvwidth, self.cv.canvheight |
|---|
| 788 | n/a | if canvwidth is not None: |
|---|
| 789 | n/a | self.canvwidth = canvwidth |
|---|
| 790 | n/a | if canvheight is not None: |
|---|
| 791 | n/a | self.canvheight = canvheight |
|---|
| 792 | n/a | self.cv.reset(canvwidth, canvheight, bg) |
|---|
| 793 | n/a | |
|---|
| 794 | n/a | def _window_size(self): |
|---|
| 795 | n/a | """ Return the width and height of the turtle window. |
|---|
| 796 | n/a | """ |
|---|
| 797 | n/a | width = self.cv.winfo_width() |
|---|
| 798 | n/a | if width <= 1: # the window isn't managed by a geometry manager |
|---|
| 799 | n/a | width = self.cv['width'] |
|---|
| 800 | n/a | height = self.cv.winfo_height() |
|---|
| 801 | n/a | if height <= 1: # the window isn't managed by a geometry manager |
|---|
| 802 | n/a | height = self.cv['height'] |
|---|
| 803 | n/a | return width, height |
|---|
| 804 | n/a | |
|---|
| 805 | n/a | |
|---|
| 806 | n/a | ############################################################################## |
|---|
| 807 | n/a | ### End of Tkinter - interface ### |
|---|
| 808 | n/a | ############################################################################## |
|---|
| 809 | n/a | |
|---|
| 810 | n/a | |
|---|
| 811 | n/a | class Terminator (Exception): |
|---|
| 812 | n/a | """Will be raised in TurtleScreen.update, if _RUNNING becomes False. |
|---|
| 813 | n/a | |
|---|
| 814 | n/a | Thus stops execution of turtle graphics script. Main purpose: use in |
|---|
| 815 | n/a | in the Demo-Viewer turtle.Demo.py. |
|---|
| 816 | n/a | """ |
|---|
| 817 | n/a | pass |
|---|
| 818 | n/a | |
|---|
| 819 | n/a | |
|---|
| 820 | n/a | class TurtleGraphicsError(Exception): |
|---|
| 821 | n/a | """Some TurtleGraphics Error |
|---|
| 822 | n/a | """ |
|---|
| 823 | n/a | |
|---|
| 824 | n/a | |
|---|
| 825 | n/a | class Shape(object): |
|---|
| 826 | n/a | """Data structure modeling shapes. |
|---|
| 827 | n/a | |
|---|
| 828 | n/a | attribute _type is one of "polygon", "image", "compound" |
|---|
| 829 | n/a | attribute _data is - depending on _type a poygon-tuple, |
|---|
| 830 | n/a | an image or a list constructed using the addcomponent method. |
|---|
| 831 | n/a | """ |
|---|
| 832 | n/a | def __init__(self, type_, data=None): |
|---|
| 833 | n/a | self._type = type_ |
|---|
| 834 | n/a | if type_ == "polygon": |
|---|
| 835 | n/a | if isinstance(data, list): |
|---|
| 836 | n/a | data = tuple(data) |
|---|
| 837 | n/a | elif type_ == "image": |
|---|
| 838 | n/a | if isinstance(data, str): |
|---|
| 839 | n/a | if data.lower().endswith(".gif") and isfile(data): |
|---|
| 840 | n/a | data = TurtleScreen._image(data) |
|---|
| 841 | n/a | # else data assumed to be Photoimage |
|---|
| 842 | n/a | elif type_ == "compound": |
|---|
| 843 | n/a | data = [] |
|---|
| 844 | n/a | else: |
|---|
| 845 | n/a | raise TurtleGraphicsError("There is no shape type %s" % type_) |
|---|
| 846 | n/a | self._data = data |
|---|
| 847 | n/a | |
|---|
| 848 | n/a | def addcomponent(self, poly, fill, outline=None): |
|---|
| 849 | n/a | """Add component to a shape of type compound. |
|---|
| 850 | n/a | |
|---|
| 851 | n/a | Arguments: poly is a polygon, i. e. a tuple of number pairs. |
|---|
| 852 | n/a | fill is the fillcolor of the component, |
|---|
| 853 | n/a | outline is the outline color of the component. |
|---|
| 854 | n/a | |
|---|
| 855 | n/a | call (for a Shapeobject namend s): |
|---|
| 856 | n/a | -- s.addcomponent(((0,0), (10,10), (-10,10)), "red", "blue") |
|---|
| 857 | n/a | |
|---|
| 858 | n/a | Example: |
|---|
| 859 | n/a | >>> poly = ((0,0),(10,-5),(0,10),(-10,-5)) |
|---|
| 860 | n/a | >>> s = Shape("compound") |
|---|
| 861 | n/a | >>> s.addcomponent(poly, "red", "blue") |
|---|
| 862 | n/a | ### .. add more components and then use register_shape() |
|---|
| 863 | n/a | """ |
|---|
| 864 | n/a | if self._type != "compound": |
|---|
| 865 | n/a | raise TurtleGraphicsError("Cannot add component to %s Shape" |
|---|
| 866 | n/a | % self._type) |
|---|
| 867 | n/a | if outline is None: |
|---|
| 868 | n/a | outline = fill |
|---|
| 869 | n/a | self._data.append([poly, fill, outline]) |
|---|
| 870 | n/a | |
|---|
| 871 | n/a | |
|---|
| 872 | n/a | class Tbuffer(object): |
|---|
| 873 | n/a | """Ring buffer used as undobuffer for RawTurtle objects.""" |
|---|
| 874 | n/a | def __init__(self, bufsize=10): |
|---|
| 875 | n/a | self.bufsize = bufsize |
|---|
| 876 | n/a | self.buffer = [[None]] * bufsize |
|---|
| 877 | n/a | self.ptr = -1 |
|---|
| 878 | n/a | self.cumulate = False |
|---|
| 879 | n/a | def reset(self, bufsize=None): |
|---|
| 880 | n/a | if bufsize is None: |
|---|
| 881 | n/a | for i in range(self.bufsize): |
|---|
| 882 | n/a | self.buffer[i] = [None] |
|---|
| 883 | n/a | else: |
|---|
| 884 | n/a | self.bufsize = bufsize |
|---|
| 885 | n/a | self.buffer = [[None]] * bufsize |
|---|
| 886 | n/a | self.ptr = -1 |
|---|
| 887 | n/a | def push(self, item): |
|---|
| 888 | n/a | if self.bufsize > 0: |
|---|
| 889 | n/a | if not self.cumulate: |
|---|
| 890 | n/a | self.ptr = (self.ptr + 1) % self.bufsize |
|---|
| 891 | n/a | self.buffer[self.ptr] = item |
|---|
| 892 | n/a | else: |
|---|
| 893 | n/a | self.buffer[self.ptr].append(item) |
|---|
| 894 | n/a | def pop(self): |
|---|
| 895 | n/a | if self.bufsize > 0: |
|---|
| 896 | n/a | item = self.buffer[self.ptr] |
|---|
| 897 | n/a | if item is None: |
|---|
| 898 | n/a | return None |
|---|
| 899 | n/a | else: |
|---|
| 900 | n/a | self.buffer[self.ptr] = [None] |
|---|
| 901 | n/a | self.ptr = (self.ptr - 1) % self.bufsize |
|---|
| 902 | n/a | return (item) |
|---|
| 903 | n/a | def nr_of_items(self): |
|---|
| 904 | n/a | return self.bufsize - self.buffer.count([None]) |
|---|
| 905 | n/a | def __repr__(self): |
|---|
| 906 | n/a | return str(self.buffer) + " " + str(self.ptr) |
|---|
| 907 | n/a | |
|---|
| 908 | n/a | |
|---|
| 909 | n/a | |
|---|
| 910 | n/a | class TurtleScreen(TurtleScreenBase): |
|---|
| 911 | n/a | """Provides screen oriented methods like setbg etc. |
|---|
| 912 | n/a | |
|---|
| 913 | n/a | Only relies upon the methods of TurtleScreenBase and NOT |
|---|
| 914 | n/a | upon components of the underlying graphics toolkit - |
|---|
| 915 | n/a | which is Tkinter in this case. |
|---|
| 916 | n/a | """ |
|---|
| 917 | n/a | # _STANDARD_DELAY = 5 |
|---|
| 918 | n/a | _RUNNING = True |
|---|
| 919 | n/a | |
|---|
| 920 | n/a | def __init__(self, cv, mode=_CFG["mode"], |
|---|
| 921 | n/a | colormode=_CFG["colormode"], delay=_CFG["delay"]): |
|---|
| 922 | n/a | self._shapes = { |
|---|
| 923 | n/a | "arrow" : Shape("polygon", ((-10,0), (10,0), (0,10))), |
|---|
| 924 | n/a | "turtle" : Shape("polygon", ((0,16), (-2,14), (-1,10), (-4,7), |
|---|
| 925 | n/a | (-7,9), (-9,8), (-6,5), (-7,1), (-5,-3), (-8,-6), |
|---|
| 926 | n/a | (-6,-8), (-4,-5), (0,-7), (4,-5), (6,-8), (8,-6), |
|---|
| 927 | n/a | (5,-3), (7,1), (6,5), (9,8), (7,9), (4,7), (1,10), |
|---|
| 928 | n/a | (2,14))), |
|---|
| 929 | n/a | "circle" : Shape("polygon", ((10,0), (9.51,3.09), (8.09,5.88), |
|---|
| 930 | n/a | (5.88,8.09), (3.09,9.51), (0,10), (-3.09,9.51), |
|---|
| 931 | n/a | (-5.88,8.09), (-8.09,5.88), (-9.51,3.09), (-10,0), |
|---|
| 932 | n/a | (-9.51,-3.09), (-8.09,-5.88), (-5.88,-8.09), |
|---|
| 933 | n/a | (-3.09,-9.51), (-0.00,-10.00), (3.09,-9.51), |
|---|
| 934 | n/a | (5.88,-8.09), (8.09,-5.88), (9.51,-3.09))), |
|---|
| 935 | n/a | "square" : Shape("polygon", ((10,-10), (10,10), (-10,10), |
|---|
| 936 | n/a | (-10,-10))), |
|---|
| 937 | n/a | "triangle" : Shape("polygon", ((10,-5.77), (0,11.55), |
|---|
| 938 | n/a | (-10,-5.77))), |
|---|
| 939 | n/a | "classic": Shape("polygon", ((0,0),(-5,-9),(0,-7),(5,-9))), |
|---|
| 940 | n/a | "blank" : Shape("image", self._blankimage()) |
|---|
| 941 | n/a | } |
|---|
| 942 | n/a | |
|---|
| 943 | n/a | self._bgpics = {"nopic" : ""} |
|---|
| 944 | n/a | |
|---|
| 945 | n/a | TurtleScreenBase.__init__(self, cv) |
|---|
| 946 | n/a | self._mode = mode |
|---|
| 947 | n/a | self._delayvalue = delay |
|---|
| 948 | n/a | self._colormode = _CFG["colormode"] |
|---|
| 949 | n/a | self._keys = [] |
|---|
| 950 | n/a | self.clear() |
|---|
| 951 | n/a | |
|---|
| 952 | n/a | def clear(self): |
|---|
| 953 | n/a | """Delete all drawings and all turtles from the TurtleScreen. |
|---|
| 954 | n/a | |
|---|
| 955 | n/a | Reset empty TurtleScreen to its initial state: white background, |
|---|
| 956 | n/a | no backgroundimage, no eventbindings and tracing on. |
|---|
| 957 | n/a | |
|---|
| 958 | n/a | No argument. |
|---|
| 959 | n/a | |
|---|
| 960 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 961 | n/a | screen.clear() |
|---|
| 962 | n/a | |
|---|
| 963 | n/a | Note: this method is not available as function. |
|---|
| 964 | n/a | """ |
|---|
| 965 | n/a | self._delayvalue = _CFG["delay"] |
|---|
| 966 | n/a | self._colormode = _CFG["colormode"] |
|---|
| 967 | n/a | self._delete("all") |
|---|
| 968 | n/a | self._bgpic = self._createimage("") |
|---|
| 969 | n/a | self._bgpicname = "nopic" |
|---|
| 970 | n/a | self._tracing = 1 |
|---|
| 971 | n/a | self._updatecounter = 0 |
|---|
| 972 | n/a | self._turtles = [] |
|---|
| 973 | n/a | self.bgcolor("white") |
|---|
| 974 | n/a | for btn in 1, 2, 3: |
|---|
| 975 | n/a | self.onclick(None, btn) |
|---|
| 976 | n/a | for key in self._keys[:]: |
|---|
| 977 | n/a | self.onkey(None, key) |
|---|
| 978 | n/a | Turtle._pen = None |
|---|
| 979 | n/a | |
|---|
| 980 | n/a | def mode(self, mode=None): |
|---|
| 981 | n/a | """Set turtle-mode ('standard', 'logo' or 'world') and perform reset. |
|---|
| 982 | n/a | |
|---|
| 983 | n/a | Optional argument: |
|---|
| 984 | n/a | mode -- on of the strings 'standard', 'logo' or 'world' |
|---|
| 985 | n/a | |
|---|
| 986 | n/a | Mode 'standard' is compatible with turtle.py. |
|---|
| 987 | n/a | Mode 'logo' is compatible with most Logo-Turtle-Graphics. |
|---|
| 988 | n/a | Mode 'world' uses userdefined 'worldcoordinates'. *Attention*: in |
|---|
| 989 | n/a | this mode angles appear distorted if x/y unit-ratio doesn't equal 1. |
|---|
| 990 | n/a | If mode is not given, return the current mode. |
|---|
| 991 | n/a | |
|---|
| 992 | n/a | Mode Initial turtle heading positive angles |
|---|
| 993 | n/a | ------------|-------------------------|------------------- |
|---|
| 994 | n/a | 'standard' to the right (east) counterclockwise |
|---|
| 995 | n/a | 'logo' upward (north) clockwise |
|---|
| 996 | n/a | |
|---|
| 997 | n/a | Examples: |
|---|
| 998 | n/a | >>> mode('logo') # resets turtle heading to north |
|---|
| 999 | n/a | >>> mode() |
|---|
| 1000 | n/a | 'logo' |
|---|
| 1001 | n/a | """ |
|---|
| 1002 | n/a | if mode is None: |
|---|
| 1003 | n/a | return self._mode |
|---|
| 1004 | n/a | mode = mode.lower() |
|---|
| 1005 | n/a | if mode not in ["standard", "logo", "world"]: |
|---|
| 1006 | n/a | raise TurtleGraphicsError("No turtle-graphics-mode %s" % mode) |
|---|
| 1007 | n/a | self._mode = mode |
|---|
| 1008 | n/a | if mode in ["standard", "logo"]: |
|---|
| 1009 | n/a | self._setscrollregion(-self.canvwidth//2, -self.canvheight//2, |
|---|
| 1010 | n/a | self.canvwidth//2, self.canvheight//2) |
|---|
| 1011 | n/a | self.xscale = self.yscale = 1.0 |
|---|
| 1012 | n/a | self.reset() |
|---|
| 1013 | n/a | |
|---|
| 1014 | n/a | def setworldcoordinates(self, llx, lly, urx, ury): |
|---|
| 1015 | n/a | """Set up a user defined coordinate-system. |
|---|
| 1016 | n/a | |
|---|
| 1017 | n/a | Arguments: |
|---|
| 1018 | n/a | llx -- a number, x-coordinate of lower left corner of canvas |
|---|
| 1019 | n/a | lly -- a number, y-coordinate of lower left corner of canvas |
|---|
| 1020 | n/a | urx -- a number, x-coordinate of upper right corner of canvas |
|---|
| 1021 | n/a | ury -- a number, y-coordinate of upper right corner of canvas |
|---|
| 1022 | n/a | |
|---|
| 1023 | n/a | Set up user coodinat-system and switch to mode 'world' if necessary. |
|---|
| 1024 | n/a | This performs a screen.reset. If mode 'world' is already active, |
|---|
| 1025 | n/a | all drawings are redrawn according to the new coordinates. |
|---|
| 1026 | n/a | |
|---|
| 1027 | n/a | But ATTENTION: in user-defined coordinatesystems angles may appear |
|---|
| 1028 | n/a | distorted. (see Screen.mode()) |
|---|
| 1029 | n/a | |
|---|
| 1030 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1031 | n/a | >>> screen.setworldcoordinates(-10,-0.5,50,1.5) |
|---|
| 1032 | n/a | >>> for _ in range(36): |
|---|
| 1033 | n/a | left(10) |
|---|
| 1034 | n/a | forward(0.5) |
|---|
| 1035 | n/a | """ |
|---|
| 1036 | n/a | if self.mode() != "world": |
|---|
| 1037 | n/a | self.mode("world") |
|---|
| 1038 | n/a | xspan = float(urx - llx) |
|---|
| 1039 | n/a | yspan = float(ury - lly) |
|---|
| 1040 | n/a | wx, wy = self._window_size() |
|---|
| 1041 | n/a | self.screensize(wx-20, wy-20) |
|---|
| 1042 | n/a | oldxscale, oldyscale = self.xscale, self.yscale |
|---|
| 1043 | n/a | self.xscale = self.canvwidth / xspan |
|---|
| 1044 | n/a | self.yscale = self.canvheight / yspan |
|---|
| 1045 | n/a | srx1 = llx * self.xscale |
|---|
| 1046 | n/a | sry1 = -ury * self.yscale |
|---|
| 1047 | n/a | srx2 = self.canvwidth + srx1 |
|---|
| 1048 | n/a | sry2 = self.canvheight + sry1 |
|---|
| 1049 | n/a | self._setscrollregion(srx1, sry1, srx2, sry2) |
|---|
| 1050 | n/a | self._rescale(self.xscale/oldxscale, self.yscale/oldyscale) |
|---|
| 1051 | n/a | self.update() |
|---|
| 1052 | n/a | |
|---|
| 1053 | n/a | def register_shape(self, name, shape=None): |
|---|
| 1054 | n/a | """Adds a turtle shape to TurtleScreen's shapelist. |
|---|
| 1055 | n/a | |
|---|
| 1056 | n/a | Arguments: |
|---|
| 1057 | n/a | (1) name is the name of a gif-file and shape is None. |
|---|
| 1058 | n/a | Installs the corresponding image shape. |
|---|
| 1059 | n/a | !! Image-shapes DO NOT rotate when turning the turtle, |
|---|
| 1060 | n/a | !! so they do not display the heading of the turtle! |
|---|
| 1061 | n/a | (2) name is an arbitrary string and shape is a tuple |
|---|
| 1062 | n/a | of pairs of coordinates. Installs the corresponding |
|---|
| 1063 | n/a | polygon shape |
|---|
| 1064 | n/a | (3) name is an arbitrary string and shape is a |
|---|
| 1065 | n/a | (compound) Shape object. Installs the corresponding |
|---|
| 1066 | n/a | compound shape. |
|---|
| 1067 | n/a | To use a shape, you have to issue the command shape(shapename). |
|---|
| 1068 | n/a | |
|---|
| 1069 | n/a | call: register_shape("turtle.gif") |
|---|
| 1070 | n/a | --or: register_shape("tri", ((0,0), (10,10), (-10,10))) |
|---|
| 1071 | n/a | |
|---|
| 1072 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1073 | n/a | >>> screen.register_shape("triangle", ((5,-3),(0,5),(-5,-3))) |
|---|
| 1074 | n/a | |
|---|
| 1075 | n/a | """ |
|---|
| 1076 | n/a | if shape is None: |
|---|
| 1077 | n/a | # image |
|---|
| 1078 | n/a | if name.lower().endswith(".gif"): |
|---|
| 1079 | n/a | shape = Shape("image", self._image(name)) |
|---|
| 1080 | n/a | else: |
|---|
| 1081 | n/a | raise TurtleGraphicsError("Bad arguments for register_shape.\n" |
|---|
| 1082 | n/a | + "Use help(register_shape)" ) |
|---|
| 1083 | n/a | elif isinstance(shape, tuple): |
|---|
| 1084 | n/a | shape = Shape("polygon", shape) |
|---|
| 1085 | n/a | ## else shape assumed to be Shape-instance |
|---|
| 1086 | n/a | self._shapes[name] = shape |
|---|
| 1087 | n/a | # print "shape added:" , self._shapes |
|---|
| 1088 | n/a | |
|---|
| 1089 | n/a | def _colorstr(self, color): |
|---|
| 1090 | n/a | """Return color string corresponding to args. |
|---|
| 1091 | n/a | |
|---|
| 1092 | n/a | Argument may be a string or a tuple of three |
|---|
| 1093 | n/a | numbers corresponding to actual colormode, |
|---|
| 1094 | n/a | i.e. in the range 0<=n<=colormode. |
|---|
| 1095 | n/a | |
|---|
| 1096 | n/a | If the argument doesn't represent a color, |
|---|
| 1097 | n/a | an error is raised. |
|---|
| 1098 | n/a | """ |
|---|
| 1099 | n/a | if len(color) == 1: |
|---|
| 1100 | n/a | color = color[0] |
|---|
| 1101 | n/a | if isinstance(color, str): |
|---|
| 1102 | n/a | if self._iscolorstring(color) or color == "": |
|---|
| 1103 | n/a | return color |
|---|
| 1104 | n/a | else: |
|---|
| 1105 | n/a | raise TurtleGraphicsError("bad color string: %s" % str(color)) |
|---|
| 1106 | n/a | try: |
|---|
| 1107 | n/a | r, g, b = color |
|---|
| 1108 | n/a | except: |
|---|
| 1109 | n/a | raise TurtleGraphicsError("bad color arguments: %s" % str(color)) |
|---|
| 1110 | n/a | if self._colormode == 1.0: |
|---|
| 1111 | n/a | r, g, b = [round(255.0*x) for x in (r, g, b)] |
|---|
| 1112 | n/a | if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)): |
|---|
| 1113 | n/a | raise TurtleGraphicsError("bad color sequence: %s" % str(color)) |
|---|
| 1114 | n/a | return "#%02x%02x%02x" % (r, g, b) |
|---|
| 1115 | n/a | |
|---|
| 1116 | n/a | def _color(self, cstr): |
|---|
| 1117 | n/a | if not cstr.startswith("#"): |
|---|
| 1118 | n/a | return cstr |
|---|
| 1119 | n/a | if len(cstr) == 7: |
|---|
| 1120 | n/a | cl = [int(cstr[i:i+2], 16) for i in (1, 3, 5)] |
|---|
| 1121 | n/a | elif len(cstr) == 4: |
|---|
| 1122 | n/a | cl = [16*int(cstr[h], 16) for h in cstr[1:]] |
|---|
| 1123 | n/a | else: |
|---|
| 1124 | n/a | raise TurtleGraphicsError("bad colorstring: %s" % cstr) |
|---|
| 1125 | n/a | return tuple([c * self._colormode/255 for c in cl]) |
|---|
| 1126 | n/a | |
|---|
| 1127 | n/a | def colormode(self, cmode=None): |
|---|
| 1128 | n/a | """Return the colormode or set it to 1.0 or 255. |
|---|
| 1129 | n/a | |
|---|
| 1130 | n/a | Optional argument: |
|---|
| 1131 | n/a | cmode -- one of the values 1.0 or 255 |
|---|
| 1132 | n/a | |
|---|
| 1133 | n/a | r, g, b values of colortriples have to be in range 0..cmode. |
|---|
| 1134 | n/a | |
|---|
| 1135 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1136 | n/a | >>> screen.colormode() |
|---|
| 1137 | n/a | 1.0 |
|---|
| 1138 | n/a | >>> screen.colormode(255) |
|---|
| 1139 | n/a | >>> turtle.pencolor(240,160,80) |
|---|
| 1140 | n/a | """ |
|---|
| 1141 | n/a | if cmode is None: |
|---|
| 1142 | n/a | return self._colormode |
|---|
| 1143 | n/a | if cmode == 1.0: |
|---|
| 1144 | n/a | self._colormode = float(cmode) |
|---|
| 1145 | n/a | elif cmode == 255: |
|---|
| 1146 | n/a | self._colormode = int(cmode) |
|---|
| 1147 | n/a | |
|---|
| 1148 | n/a | def reset(self): |
|---|
| 1149 | n/a | """Reset all Turtles on the Screen to their initial state. |
|---|
| 1150 | n/a | |
|---|
| 1151 | n/a | No argument. |
|---|
| 1152 | n/a | |
|---|
| 1153 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1154 | n/a | >>> screen.reset() |
|---|
| 1155 | n/a | """ |
|---|
| 1156 | n/a | for turtle in self._turtles: |
|---|
| 1157 | n/a | turtle._setmode(self._mode) |
|---|
| 1158 | n/a | turtle.reset() |
|---|
| 1159 | n/a | |
|---|
| 1160 | n/a | def turtles(self): |
|---|
| 1161 | n/a | """Return the list of turtles on the screen. |
|---|
| 1162 | n/a | |
|---|
| 1163 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1164 | n/a | >>> screen.turtles() |
|---|
| 1165 | n/a | [<turtle.Turtle object at 0x00E11FB0>] |
|---|
| 1166 | n/a | """ |
|---|
| 1167 | n/a | return self._turtles |
|---|
| 1168 | n/a | |
|---|
| 1169 | n/a | def bgcolor(self, *args): |
|---|
| 1170 | n/a | """Set or return backgroundcolor of the TurtleScreen. |
|---|
| 1171 | n/a | |
|---|
| 1172 | n/a | Arguments (if given): a color string or three numbers |
|---|
| 1173 | n/a | in the range 0..colormode or a 3-tuple of such numbers. |
|---|
| 1174 | n/a | |
|---|
| 1175 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1176 | n/a | >>> screen.bgcolor("orange") |
|---|
| 1177 | n/a | >>> screen.bgcolor() |
|---|
| 1178 | n/a | 'orange' |
|---|
| 1179 | n/a | >>> screen.bgcolor(0.5,0,0.5) |
|---|
| 1180 | n/a | >>> screen.bgcolor() |
|---|
| 1181 | n/a | '#800080' |
|---|
| 1182 | n/a | """ |
|---|
| 1183 | n/a | if args: |
|---|
| 1184 | n/a | color = self._colorstr(args) |
|---|
| 1185 | n/a | else: |
|---|
| 1186 | n/a | color = None |
|---|
| 1187 | n/a | color = self._bgcolor(color) |
|---|
| 1188 | n/a | if color is not None: |
|---|
| 1189 | n/a | color = self._color(color) |
|---|
| 1190 | n/a | return color |
|---|
| 1191 | n/a | |
|---|
| 1192 | n/a | def tracer(self, n=None, delay=None): |
|---|
| 1193 | n/a | """Turns turtle animation on/off and set delay for update drawings. |
|---|
| 1194 | n/a | |
|---|
| 1195 | n/a | Optional arguments: |
|---|
| 1196 | n/a | n -- nonnegative integer |
|---|
| 1197 | n/a | delay -- nonnegative integer |
|---|
| 1198 | n/a | |
|---|
| 1199 | n/a | If n is given, only each n-th regular screen update is really performed. |
|---|
| 1200 | n/a | (Can be used to accelerate the drawing of complex graphics.) |
|---|
| 1201 | n/a | Second arguments sets delay value (see RawTurtle.delay()) |
|---|
| 1202 | n/a | |
|---|
| 1203 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1204 | n/a | >>> screen.tracer(8, 25) |
|---|
| 1205 | n/a | >>> dist = 2 |
|---|
| 1206 | n/a | >>> for i in range(200): |
|---|
| 1207 | n/a | fd(dist) |
|---|
| 1208 | n/a | rt(90) |
|---|
| 1209 | n/a | dist += 2 |
|---|
| 1210 | n/a | """ |
|---|
| 1211 | n/a | if n is None: |
|---|
| 1212 | n/a | return self._tracing |
|---|
| 1213 | n/a | self._tracing = int(n) |
|---|
| 1214 | n/a | self._updatecounter = 0 |
|---|
| 1215 | n/a | if delay is not None: |
|---|
| 1216 | n/a | self._delayvalue = int(delay) |
|---|
| 1217 | n/a | if self._tracing: |
|---|
| 1218 | n/a | self.update() |
|---|
| 1219 | n/a | |
|---|
| 1220 | n/a | def delay(self, delay=None): |
|---|
| 1221 | n/a | """ Return or set the drawing delay in milliseconds. |
|---|
| 1222 | n/a | |
|---|
| 1223 | n/a | Optional argument: |
|---|
| 1224 | n/a | delay -- positive integer |
|---|
| 1225 | n/a | |
|---|
| 1226 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1227 | n/a | >>> screen.delay(15) |
|---|
| 1228 | n/a | >>> screen.delay() |
|---|
| 1229 | n/a | 15 |
|---|
| 1230 | n/a | """ |
|---|
| 1231 | n/a | if delay is None: |
|---|
| 1232 | n/a | return self._delayvalue |
|---|
| 1233 | n/a | self._delayvalue = int(delay) |
|---|
| 1234 | n/a | |
|---|
| 1235 | n/a | def _incrementudc(self): |
|---|
| 1236 | n/a | "Increment upadate counter.""" |
|---|
| 1237 | n/a | if not TurtleScreen._RUNNING: |
|---|
| 1238 | n/a | TurtleScreen._RUNNNING = True |
|---|
| 1239 | n/a | raise Terminator |
|---|
| 1240 | n/a | if self._tracing > 0: |
|---|
| 1241 | n/a | self._updatecounter += 1 |
|---|
| 1242 | n/a | self._updatecounter %= self._tracing |
|---|
| 1243 | n/a | |
|---|
| 1244 | n/a | def update(self): |
|---|
| 1245 | n/a | """Perform a TurtleScreen update. |
|---|
| 1246 | n/a | """ |
|---|
| 1247 | n/a | tracing = self._tracing |
|---|
| 1248 | n/a | self._tracing = True |
|---|
| 1249 | n/a | for t in self.turtles(): |
|---|
| 1250 | n/a | t._update_data() |
|---|
| 1251 | n/a | t._drawturtle() |
|---|
| 1252 | n/a | self._tracing = tracing |
|---|
| 1253 | n/a | self._update() |
|---|
| 1254 | n/a | |
|---|
| 1255 | n/a | def window_width(self): |
|---|
| 1256 | n/a | """ Return the width of the turtle window. |
|---|
| 1257 | n/a | |
|---|
| 1258 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1259 | n/a | >>> screen.window_width() |
|---|
| 1260 | n/a | 640 |
|---|
| 1261 | n/a | """ |
|---|
| 1262 | n/a | return self._window_size()[0] |
|---|
| 1263 | n/a | |
|---|
| 1264 | n/a | def window_height(self): |
|---|
| 1265 | n/a | """ Return the height of the turtle window. |
|---|
| 1266 | n/a | |
|---|
| 1267 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1268 | n/a | >>> screen.window_height() |
|---|
| 1269 | n/a | 480 |
|---|
| 1270 | n/a | """ |
|---|
| 1271 | n/a | return self._window_size()[1] |
|---|
| 1272 | n/a | |
|---|
| 1273 | n/a | def getcanvas(self): |
|---|
| 1274 | n/a | """Return the Canvas of this TurtleScreen. |
|---|
| 1275 | n/a | |
|---|
| 1276 | n/a | No argument. |
|---|
| 1277 | n/a | |
|---|
| 1278 | n/a | Example (for a Screen instance named screen): |
|---|
| 1279 | n/a | >>> cv = screen.getcanvas() |
|---|
| 1280 | n/a | >>> cv |
|---|
| 1281 | n/a | <turtle.ScrolledCanvas instance at 0x010742D8> |
|---|
| 1282 | n/a | """ |
|---|
| 1283 | n/a | return self.cv |
|---|
| 1284 | n/a | |
|---|
| 1285 | n/a | def getshapes(self): |
|---|
| 1286 | n/a | """Return a list of names of all currently available turtle shapes. |
|---|
| 1287 | n/a | |
|---|
| 1288 | n/a | No argument. |
|---|
| 1289 | n/a | |
|---|
| 1290 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1291 | n/a | >>> screen.getshapes() |
|---|
| 1292 | n/a | ['arrow', 'blank', 'circle', ... , 'turtle'] |
|---|
| 1293 | n/a | """ |
|---|
| 1294 | n/a | return sorted(self._shapes.keys()) |
|---|
| 1295 | n/a | |
|---|
| 1296 | n/a | def onclick(self, fun, btn=1, add=None): |
|---|
| 1297 | n/a | """Bind fun to mouse-click event on canvas. |
|---|
| 1298 | n/a | |
|---|
| 1299 | n/a | Arguments: |
|---|
| 1300 | n/a | fun -- a function with two arguments, the coordinates of the |
|---|
| 1301 | n/a | clicked point on the canvas. |
|---|
| 1302 | n/a | num -- the number of the mouse-button, defaults to 1 |
|---|
| 1303 | n/a | |
|---|
| 1304 | n/a | Example (for a TurtleScreen instance named screen |
|---|
| 1305 | n/a | and a Turtle instance named turtle): |
|---|
| 1306 | n/a | |
|---|
| 1307 | n/a | >>> screen.onclick(turtle.goto) |
|---|
| 1308 | n/a | |
|---|
| 1309 | n/a | ### Subsequently clicking into the TurtleScreen will |
|---|
| 1310 | n/a | ### make the turtle move to the clicked point. |
|---|
| 1311 | n/a | >>> screen.onclick(None) |
|---|
| 1312 | n/a | |
|---|
| 1313 | n/a | ### event-binding will be removed |
|---|
| 1314 | n/a | """ |
|---|
| 1315 | n/a | self._onscreenclick(fun, btn, add) |
|---|
| 1316 | n/a | |
|---|
| 1317 | n/a | def onkey(self, fun, key): |
|---|
| 1318 | n/a | """Bind fun to key-release event of key. |
|---|
| 1319 | n/a | |
|---|
| 1320 | n/a | Arguments: |
|---|
| 1321 | n/a | fun -- a function with no arguments |
|---|
| 1322 | n/a | key -- a string: key (e.g. "a") or key-symbol (e.g. "space") |
|---|
| 1323 | n/a | |
|---|
| 1324 | n/a | In order to be able to register key-events, TurtleScreen |
|---|
| 1325 | n/a | must have focus. (See method listen.) |
|---|
| 1326 | n/a | |
|---|
| 1327 | n/a | Example (for a TurtleScreen instance named screen |
|---|
| 1328 | n/a | and a Turtle instance named turtle): |
|---|
| 1329 | n/a | |
|---|
| 1330 | n/a | >>> def f(): |
|---|
| 1331 | n/a | fd(50) |
|---|
| 1332 | n/a | lt(60) |
|---|
| 1333 | n/a | |
|---|
| 1334 | n/a | |
|---|
| 1335 | n/a | >>> screen.onkey(f, "Up") |
|---|
| 1336 | n/a | >>> screen.listen() |
|---|
| 1337 | n/a | |
|---|
| 1338 | n/a | ### Subsequently the turtle can be moved by |
|---|
| 1339 | n/a | ### repeatedly pressing the up-arrow key, |
|---|
| 1340 | n/a | ### consequently drawing a hexagon |
|---|
| 1341 | n/a | """ |
|---|
| 1342 | n/a | if fun is None: |
|---|
| 1343 | n/a | if key in self._keys: |
|---|
| 1344 | n/a | self._keys.remove(key) |
|---|
| 1345 | n/a | elif key not in self._keys: |
|---|
| 1346 | n/a | self._keys.append(key) |
|---|
| 1347 | n/a | self._onkey(fun, key) |
|---|
| 1348 | n/a | |
|---|
| 1349 | n/a | def listen(self, xdummy=None, ydummy=None): |
|---|
| 1350 | n/a | """Set focus on TurtleScreen (in order to collect key-events) |
|---|
| 1351 | n/a | |
|---|
| 1352 | n/a | No arguments. |
|---|
| 1353 | n/a | Dummy arguments are provided in order |
|---|
| 1354 | n/a | to be able to pass listen to the onclick method. |
|---|
| 1355 | n/a | |
|---|
| 1356 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1357 | n/a | >>> screen.listen() |
|---|
| 1358 | n/a | """ |
|---|
| 1359 | n/a | self._listen() |
|---|
| 1360 | n/a | |
|---|
| 1361 | n/a | def ontimer(self, fun, t=0): |
|---|
| 1362 | n/a | """Install a timer, which calls fun after t milliseconds. |
|---|
| 1363 | n/a | |
|---|
| 1364 | n/a | Arguments: |
|---|
| 1365 | n/a | fun -- a function with no arguments. |
|---|
| 1366 | n/a | t -- a number >= 0 |
|---|
| 1367 | n/a | |
|---|
| 1368 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1369 | n/a | |
|---|
| 1370 | n/a | >>> running = True |
|---|
| 1371 | n/a | >>> def f(): |
|---|
| 1372 | n/a | if running: |
|---|
| 1373 | n/a | fd(50) |
|---|
| 1374 | n/a | lt(60) |
|---|
| 1375 | n/a | screen.ontimer(f, 250) |
|---|
| 1376 | n/a | |
|---|
| 1377 | n/a | >>> f() ### makes the turtle marching around |
|---|
| 1378 | n/a | >>> running = False |
|---|
| 1379 | n/a | """ |
|---|
| 1380 | n/a | self._ontimer(fun, t) |
|---|
| 1381 | n/a | |
|---|
| 1382 | n/a | def bgpic(self, picname=None): |
|---|
| 1383 | n/a | """Set background image or return name of current backgroundimage. |
|---|
| 1384 | n/a | |
|---|
| 1385 | n/a | Optional argument: |
|---|
| 1386 | n/a | picname -- a string, name of a gif-file or "nopic". |
|---|
| 1387 | n/a | |
|---|
| 1388 | n/a | If picname is a filename, set the corresponing image as background. |
|---|
| 1389 | n/a | If picname is "nopic", delete backgroundimage, if present. |
|---|
| 1390 | n/a | If picname is None, return the filename of the current backgroundimage. |
|---|
| 1391 | n/a | |
|---|
| 1392 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 1393 | n/a | >>> screen.bgpic() |
|---|
| 1394 | n/a | 'nopic' |
|---|
| 1395 | n/a | >>> screen.bgpic("landscape.gif") |
|---|
| 1396 | n/a | >>> screen.bgpic() |
|---|
| 1397 | n/a | 'landscape.gif' |
|---|
| 1398 | n/a | """ |
|---|
| 1399 | n/a | if picname is None: |
|---|
| 1400 | n/a | return self._bgpicname |
|---|
| 1401 | n/a | if picname not in self._bgpics: |
|---|
| 1402 | n/a | self._bgpics[picname] = self._image(picname) |
|---|
| 1403 | n/a | self._setbgpic(self._bgpic, self._bgpics[picname]) |
|---|
| 1404 | n/a | self._bgpicname = picname |
|---|
| 1405 | n/a | |
|---|
| 1406 | n/a | def screensize(self, canvwidth=None, canvheight=None, bg=None): |
|---|
| 1407 | n/a | """Resize the canvas the turtles are drawing on. |
|---|
| 1408 | n/a | |
|---|
| 1409 | n/a | Optional arguments: |
|---|
| 1410 | n/a | canvwidth -- positive integer, new width of canvas in pixels |
|---|
| 1411 | n/a | canvheight -- positive integer, new height of canvas in pixels |
|---|
| 1412 | n/a | bg -- colorstring or color-tupel, new backgroundcolor |
|---|
| 1413 | n/a | If no arguments are given, return current (canvaswidth, canvasheight) |
|---|
| 1414 | n/a | |
|---|
| 1415 | n/a | Do not alter the drawing window. To observe hidden parts of |
|---|
| 1416 | n/a | the canvas use the scrollbars. (Can make visible those parts |
|---|
| 1417 | n/a | of a drawing, which were outside the canvas before!) |
|---|
| 1418 | n/a | |
|---|
| 1419 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1420 | n/a | >>> turtle.screensize(2000,1500) |
|---|
| 1421 | n/a | ### e. g. to search for an erroneously escaped turtle ;-) |
|---|
| 1422 | n/a | """ |
|---|
| 1423 | n/a | return self._resize(canvwidth, canvheight, bg) |
|---|
| 1424 | n/a | |
|---|
| 1425 | n/a | onscreenclick = onclick |
|---|
| 1426 | n/a | resetscreen = reset |
|---|
| 1427 | n/a | clearscreen = clear |
|---|
| 1428 | n/a | addshape = register_shape |
|---|
| 1429 | n/a | |
|---|
| 1430 | n/a | class TNavigator(object): |
|---|
| 1431 | n/a | """Navigation part of the RawTurtle. |
|---|
| 1432 | n/a | Implements methods for turtle movement. |
|---|
| 1433 | n/a | """ |
|---|
| 1434 | n/a | START_ORIENTATION = { |
|---|
| 1435 | n/a | "standard": Vec2D(1.0, 0.0), |
|---|
| 1436 | n/a | "world" : Vec2D(1.0, 0.0), |
|---|
| 1437 | n/a | "logo" : Vec2D(0.0, 1.0) } |
|---|
| 1438 | n/a | DEFAULT_MODE = "standard" |
|---|
| 1439 | n/a | DEFAULT_ANGLEOFFSET = 0 |
|---|
| 1440 | n/a | DEFAULT_ANGLEORIENT = 1 |
|---|
| 1441 | n/a | |
|---|
| 1442 | n/a | def __init__(self, mode=DEFAULT_MODE): |
|---|
| 1443 | n/a | self._angleOffset = self.DEFAULT_ANGLEOFFSET |
|---|
| 1444 | n/a | self._angleOrient = self.DEFAULT_ANGLEORIENT |
|---|
| 1445 | n/a | self._mode = mode |
|---|
| 1446 | n/a | self.undobuffer = None |
|---|
| 1447 | n/a | self.degrees() |
|---|
| 1448 | n/a | self._mode = None |
|---|
| 1449 | n/a | self._setmode(mode) |
|---|
| 1450 | n/a | TNavigator.reset(self) |
|---|
| 1451 | n/a | |
|---|
| 1452 | n/a | def reset(self): |
|---|
| 1453 | n/a | """reset turtle to its initial values |
|---|
| 1454 | n/a | |
|---|
| 1455 | n/a | Will be overwritten by parent class |
|---|
| 1456 | n/a | """ |
|---|
| 1457 | n/a | self._position = Vec2D(0.0, 0.0) |
|---|
| 1458 | n/a | self._orient = TNavigator.START_ORIENTATION[self._mode] |
|---|
| 1459 | n/a | |
|---|
| 1460 | n/a | def _setmode(self, mode=None): |
|---|
| 1461 | n/a | """Set turtle-mode to 'standard', 'world' or 'logo'. |
|---|
| 1462 | n/a | """ |
|---|
| 1463 | n/a | if mode is None: |
|---|
| 1464 | n/a | return self._mode |
|---|
| 1465 | n/a | if mode not in ["standard", "logo", "world"]: |
|---|
| 1466 | n/a | return |
|---|
| 1467 | n/a | self._mode = mode |
|---|
| 1468 | n/a | if mode in ["standard", "world"]: |
|---|
| 1469 | n/a | self._angleOffset = 0 |
|---|
| 1470 | n/a | self._angleOrient = 1 |
|---|
| 1471 | n/a | else: # mode == "logo": |
|---|
| 1472 | n/a | self._angleOffset = self._fullcircle/4. |
|---|
| 1473 | n/a | self._angleOrient = -1 |
|---|
| 1474 | n/a | |
|---|
| 1475 | n/a | def _setDegreesPerAU(self, fullcircle): |
|---|
| 1476 | n/a | """Helper function for degrees() and radians()""" |
|---|
| 1477 | n/a | self._fullcircle = fullcircle |
|---|
| 1478 | n/a | self._degreesPerAU = 360/fullcircle |
|---|
| 1479 | n/a | if self._mode == "standard": |
|---|
| 1480 | n/a | self._angleOffset = 0 |
|---|
| 1481 | n/a | else: |
|---|
| 1482 | n/a | self._angleOffset = fullcircle/4. |
|---|
| 1483 | n/a | |
|---|
| 1484 | n/a | def degrees(self, fullcircle=360.0): |
|---|
| 1485 | n/a | """ Set angle measurement units to degrees. |
|---|
| 1486 | n/a | |
|---|
| 1487 | n/a | Optional argument: |
|---|
| 1488 | n/a | fullcircle - a number |
|---|
| 1489 | n/a | |
|---|
| 1490 | n/a | Set angle measurement units, i. e. set number |
|---|
| 1491 | n/a | of 'degrees' for a full circle. Dafault value is |
|---|
| 1492 | n/a | 360 degrees. |
|---|
| 1493 | n/a | |
|---|
| 1494 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1495 | n/a | >>> turtle.left(90) |
|---|
| 1496 | n/a | >>> turtle.heading() |
|---|
| 1497 | n/a | 90 |
|---|
| 1498 | n/a | >>> turtle.degrees(400.0) # angle measurement in gon |
|---|
| 1499 | n/a | >>> turtle.heading() |
|---|
| 1500 | n/a | 100 |
|---|
| 1501 | n/a | |
|---|
| 1502 | n/a | """ |
|---|
| 1503 | n/a | self._setDegreesPerAU(fullcircle) |
|---|
| 1504 | n/a | |
|---|
| 1505 | n/a | def radians(self): |
|---|
| 1506 | n/a | """ Set the angle measurement units to radians. |
|---|
| 1507 | n/a | |
|---|
| 1508 | n/a | No arguments. |
|---|
| 1509 | n/a | |
|---|
| 1510 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1511 | n/a | >>> turtle.heading() |
|---|
| 1512 | n/a | 90 |
|---|
| 1513 | n/a | >>> turtle.radians() |
|---|
| 1514 | n/a | >>> turtle.heading() |
|---|
| 1515 | n/a | 1.5707963267948966 |
|---|
| 1516 | n/a | """ |
|---|
| 1517 | n/a | self._setDegreesPerAU(2*math.pi) |
|---|
| 1518 | n/a | |
|---|
| 1519 | n/a | def _go(self, distance): |
|---|
| 1520 | n/a | """move turtle forward by specified distance""" |
|---|
| 1521 | n/a | ende = self._position + self._orient * distance |
|---|
| 1522 | n/a | self._goto(ende) |
|---|
| 1523 | n/a | |
|---|
| 1524 | n/a | def _rotate(self, angle): |
|---|
| 1525 | n/a | """Turn turtle counterclockwise by specified angle if angle > 0.""" |
|---|
| 1526 | n/a | angle *= self._degreesPerAU |
|---|
| 1527 | n/a | self._orient = self._orient.rotate(angle) |
|---|
| 1528 | n/a | |
|---|
| 1529 | n/a | def _goto(self, end): |
|---|
| 1530 | n/a | """move turtle to position end.""" |
|---|
| 1531 | n/a | self._position = end |
|---|
| 1532 | n/a | |
|---|
| 1533 | n/a | def forward(self, distance): |
|---|
| 1534 | n/a | """Move the turtle forward by the specified distance. |
|---|
| 1535 | n/a | |
|---|
| 1536 | n/a | Aliases: forward | fd |
|---|
| 1537 | n/a | |
|---|
| 1538 | n/a | Argument: |
|---|
| 1539 | n/a | distance -- a number (integer or float) |
|---|
| 1540 | n/a | |
|---|
| 1541 | n/a | Move the turtle forward by the specified distance, in the direction |
|---|
| 1542 | n/a | the turtle is headed. |
|---|
| 1543 | n/a | |
|---|
| 1544 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1545 | n/a | >>> turtle.position() |
|---|
| 1546 | n/a | (0.00, 0.00) |
|---|
| 1547 | n/a | >>> turtle.forward(25) |
|---|
| 1548 | n/a | >>> turtle.position() |
|---|
| 1549 | n/a | (25.00,0.00) |
|---|
| 1550 | n/a | >>> turtle.forward(-75) |
|---|
| 1551 | n/a | >>> turtle.position() |
|---|
| 1552 | n/a | (-50.00,0.00) |
|---|
| 1553 | n/a | """ |
|---|
| 1554 | n/a | self._go(distance) |
|---|
| 1555 | n/a | |
|---|
| 1556 | n/a | def back(self, distance): |
|---|
| 1557 | n/a | """Move the turtle backward by distance. |
|---|
| 1558 | n/a | |
|---|
| 1559 | n/a | Aliases: back | backward | bk |
|---|
| 1560 | n/a | |
|---|
| 1561 | n/a | Argument: |
|---|
| 1562 | n/a | distance -- a number |
|---|
| 1563 | n/a | |
|---|
| 1564 | n/a | Move the turtle backward by distance ,opposite to the direction the |
|---|
| 1565 | n/a | turtle is headed. Do not change the turtle's heading. |
|---|
| 1566 | n/a | |
|---|
| 1567 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1568 | n/a | >>> turtle.position() |
|---|
| 1569 | n/a | (0.00, 0.00) |
|---|
| 1570 | n/a | >>> turtle.backward(30) |
|---|
| 1571 | n/a | >>> turtle.position() |
|---|
| 1572 | n/a | (-30.00, 0.00) |
|---|
| 1573 | n/a | """ |
|---|
| 1574 | n/a | self._go(-distance) |
|---|
| 1575 | n/a | |
|---|
| 1576 | n/a | def right(self, angle): |
|---|
| 1577 | n/a | """Turn turtle right by angle units. |
|---|
| 1578 | n/a | |
|---|
| 1579 | n/a | Aliases: right | rt |
|---|
| 1580 | n/a | |
|---|
| 1581 | n/a | Argument: |
|---|
| 1582 | n/a | angle -- a number (integer or float) |
|---|
| 1583 | n/a | |
|---|
| 1584 | n/a | Turn turtle right by angle units. (Units are by default degrees, |
|---|
| 1585 | n/a | but can be set via the degrees() and radians() functions.) |
|---|
| 1586 | n/a | Angle orientation depends on mode. (See this.) |
|---|
| 1587 | n/a | |
|---|
| 1588 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1589 | n/a | >>> turtle.heading() |
|---|
| 1590 | n/a | 22.0 |
|---|
| 1591 | n/a | >>> turtle.right(45) |
|---|
| 1592 | n/a | >>> turtle.heading() |
|---|
| 1593 | n/a | 337.0 |
|---|
| 1594 | n/a | """ |
|---|
| 1595 | n/a | self._rotate(-angle) |
|---|
| 1596 | n/a | |
|---|
| 1597 | n/a | def left(self, angle): |
|---|
| 1598 | n/a | """Turn turtle left by angle units. |
|---|
| 1599 | n/a | |
|---|
| 1600 | n/a | Aliases: left | lt |
|---|
| 1601 | n/a | |
|---|
| 1602 | n/a | Argument: |
|---|
| 1603 | n/a | angle -- a number (integer or float) |
|---|
| 1604 | n/a | |
|---|
| 1605 | n/a | Turn turtle left by angle units. (Units are by default degrees, |
|---|
| 1606 | n/a | but can be set via the degrees() and radians() functions.) |
|---|
| 1607 | n/a | Angle orientation depends on mode. (See this.) |
|---|
| 1608 | n/a | |
|---|
| 1609 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1610 | n/a | >>> turtle.heading() |
|---|
| 1611 | n/a | 22.0 |
|---|
| 1612 | n/a | >>> turtle.left(45) |
|---|
| 1613 | n/a | >>> turtle.heading() |
|---|
| 1614 | n/a | 67.0 |
|---|
| 1615 | n/a | """ |
|---|
| 1616 | n/a | self._rotate(angle) |
|---|
| 1617 | n/a | |
|---|
| 1618 | n/a | def pos(self): |
|---|
| 1619 | n/a | """Return the turtle's current location (x,y), as a Vec2D-vector. |
|---|
| 1620 | n/a | |
|---|
| 1621 | n/a | Aliases: pos | position |
|---|
| 1622 | n/a | |
|---|
| 1623 | n/a | No arguments. |
|---|
| 1624 | n/a | |
|---|
| 1625 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1626 | n/a | >>> turtle.pos() |
|---|
| 1627 | n/a | (0.00, 240.00) |
|---|
| 1628 | n/a | """ |
|---|
| 1629 | n/a | return self._position |
|---|
| 1630 | n/a | |
|---|
| 1631 | n/a | def xcor(self): |
|---|
| 1632 | n/a | """ Return the turtle's x coordinate. |
|---|
| 1633 | n/a | |
|---|
| 1634 | n/a | No arguments. |
|---|
| 1635 | n/a | |
|---|
| 1636 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1637 | n/a | >>> reset() |
|---|
| 1638 | n/a | >>> turtle.left(60) |
|---|
| 1639 | n/a | >>> turtle.forward(100) |
|---|
| 1640 | n/a | >>> print turtle.xcor() |
|---|
| 1641 | n/a | 50.0 |
|---|
| 1642 | n/a | """ |
|---|
| 1643 | n/a | return self._position[0] |
|---|
| 1644 | n/a | |
|---|
| 1645 | n/a | def ycor(self): |
|---|
| 1646 | n/a | """ Return the turtle's y coordinate |
|---|
| 1647 | n/a | --- |
|---|
| 1648 | n/a | No arguments. |
|---|
| 1649 | n/a | |
|---|
| 1650 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1651 | n/a | >>> reset() |
|---|
| 1652 | n/a | >>> turtle.left(60) |
|---|
| 1653 | n/a | >>> turtle.forward(100) |
|---|
| 1654 | n/a | >>> print turtle.ycor() |
|---|
| 1655 | n/a | 86.6025403784 |
|---|
| 1656 | n/a | """ |
|---|
| 1657 | n/a | return self._position[1] |
|---|
| 1658 | n/a | |
|---|
| 1659 | n/a | |
|---|
| 1660 | n/a | def goto(self, x, y=None): |
|---|
| 1661 | n/a | """Move turtle to an absolute position. |
|---|
| 1662 | n/a | |
|---|
| 1663 | n/a | Aliases: setpos | setposition | goto: |
|---|
| 1664 | n/a | |
|---|
| 1665 | n/a | Arguments: |
|---|
| 1666 | n/a | x -- a number or a pair/vector of numbers |
|---|
| 1667 | n/a | y -- a number None |
|---|
| 1668 | n/a | |
|---|
| 1669 | n/a | call: goto(x, y) # two coordinates |
|---|
| 1670 | n/a | --or: goto((x, y)) # a pair (tuple) of coordinates |
|---|
| 1671 | n/a | --or: goto(vec) # e.g. as returned by pos() |
|---|
| 1672 | n/a | |
|---|
| 1673 | n/a | Move turtle to an absolute position. If the pen is down, |
|---|
| 1674 | n/a | a line will be drawn. The turtle's orientation does not change. |
|---|
| 1675 | n/a | |
|---|
| 1676 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1677 | n/a | >>> tp = turtle.pos() |
|---|
| 1678 | n/a | >>> tp |
|---|
| 1679 | n/a | (0.00, 0.00) |
|---|
| 1680 | n/a | >>> turtle.setpos(60,30) |
|---|
| 1681 | n/a | >>> turtle.pos() |
|---|
| 1682 | n/a | (60.00,30.00) |
|---|
| 1683 | n/a | >>> turtle.setpos((20,80)) |
|---|
| 1684 | n/a | >>> turtle.pos() |
|---|
| 1685 | n/a | (20.00,80.00) |
|---|
| 1686 | n/a | >>> turtle.setpos(tp) |
|---|
| 1687 | n/a | >>> turtle.pos() |
|---|
| 1688 | n/a | (0.00,0.00) |
|---|
| 1689 | n/a | """ |
|---|
| 1690 | n/a | if y is None: |
|---|
| 1691 | n/a | self._goto(Vec2D(*x)) |
|---|
| 1692 | n/a | else: |
|---|
| 1693 | n/a | self._goto(Vec2D(x, y)) |
|---|
| 1694 | n/a | |
|---|
| 1695 | n/a | def home(self): |
|---|
| 1696 | n/a | """Move turtle to the origin - coordinates (0,0). |
|---|
| 1697 | n/a | |
|---|
| 1698 | n/a | No arguments. |
|---|
| 1699 | n/a | |
|---|
| 1700 | n/a | Move turtle to the origin - coordinates (0,0) and set its |
|---|
| 1701 | n/a | heading to its start-orientation (which depends on mode). |
|---|
| 1702 | n/a | |
|---|
| 1703 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1704 | n/a | >>> turtle.home() |
|---|
| 1705 | n/a | """ |
|---|
| 1706 | n/a | self.goto(0, 0) |
|---|
| 1707 | n/a | self.setheading(0) |
|---|
| 1708 | n/a | |
|---|
| 1709 | n/a | def setx(self, x): |
|---|
| 1710 | n/a | """Set the turtle's first coordinate to x |
|---|
| 1711 | n/a | |
|---|
| 1712 | n/a | Argument: |
|---|
| 1713 | n/a | x -- a number (integer or float) |
|---|
| 1714 | n/a | |
|---|
| 1715 | n/a | Set the turtle's first coordinate to x, leave second coordinate |
|---|
| 1716 | n/a | unchanged. |
|---|
| 1717 | n/a | |
|---|
| 1718 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1719 | n/a | >>> turtle.position() |
|---|
| 1720 | n/a | (0.00, 240.00) |
|---|
| 1721 | n/a | >>> turtle.setx(10) |
|---|
| 1722 | n/a | >>> turtle.position() |
|---|
| 1723 | n/a | (10.00, 240.00) |
|---|
| 1724 | n/a | """ |
|---|
| 1725 | n/a | self._goto(Vec2D(x, self._position[1])) |
|---|
| 1726 | n/a | |
|---|
| 1727 | n/a | def sety(self, y): |
|---|
| 1728 | n/a | """Set the turtle's second coordinate to y |
|---|
| 1729 | n/a | |
|---|
| 1730 | n/a | Argument: |
|---|
| 1731 | n/a | y -- a number (integer or float) |
|---|
| 1732 | n/a | |
|---|
| 1733 | n/a | Set the turtle's first coordinate to x, second coordinate remains |
|---|
| 1734 | n/a | unchanged. |
|---|
| 1735 | n/a | |
|---|
| 1736 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1737 | n/a | >>> turtle.position() |
|---|
| 1738 | n/a | (0.00, 40.00) |
|---|
| 1739 | n/a | >>> turtle.sety(-10) |
|---|
| 1740 | n/a | >>> turtle.position() |
|---|
| 1741 | n/a | (0.00, -10.00) |
|---|
| 1742 | n/a | """ |
|---|
| 1743 | n/a | self._goto(Vec2D(self._position[0], y)) |
|---|
| 1744 | n/a | |
|---|
| 1745 | n/a | def distance(self, x, y=None): |
|---|
| 1746 | n/a | """Return the distance from the turtle to (x,y) in turtle step units. |
|---|
| 1747 | n/a | |
|---|
| 1748 | n/a | Arguments: |
|---|
| 1749 | n/a | x -- a number or a pair/vector of numbers or a turtle instance |
|---|
| 1750 | n/a | y -- a number None None |
|---|
| 1751 | n/a | |
|---|
| 1752 | n/a | call: distance(x, y) # two coordinates |
|---|
| 1753 | n/a | --or: distance((x, y)) # a pair (tuple) of coordinates |
|---|
| 1754 | n/a | --or: distance(vec) # e.g. as returned by pos() |
|---|
| 1755 | n/a | --or: distance(mypen) # where mypen is another turtle |
|---|
| 1756 | n/a | |
|---|
| 1757 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1758 | n/a | >>> turtle.pos() |
|---|
| 1759 | n/a | (0.00, 0.00) |
|---|
| 1760 | n/a | >>> turtle.distance(30,40) |
|---|
| 1761 | n/a | 50.0 |
|---|
| 1762 | n/a | >>> pen = Turtle() |
|---|
| 1763 | n/a | >>> pen.forward(77) |
|---|
| 1764 | n/a | >>> turtle.distance(pen) |
|---|
| 1765 | n/a | 77.0 |
|---|
| 1766 | n/a | """ |
|---|
| 1767 | n/a | if y is not None: |
|---|
| 1768 | n/a | pos = Vec2D(x, y) |
|---|
| 1769 | n/a | if isinstance(x, Vec2D): |
|---|
| 1770 | n/a | pos = x |
|---|
| 1771 | n/a | elif isinstance(x, tuple): |
|---|
| 1772 | n/a | pos = Vec2D(*x) |
|---|
| 1773 | n/a | elif isinstance(x, TNavigator): |
|---|
| 1774 | n/a | pos = x._position |
|---|
| 1775 | n/a | return abs(pos - self._position) |
|---|
| 1776 | n/a | |
|---|
| 1777 | n/a | def towards(self, x, y=None): |
|---|
| 1778 | n/a | """Return the angle of the line from the turtle's position to (x, y). |
|---|
| 1779 | n/a | |
|---|
| 1780 | n/a | Arguments: |
|---|
| 1781 | n/a | x -- a number or a pair/vector of numbers or a turtle instance |
|---|
| 1782 | n/a | y -- a number None None |
|---|
| 1783 | n/a | |
|---|
| 1784 | n/a | call: distance(x, y) # two coordinates |
|---|
| 1785 | n/a | --or: distance((x, y)) # a pair (tuple) of coordinates |
|---|
| 1786 | n/a | --or: distance(vec) # e.g. as returned by pos() |
|---|
| 1787 | n/a | --or: distance(mypen) # where mypen is another turtle |
|---|
| 1788 | n/a | |
|---|
| 1789 | n/a | Return the angle, between the line from turtle-position to position |
|---|
| 1790 | n/a | specified by x, y and the turtle's start orientation. (Depends on |
|---|
| 1791 | n/a | modes - "standard" or "logo") |
|---|
| 1792 | n/a | |
|---|
| 1793 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1794 | n/a | >>> turtle.pos() |
|---|
| 1795 | n/a | (10.00, 10.00) |
|---|
| 1796 | n/a | >>> turtle.towards(0,0) |
|---|
| 1797 | n/a | 225.0 |
|---|
| 1798 | n/a | """ |
|---|
| 1799 | n/a | if y is not None: |
|---|
| 1800 | n/a | pos = Vec2D(x, y) |
|---|
| 1801 | n/a | if isinstance(x, Vec2D): |
|---|
| 1802 | n/a | pos = x |
|---|
| 1803 | n/a | elif isinstance(x, tuple): |
|---|
| 1804 | n/a | pos = Vec2D(*x) |
|---|
| 1805 | n/a | elif isinstance(x, TNavigator): |
|---|
| 1806 | n/a | pos = x._position |
|---|
| 1807 | n/a | x, y = pos - self._position |
|---|
| 1808 | n/a | result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0 |
|---|
| 1809 | n/a | result /= self._degreesPerAU |
|---|
| 1810 | n/a | return (self._angleOffset + self._angleOrient*result) % self._fullcircle |
|---|
| 1811 | n/a | |
|---|
| 1812 | n/a | def heading(self): |
|---|
| 1813 | n/a | """ Return the turtle's current heading. |
|---|
| 1814 | n/a | |
|---|
| 1815 | n/a | No arguments. |
|---|
| 1816 | n/a | |
|---|
| 1817 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1818 | n/a | >>> turtle.left(67) |
|---|
| 1819 | n/a | >>> turtle.heading() |
|---|
| 1820 | n/a | 67.0 |
|---|
| 1821 | n/a | """ |
|---|
| 1822 | n/a | x, y = self._orient |
|---|
| 1823 | n/a | result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0 |
|---|
| 1824 | n/a | result /= self._degreesPerAU |
|---|
| 1825 | n/a | return (self._angleOffset + self._angleOrient*result) % self._fullcircle |
|---|
| 1826 | n/a | |
|---|
| 1827 | n/a | def setheading(self, to_angle): |
|---|
| 1828 | n/a | """Set the orientation of the turtle to to_angle. |
|---|
| 1829 | n/a | |
|---|
| 1830 | n/a | Aliases: setheading | seth |
|---|
| 1831 | n/a | |
|---|
| 1832 | n/a | Argument: |
|---|
| 1833 | n/a | to_angle -- a number (integer or float) |
|---|
| 1834 | n/a | |
|---|
| 1835 | n/a | Set the orientation of the turtle to to_angle. |
|---|
| 1836 | n/a | Here are some common directions in degrees: |
|---|
| 1837 | n/a | |
|---|
| 1838 | n/a | standard - mode: logo-mode: |
|---|
| 1839 | n/a | -------------------|-------------------- |
|---|
| 1840 | n/a | 0 - east 0 - north |
|---|
| 1841 | n/a | 90 - north 90 - east |
|---|
| 1842 | n/a | 180 - west 180 - south |
|---|
| 1843 | n/a | 270 - south 270 - west |
|---|
| 1844 | n/a | |
|---|
| 1845 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1846 | n/a | >>> turtle.setheading(90) |
|---|
| 1847 | n/a | >>> turtle.heading() |
|---|
| 1848 | n/a | 90 |
|---|
| 1849 | n/a | """ |
|---|
| 1850 | n/a | angle = (to_angle - self.heading())*self._angleOrient |
|---|
| 1851 | n/a | full = self._fullcircle |
|---|
| 1852 | n/a | angle = (angle+full/2.)%full - full/2. |
|---|
| 1853 | n/a | self._rotate(angle) |
|---|
| 1854 | n/a | |
|---|
| 1855 | n/a | def circle(self, radius, extent = None, steps = None): |
|---|
| 1856 | n/a | """ Draw a circle with given radius. |
|---|
| 1857 | n/a | |
|---|
| 1858 | n/a | Arguments: |
|---|
| 1859 | n/a | radius -- a number |
|---|
| 1860 | n/a | extent (optional) -- a number |
|---|
| 1861 | n/a | steps (optional) -- an integer |
|---|
| 1862 | n/a | |
|---|
| 1863 | n/a | Draw a circle with given radius. The center is radius units left |
|---|
| 1864 | n/a | of the turtle; extent - an angle - determines which part of the |
|---|
| 1865 | n/a | circle is drawn. If extent is not given, draw the entire circle. |
|---|
| 1866 | n/a | If extent is not a full circle, one endpoint of the arc is the |
|---|
| 1867 | n/a | current pen position. Draw the arc in counterclockwise direction |
|---|
| 1868 | n/a | if radius is positive, otherwise in clockwise direction. Finally |
|---|
| 1869 | n/a | the direction of the turtle is changed by the amount of extent. |
|---|
| 1870 | n/a | |
|---|
| 1871 | n/a | As the circle is approximated by an inscribed regular polygon, |
|---|
| 1872 | n/a | steps determines the number of steps to use. If not given, |
|---|
| 1873 | n/a | it will be calculated automatically. Maybe used to draw regular |
|---|
| 1874 | n/a | polygons. |
|---|
| 1875 | n/a | |
|---|
| 1876 | n/a | call: circle(radius) # full circle |
|---|
| 1877 | n/a | --or: circle(radius, extent) # arc |
|---|
| 1878 | n/a | --or: circle(radius, extent, steps) |
|---|
| 1879 | n/a | --or: circle(radius, steps=6) # 6-sided polygon |
|---|
| 1880 | n/a | |
|---|
| 1881 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 1882 | n/a | >>> turtle.circle(50) |
|---|
| 1883 | n/a | >>> turtle.circle(120, 180) # semicircle |
|---|
| 1884 | n/a | """ |
|---|
| 1885 | n/a | if self.undobuffer: |
|---|
| 1886 | n/a | self.undobuffer.push(["seq"]) |
|---|
| 1887 | n/a | self.undobuffer.cumulate = True |
|---|
| 1888 | n/a | speed = self.speed() |
|---|
| 1889 | n/a | if extent is None: |
|---|
| 1890 | n/a | extent = self._fullcircle |
|---|
| 1891 | n/a | if steps is None: |
|---|
| 1892 | n/a | frac = abs(extent)/self._fullcircle |
|---|
| 1893 | n/a | steps = 1+int(min(11+abs(radius)/6.0, 59.0)*frac) |
|---|
| 1894 | n/a | w = 1.0 * extent / steps |
|---|
| 1895 | n/a | w2 = 0.5 * w |
|---|
| 1896 | n/a | l = 2.0 * radius * math.sin(w2*math.pi/180.0*self._degreesPerAU) |
|---|
| 1897 | n/a | if radius < 0: |
|---|
| 1898 | n/a | l, w, w2 = -l, -w, -w2 |
|---|
| 1899 | n/a | tr = self.tracer() |
|---|
| 1900 | n/a | dl = self._delay() |
|---|
| 1901 | n/a | if speed == 0: |
|---|
| 1902 | n/a | self.tracer(0, 0) |
|---|
| 1903 | n/a | else: |
|---|
| 1904 | n/a | self.speed(0) |
|---|
| 1905 | n/a | self._rotate(w2) |
|---|
| 1906 | n/a | for i in range(steps): |
|---|
| 1907 | n/a | self.speed(speed) |
|---|
| 1908 | n/a | self._go(l) |
|---|
| 1909 | n/a | self.speed(0) |
|---|
| 1910 | n/a | self._rotate(w) |
|---|
| 1911 | n/a | self._rotate(-w2) |
|---|
| 1912 | n/a | if speed == 0: |
|---|
| 1913 | n/a | self.tracer(tr, dl) |
|---|
| 1914 | n/a | self.speed(speed) |
|---|
| 1915 | n/a | if self.undobuffer: |
|---|
| 1916 | n/a | self.undobuffer.cumulate = False |
|---|
| 1917 | n/a | |
|---|
| 1918 | n/a | ## three dummy methods to be implemented by child class: |
|---|
| 1919 | n/a | |
|---|
| 1920 | n/a | def speed(self, s=0): |
|---|
| 1921 | n/a | """dummy method - to be overwritten by child class""" |
|---|
| 1922 | n/a | def tracer(self, a=None, b=None): |
|---|
| 1923 | n/a | """dummy method - to be overwritten by child class""" |
|---|
| 1924 | n/a | def _delay(self, n=None): |
|---|
| 1925 | n/a | """dummy method - to be overwritten by child class""" |
|---|
| 1926 | n/a | |
|---|
| 1927 | n/a | fd = forward |
|---|
| 1928 | n/a | bk = back |
|---|
| 1929 | n/a | backward = back |
|---|
| 1930 | n/a | rt = right |
|---|
| 1931 | n/a | lt = left |
|---|
| 1932 | n/a | position = pos |
|---|
| 1933 | n/a | setpos = goto |
|---|
| 1934 | n/a | setposition = goto |
|---|
| 1935 | n/a | seth = setheading |
|---|
| 1936 | n/a | |
|---|
| 1937 | n/a | |
|---|
| 1938 | n/a | class TPen(object): |
|---|
| 1939 | n/a | """Drawing part of the RawTurtle. |
|---|
| 1940 | n/a | Implements drawing properties. |
|---|
| 1941 | n/a | """ |
|---|
| 1942 | n/a | def __init__(self, resizemode=_CFG["resizemode"]): |
|---|
| 1943 | n/a | self._resizemode = resizemode # or "user" or "noresize" |
|---|
| 1944 | n/a | self.undobuffer = None |
|---|
| 1945 | n/a | TPen._reset(self) |
|---|
| 1946 | n/a | |
|---|
| 1947 | n/a | def _reset(self, pencolor=_CFG["pencolor"], |
|---|
| 1948 | n/a | fillcolor=_CFG["fillcolor"]): |
|---|
| 1949 | n/a | self._pensize = 1 |
|---|
| 1950 | n/a | self._shown = True |
|---|
| 1951 | n/a | self._pencolor = pencolor |
|---|
| 1952 | n/a | self._fillcolor = fillcolor |
|---|
| 1953 | n/a | self._drawing = True |
|---|
| 1954 | n/a | self._speed = 3 |
|---|
| 1955 | n/a | self._stretchfactor = (1, 1) |
|---|
| 1956 | n/a | self._tilt = 0 |
|---|
| 1957 | n/a | self._outlinewidth = 1 |
|---|
| 1958 | n/a | ### self.screen = None # to override by child class |
|---|
| 1959 | n/a | |
|---|
| 1960 | n/a | def resizemode(self, rmode=None): |
|---|
| 1961 | n/a | """Set resizemode to one of the values: "auto", "user", "noresize". |
|---|
| 1962 | n/a | |
|---|
| 1963 | n/a | (Optional) Argument: |
|---|
| 1964 | n/a | rmode -- one of the strings "auto", "user", "noresize" |
|---|
| 1965 | n/a | |
|---|
| 1966 | n/a | Different resizemodes have the following effects: |
|---|
| 1967 | n/a | - "auto" adapts the appearance of the turtle |
|---|
| 1968 | n/a | corresponding to the value of pensize. |
|---|
| 1969 | n/a | - "user" adapts the appearance of the turtle according to the |
|---|
| 1970 | n/a | values of stretchfactor and outlinewidth (outline), |
|---|
| 1971 | n/a | which are set by shapesize() |
|---|
| 1972 | n/a | - "noresize" no adaption of the turtle's appearance takes place. |
|---|
| 1973 | n/a | If no argument is given, return current resizemode. |
|---|
| 1974 | n/a | resizemode("user") is called by a call of shapesize with arguments. |
|---|
| 1975 | n/a | |
|---|
| 1976 | n/a | |
|---|
| 1977 | n/a | Examples (for a Turtle instance named turtle): |
|---|
| 1978 | n/a | >>> turtle.resizemode("noresize") |
|---|
| 1979 | n/a | >>> turtle.resizemode() |
|---|
| 1980 | n/a | 'noresize' |
|---|
| 1981 | n/a | """ |
|---|
| 1982 | n/a | if rmode is None: |
|---|
| 1983 | n/a | return self._resizemode |
|---|
| 1984 | n/a | rmode = rmode.lower() |
|---|
| 1985 | n/a | if rmode in ["auto", "user", "noresize"]: |
|---|
| 1986 | n/a | self.pen(resizemode=rmode) |
|---|
| 1987 | n/a | |
|---|
| 1988 | n/a | def pensize(self, width=None): |
|---|
| 1989 | n/a | """Set or return the line thickness. |
|---|
| 1990 | n/a | |
|---|
| 1991 | n/a | Aliases: pensize | width |
|---|
| 1992 | n/a | |
|---|
| 1993 | n/a | Argument: |
|---|
| 1994 | n/a | width -- positive number |
|---|
| 1995 | n/a | |
|---|
| 1996 | n/a | Set the line thickness to width or return it. If resizemode is set |
|---|
| 1997 | n/a | to "auto" and turtleshape is a polygon, that polygon is drawn with |
|---|
| 1998 | n/a | the same line thickness. If no argument is given, current pensize |
|---|
| 1999 | n/a | is returned. |
|---|
| 2000 | n/a | |
|---|
| 2001 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2002 | n/a | >>> turtle.pensize() |
|---|
| 2003 | n/a | 1 |
|---|
| 2004 | n/a | turtle.pensize(10) # from here on lines of width 10 are drawn |
|---|
| 2005 | n/a | """ |
|---|
| 2006 | n/a | if width is None: |
|---|
| 2007 | n/a | return self._pensize |
|---|
| 2008 | n/a | self.pen(pensize=width) |
|---|
| 2009 | n/a | |
|---|
| 2010 | n/a | |
|---|
| 2011 | n/a | def penup(self): |
|---|
| 2012 | n/a | """Pull the pen up -- no drawing when moving. |
|---|
| 2013 | n/a | |
|---|
| 2014 | n/a | Aliases: penup | pu | up |
|---|
| 2015 | n/a | |
|---|
| 2016 | n/a | No argument |
|---|
| 2017 | n/a | |
|---|
| 2018 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2019 | n/a | >>> turtle.penup() |
|---|
| 2020 | n/a | """ |
|---|
| 2021 | n/a | if not self._drawing: |
|---|
| 2022 | n/a | return |
|---|
| 2023 | n/a | self.pen(pendown=False) |
|---|
| 2024 | n/a | |
|---|
| 2025 | n/a | def pendown(self): |
|---|
| 2026 | n/a | """Pull the pen down -- drawing when moving. |
|---|
| 2027 | n/a | |
|---|
| 2028 | n/a | Aliases: pendown | pd | down |
|---|
| 2029 | n/a | |
|---|
| 2030 | n/a | No argument. |
|---|
| 2031 | n/a | |
|---|
| 2032 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2033 | n/a | >>> turtle.pendown() |
|---|
| 2034 | n/a | """ |
|---|
| 2035 | n/a | if self._drawing: |
|---|
| 2036 | n/a | return |
|---|
| 2037 | n/a | self.pen(pendown=True) |
|---|
| 2038 | n/a | |
|---|
| 2039 | n/a | def isdown(self): |
|---|
| 2040 | n/a | """Return True if pen is down, False if it's up. |
|---|
| 2041 | n/a | |
|---|
| 2042 | n/a | No argument. |
|---|
| 2043 | n/a | |
|---|
| 2044 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2045 | n/a | >>> turtle.penup() |
|---|
| 2046 | n/a | >>> turtle.isdown() |
|---|
| 2047 | n/a | False |
|---|
| 2048 | n/a | >>> turtle.pendown() |
|---|
| 2049 | n/a | >>> turtle.isdown() |
|---|
| 2050 | n/a | True |
|---|
| 2051 | n/a | """ |
|---|
| 2052 | n/a | return self._drawing |
|---|
| 2053 | n/a | |
|---|
| 2054 | n/a | def speed(self, speed=None): |
|---|
| 2055 | n/a | """ Return or set the turtle's speed. |
|---|
| 2056 | n/a | |
|---|
| 2057 | n/a | Optional argument: |
|---|
| 2058 | n/a | speed -- an integer in the range 0..10 or a speedstring (see below) |
|---|
| 2059 | n/a | |
|---|
| 2060 | n/a | Set the turtle's speed to an integer value in the range 0 .. 10. |
|---|
| 2061 | n/a | If no argument is given: return current speed. |
|---|
| 2062 | n/a | |
|---|
| 2063 | n/a | If input is a number greater than 10 or smaller than 0.5, |
|---|
| 2064 | n/a | speed is set to 0. |
|---|
| 2065 | n/a | Speedstrings are mapped to speedvalues in the following way: |
|---|
| 2066 | n/a | 'fastest' : 0 |
|---|
| 2067 | n/a | 'fast' : 10 |
|---|
| 2068 | n/a | 'normal' : 6 |
|---|
| 2069 | n/a | 'slow' : 3 |
|---|
| 2070 | n/a | 'slowest' : 1 |
|---|
| 2071 | n/a | speeds from 1 to 10 enforce increasingly faster animation of |
|---|
| 2072 | n/a | line drawing and turtle turning. |
|---|
| 2073 | n/a | |
|---|
| 2074 | n/a | Attention: |
|---|
| 2075 | n/a | speed = 0 : *no* animation takes place. forward/back makes turtle jump |
|---|
| 2076 | n/a | and likewise left/right make the turtle turn instantly. |
|---|
| 2077 | n/a | |
|---|
| 2078 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2079 | n/a | >>> turtle.speed(3) |
|---|
| 2080 | n/a | """ |
|---|
| 2081 | n/a | speeds = {'fastest':0, 'fast':10, 'normal':6, 'slow':3, 'slowest':1 } |
|---|
| 2082 | n/a | if speed is None: |
|---|
| 2083 | n/a | return self._speed |
|---|
| 2084 | n/a | if speed in speeds: |
|---|
| 2085 | n/a | speed = speeds[speed] |
|---|
| 2086 | n/a | elif 0.5 < speed < 10.5: |
|---|
| 2087 | n/a | speed = int(round(speed)) |
|---|
| 2088 | n/a | else: |
|---|
| 2089 | n/a | speed = 0 |
|---|
| 2090 | n/a | self.pen(speed=speed) |
|---|
| 2091 | n/a | |
|---|
| 2092 | n/a | def color(self, *args): |
|---|
| 2093 | n/a | """Return or set the pencolor and fillcolor. |
|---|
| 2094 | n/a | |
|---|
| 2095 | n/a | Arguments: |
|---|
| 2096 | n/a | Several input formats are allowed. |
|---|
| 2097 | n/a | They use 0, 1, 2, or 3 arguments as follows: |
|---|
| 2098 | n/a | |
|---|
| 2099 | n/a | color() |
|---|
| 2100 | n/a | Return the current pencolor and the current fillcolor |
|---|
| 2101 | n/a | as a pair of color specification strings as are returned |
|---|
| 2102 | n/a | by pencolor and fillcolor. |
|---|
| 2103 | n/a | color(colorstring), color((r,g,b)), color(r,g,b) |
|---|
| 2104 | n/a | inputs as in pencolor, set both, fillcolor and pencolor, |
|---|
| 2105 | n/a | to the given value. |
|---|
| 2106 | n/a | color(colorstring1, colorstring2), |
|---|
| 2107 | n/a | color((r1,g1,b1), (r2,g2,b2)) |
|---|
| 2108 | n/a | equivalent to pencolor(colorstring1) and fillcolor(colorstring2) |
|---|
| 2109 | n/a | and analogously, if the other input format is used. |
|---|
| 2110 | n/a | |
|---|
| 2111 | n/a | If turtleshape is a polygon, outline and interior of that polygon |
|---|
| 2112 | n/a | is drawn with the newly set colors. |
|---|
| 2113 | n/a | For mor info see: pencolor, fillcolor |
|---|
| 2114 | n/a | |
|---|
| 2115 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2116 | n/a | >>> turtle.color('red', 'green') |
|---|
| 2117 | n/a | >>> turtle.color() |
|---|
| 2118 | n/a | ('red', 'green') |
|---|
| 2119 | n/a | >>> colormode(255) |
|---|
| 2120 | n/a | >>> color((40, 80, 120), (160, 200, 240)) |
|---|
| 2121 | n/a | >>> color() |
|---|
| 2122 | n/a | ('#285078', '#a0c8f0') |
|---|
| 2123 | n/a | """ |
|---|
| 2124 | n/a | if args: |
|---|
| 2125 | n/a | l = len(args) |
|---|
| 2126 | n/a | if l == 1: |
|---|
| 2127 | n/a | pcolor = fcolor = args[0] |
|---|
| 2128 | n/a | elif l == 2: |
|---|
| 2129 | n/a | pcolor, fcolor = args |
|---|
| 2130 | n/a | elif l == 3: |
|---|
| 2131 | n/a | pcolor = fcolor = args |
|---|
| 2132 | n/a | pcolor = self._colorstr(pcolor) |
|---|
| 2133 | n/a | fcolor = self._colorstr(fcolor) |
|---|
| 2134 | n/a | self.pen(pencolor=pcolor, fillcolor=fcolor) |
|---|
| 2135 | n/a | else: |
|---|
| 2136 | n/a | return self._color(self._pencolor), self._color(self._fillcolor) |
|---|
| 2137 | n/a | |
|---|
| 2138 | n/a | def pencolor(self, *args): |
|---|
| 2139 | n/a | """ Return or set the pencolor. |
|---|
| 2140 | n/a | |
|---|
| 2141 | n/a | Arguments: |
|---|
| 2142 | n/a | Four input formats are allowed: |
|---|
| 2143 | n/a | - pencolor() |
|---|
| 2144 | n/a | Return the current pencolor as color specification string, |
|---|
| 2145 | n/a | possibly in hex-number format (see example). |
|---|
| 2146 | n/a | May be used as input to another color/pencolor/fillcolor call. |
|---|
| 2147 | n/a | - pencolor(colorstring) |
|---|
| 2148 | n/a | s is a Tk color specification string, such as "red" or "yellow" |
|---|
| 2149 | n/a | - pencolor((r, g, b)) |
|---|
| 2150 | n/a | *a tuple* of r, g, and b, which represent, an RGB color, |
|---|
| 2151 | n/a | and each of r, g, and b are in the range 0..colormode, |
|---|
| 2152 | n/a | where colormode is either 1.0 or 255 |
|---|
| 2153 | n/a | - pencolor(r, g, b) |
|---|
| 2154 | n/a | r, g, and b represent an RGB color, and each of r, g, and b |
|---|
| 2155 | n/a | are in the range 0..colormode |
|---|
| 2156 | n/a | |
|---|
| 2157 | n/a | If turtleshape is a polygon, the outline of that polygon is drawn |
|---|
| 2158 | n/a | with the newly set pencolor. |
|---|
| 2159 | n/a | |
|---|
| 2160 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2161 | n/a | >>> turtle.pencolor('brown') |
|---|
| 2162 | n/a | >>> tup = (0.2, 0.8, 0.55) |
|---|
| 2163 | n/a | >>> turtle.pencolor(tup) |
|---|
| 2164 | n/a | >>> turtle.pencolor() |
|---|
| 2165 | n/a | '#33cc8c' |
|---|
| 2166 | n/a | """ |
|---|
| 2167 | n/a | if args: |
|---|
| 2168 | n/a | color = self._colorstr(args) |
|---|
| 2169 | n/a | if color == self._pencolor: |
|---|
| 2170 | n/a | return |
|---|
| 2171 | n/a | self.pen(pencolor=color) |
|---|
| 2172 | n/a | else: |
|---|
| 2173 | n/a | return self._color(self._pencolor) |
|---|
| 2174 | n/a | |
|---|
| 2175 | n/a | def fillcolor(self, *args): |
|---|
| 2176 | n/a | """ Return or set the fillcolor. |
|---|
| 2177 | n/a | |
|---|
| 2178 | n/a | Arguments: |
|---|
| 2179 | n/a | Four input formats are allowed: |
|---|
| 2180 | n/a | - fillcolor() |
|---|
| 2181 | n/a | Return the current fillcolor as color specification string, |
|---|
| 2182 | n/a | possibly in hex-number format (see example). |
|---|
| 2183 | n/a | May be used as input to another color/pencolor/fillcolor call. |
|---|
| 2184 | n/a | - fillcolor(colorstring) |
|---|
| 2185 | n/a | s is a Tk color specification string, such as "red" or "yellow" |
|---|
| 2186 | n/a | - fillcolor((r, g, b)) |
|---|
| 2187 | n/a | *a tuple* of r, g, and b, which represent, an RGB color, |
|---|
| 2188 | n/a | and each of r, g, and b are in the range 0..colormode, |
|---|
| 2189 | n/a | where colormode is either 1.0 or 255 |
|---|
| 2190 | n/a | - fillcolor(r, g, b) |
|---|
| 2191 | n/a | r, g, and b represent an RGB color, and each of r, g, and b |
|---|
| 2192 | n/a | are in the range 0..colormode |
|---|
| 2193 | n/a | |
|---|
| 2194 | n/a | If turtleshape is a polygon, the interior of that polygon is drawn |
|---|
| 2195 | n/a | with the newly set fillcolor. |
|---|
| 2196 | n/a | |
|---|
| 2197 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2198 | n/a | >>> turtle.fillcolor('violet') |
|---|
| 2199 | n/a | >>> col = turtle.pencolor() |
|---|
| 2200 | n/a | >>> turtle.fillcolor(col) |
|---|
| 2201 | n/a | >>> turtle.fillcolor(0, .5, 0) |
|---|
| 2202 | n/a | """ |
|---|
| 2203 | n/a | if args: |
|---|
| 2204 | n/a | color = self._colorstr(args) |
|---|
| 2205 | n/a | if color == self._fillcolor: |
|---|
| 2206 | n/a | return |
|---|
| 2207 | n/a | self.pen(fillcolor=color) |
|---|
| 2208 | n/a | else: |
|---|
| 2209 | n/a | return self._color(self._fillcolor) |
|---|
| 2210 | n/a | |
|---|
| 2211 | n/a | def showturtle(self): |
|---|
| 2212 | n/a | """Makes the turtle visible. |
|---|
| 2213 | n/a | |
|---|
| 2214 | n/a | Aliases: showturtle | st |
|---|
| 2215 | n/a | |
|---|
| 2216 | n/a | No argument. |
|---|
| 2217 | n/a | |
|---|
| 2218 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2219 | n/a | >>> turtle.hideturtle() |
|---|
| 2220 | n/a | >>> turtle.showturtle() |
|---|
| 2221 | n/a | """ |
|---|
| 2222 | n/a | self.pen(shown=True) |
|---|
| 2223 | n/a | |
|---|
| 2224 | n/a | def hideturtle(self): |
|---|
| 2225 | n/a | """Makes the turtle invisible. |
|---|
| 2226 | n/a | |
|---|
| 2227 | n/a | Aliases: hideturtle | ht |
|---|
| 2228 | n/a | |
|---|
| 2229 | n/a | No argument. |
|---|
| 2230 | n/a | |
|---|
| 2231 | n/a | It's a good idea to do this while you're in the |
|---|
| 2232 | n/a | middle of a complicated drawing, because hiding |
|---|
| 2233 | n/a | the turtle speeds up the drawing observably. |
|---|
| 2234 | n/a | |
|---|
| 2235 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2236 | n/a | >>> turtle.hideturtle() |
|---|
| 2237 | n/a | """ |
|---|
| 2238 | n/a | self.pen(shown=False) |
|---|
| 2239 | n/a | |
|---|
| 2240 | n/a | def isvisible(self): |
|---|
| 2241 | n/a | """Return True if the Turtle is shown, False if it's hidden. |
|---|
| 2242 | n/a | |
|---|
| 2243 | n/a | No argument. |
|---|
| 2244 | n/a | |
|---|
| 2245 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2246 | n/a | >>> turtle.hideturtle() |
|---|
| 2247 | n/a | >>> print turtle.isvisible(): |
|---|
| 2248 | n/a | False |
|---|
| 2249 | n/a | """ |
|---|
| 2250 | n/a | return self._shown |
|---|
| 2251 | n/a | |
|---|
| 2252 | n/a | def pen(self, pen=None, **pendict): |
|---|
| 2253 | n/a | """Return or set the pen's attributes. |
|---|
| 2254 | n/a | |
|---|
| 2255 | n/a | Arguments: |
|---|
| 2256 | n/a | pen -- a dictionary with some or all of the below listed keys. |
|---|
| 2257 | n/a | **pendict -- one or more keyword-arguments with the below |
|---|
| 2258 | n/a | listed keys as keywords. |
|---|
| 2259 | n/a | |
|---|
| 2260 | n/a | Return or set the pen's attributes in a 'pen-dictionary' |
|---|
| 2261 | n/a | with the following key/value pairs: |
|---|
| 2262 | n/a | "shown" : True/False |
|---|
| 2263 | n/a | "pendown" : True/False |
|---|
| 2264 | n/a | "pencolor" : color-string or color-tuple |
|---|
| 2265 | n/a | "fillcolor" : color-string or color-tuple |
|---|
| 2266 | n/a | "pensize" : positive number |
|---|
| 2267 | n/a | "speed" : number in range 0..10 |
|---|
| 2268 | n/a | "resizemode" : "auto" or "user" or "noresize" |
|---|
| 2269 | n/a | "stretchfactor": (positive number, positive number) |
|---|
| 2270 | n/a | "outline" : positive number |
|---|
| 2271 | n/a | "tilt" : number |
|---|
| 2272 | n/a | |
|---|
| 2273 | n/a | This dictionary can be used as argument for a subsequent |
|---|
| 2274 | n/a | pen()-call to restore the former pen-state. Moreover one |
|---|
| 2275 | n/a | or more of these attributes can be provided as keyword-arguments. |
|---|
| 2276 | n/a | This can be used to set several pen attributes in one statement. |
|---|
| 2277 | n/a | |
|---|
| 2278 | n/a | |
|---|
| 2279 | n/a | Examples (for a Turtle instance named turtle): |
|---|
| 2280 | n/a | >>> turtle.pen(fillcolor="black", pencolor="red", pensize=10) |
|---|
| 2281 | n/a | >>> turtle.pen() |
|---|
| 2282 | n/a | {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, |
|---|
| 2283 | n/a | 'pencolor': 'red', 'pendown': True, 'fillcolor': 'black', |
|---|
| 2284 | n/a | 'stretchfactor': (1,1), 'speed': 3} |
|---|
| 2285 | n/a | >>> penstate=turtle.pen() |
|---|
| 2286 | n/a | >>> turtle.color("yellow","") |
|---|
| 2287 | n/a | >>> turtle.penup() |
|---|
| 2288 | n/a | >>> turtle.pen() |
|---|
| 2289 | n/a | {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, |
|---|
| 2290 | n/a | 'pencolor': 'yellow', 'pendown': False, 'fillcolor': '', |
|---|
| 2291 | n/a | 'stretchfactor': (1,1), 'speed': 3} |
|---|
| 2292 | n/a | >>> p.pen(penstate, fillcolor="green") |
|---|
| 2293 | n/a | >>> p.pen() |
|---|
| 2294 | n/a | {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, |
|---|
| 2295 | n/a | 'pencolor': 'red', 'pendown': True, 'fillcolor': 'green', |
|---|
| 2296 | n/a | 'stretchfactor': (1,1), 'speed': 3} |
|---|
| 2297 | n/a | """ |
|---|
| 2298 | n/a | _pd = {"shown" : self._shown, |
|---|
| 2299 | n/a | "pendown" : self._drawing, |
|---|
| 2300 | n/a | "pencolor" : self._pencolor, |
|---|
| 2301 | n/a | "fillcolor" : self._fillcolor, |
|---|
| 2302 | n/a | "pensize" : self._pensize, |
|---|
| 2303 | n/a | "speed" : self._speed, |
|---|
| 2304 | n/a | "resizemode" : self._resizemode, |
|---|
| 2305 | n/a | "stretchfactor" : self._stretchfactor, |
|---|
| 2306 | n/a | "outline" : self._outlinewidth, |
|---|
| 2307 | n/a | "tilt" : self._tilt |
|---|
| 2308 | n/a | } |
|---|
| 2309 | n/a | |
|---|
| 2310 | n/a | if not (pen or pendict): |
|---|
| 2311 | n/a | return _pd |
|---|
| 2312 | n/a | |
|---|
| 2313 | n/a | if isinstance(pen, dict): |
|---|
| 2314 | n/a | p = pen |
|---|
| 2315 | n/a | else: |
|---|
| 2316 | n/a | p = {} |
|---|
| 2317 | n/a | p.update(pendict) |
|---|
| 2318 | n/a | |
|---|
| 2319 | n/a | _p_buf = {} |
|---|
| 2320 | n/a | for key in p: |
|---|
| 2321 | n/a | _p_buf[key] = _pd[key] |
|---|
| 2322 | n/a | |
|---|
| 2323 | n/a | if self.undobuffer: |
|---|
| 2324 | n/a | self.undobuffer.push(("pen", _p_buf)) |
|---|
| 2325 | n/a | |
|---|
| 2326 | n/a | newLine = False |
|---|
| 2327 | n/a | if "pendown" in p: |
|---|
| 2328 | n/a | if self._drawing != p["pendown"]: |
|---|
| 2329 | n/a | newLine = True |
|---|
| 2330 | n/a | if "pencolor" in p: |
|---|
| 2331 | n/a | if isinstance(p["pencolor"], tuple): |
|---|
| 2332 | n/a | p["pencolor"] = self._colorstr((p["pencolor"],)) |
|---|
| 2333 | n/a | if self._pencolor != p["pencolor"]: |
|---|
| 2334 | n/a | newLine = True |
|---|
| 2335 | n/a | if "pensize" in p: |
|---|
| 2336 | n/a | if self._pensize != p["pensize"]: |
|---|
| 2337 | n/a | newLine = True |
|---|
| 2338 | n/a | if newLine: |
|---|
| 2339 | n/a | self._newLine() |
|---|
| 2340 | n/a | if "pendown" in p: |
|---|
| 2341 | n/a | self._drawing = p["pendown"] |
|---|
| 2342 | n/a | if "pencolor" in p: |
|---|
| 2343 | n/a | self._pencolor = p["pencolor"] |
|---|
| 2344 | n/a | if "pensize" in p: |
|---|
| 2345 | n/a | self._pensize = p["pensize"] |
|---|
| 2346 | n/a | if "fillcolor" in p: |
|---|
| 2347 | n/a | if isinstance(p["fillcolor"], tuple): |
|---|
| 2348 | n/a | p["fillcolor"] = self._colorstr((p["fillcolor"],)) |
|---|
| 2349 | n/a | self._fillcolor = p["fillcolor"] |
|---|
| 2350 | n/a | if "speed" in p: |
|---|
| 2351 | n/a | self._speed = p["speed"] |
|---|
| 2352 | n/a | if "resizemode" in p: |
|---|
| 2353 | n/a | self._resizemode = p["resizemode"] |
|---|
| 2354 | n/a | if "stretchfactor" in p: |
|---|
| 2355 | n/a | sf = p["stretchfactor"] |
|---|
| 2356 | n/a | if isinstance(sf, (int, float)): |
|---|
| 2357 | n/a | sf = (sf, sf) |
|---|
| 2358 | n/a | self._stretchfactor = sf |
|---|
| 2359 | n/a | if "outline" in p: |
|---|
| 2360 | n/a | self._outlinewidth = p["outline"] |
|---|
| 2361 | n/a | if "shown" in p: |
|---|
| 2362 | n/a | self._shown = p["shown"] |
|---|
| 2363 | n/a | if "tilt" in p: |
|---|
| 2364 | n/a | self._tilt = p["tilt"] |
|---|
| 2365 | n/a | self._update() |
|---|
| 2366 | n/a | |
|---|
| 2367 | n/a | ## three dummy methods to be implemented by child class: |
|---|
| 2368 | n/a | |
|---|
| 2369 | n/a | def _newLine(self, usePos = True): |
|---|
| 2370 | n/a | """dummy method - to be overwritten by child class""" |
|---|
| 2371 | n/a | def _update(self, count=True, forced=False): |
|---|
| 2372 | n/a | """dummy method - to be overwritten by child class""" |
|---|
| 2373 | n/a | def _color(self, args): |
|---|
| 2374 | n/a | """dummy method - to be overwritten by child class""" |
|---|
| 2375 | n/a | def _colorstr(self, args): |
|---|
| 2376 | n/a | """dummy method - to be overwritten by child class""" |
|---|
| 2377 | n/a | |
|---|
| 2378 | n/a | width = pensize |
|---|
| 2379 | n/a | up = penup |
|---|
| 2380 | n/a | pu = penup |
|---|
| 2381 | n/a | pd = pendown |
|---|
| 2382 | n/a | down = pendown |
|---|
| 2383 | n/a | st = showturtle |
|---|
| 2384 | n/a | ht = hideturtle |
|---|
| 2385 | n/a | |
|---|
| 2386 | n/a | |
|---|
| 2387 | n/a | class _TurtleImage(object): |
|---|
| 2388 | n/a | """Helper class: Datatype to store Turtle attributes |
|---|
| 2389 | n/a | """ |
|---|
| 2390 | n/a | |
|---|
| 2391 | n/a | def __init__(self, screen, shapeIndex): |
|---|
| 2392 | n/a | self.screen = screen |
|---|
| 2393 | n/a | self._type = None |
|---|
| 2394 | n/a | self._setshape(shapeIndex) |
|---|
| 2395 | n/a | |
|---|
| 2396 | n/a | def _setshape(self, shapeIndex): |
|---|
| 2397 | n/a | screen = self.screen # RawTurtle.screens[self.screenIndex] |
|---|
| 2398 | n/a | self.shapeIndex = shapeIndex |
|---|
| 2399 | n/a | if self._type == "polygon" == screen._shapes[shapeIndex]._type: |
|---|
| 2400 | n/a | return |
|---|
| 2401 | n/a | if self._type == "image" == screen._shapes[shapeIndex]._type: |
|---|
| 2402 | n/a | return |
|---|
| 2403 | n/a | if self._type in ["image", "polygon"]: |
|---|
| 2404 | n/a | screen._delete(self._item) |
|---|
| 2405 | n/a | elif self._type == "compound": |
|---|
| 2406 | n/a | for item in self._item: |
|---|
| 2407 | n/a | screen._delete(item) |
|---|
| 2408 | n/a | self._type = screen._shapes[shapeIndex]._type |
|---|
| 2409 | n/a | if self._type == "polygon": |
|---|
| 2410 | n/a | self._item = screen._createpoly() |
|---|
| 2411 | n/a | elif self._type == "image": |
|---|
| 2412 | n/a | self._item = screen._createimage(screen._shapes["blank"]._data) |
|---|
| 2413 | n/a | elif self._type == "compound": |
|---|
| 2414 | n/a | self._item = [screen._createpoly() for item in |
|---|
| 2415 | n/a | screen._shapes[shapeIndex]._data] |
|---|
| 2416 | n/a | |
|---|
| 2417 | n/a | |
|---|
| 2418 | n/a | class RawTurtle(TPen, TNavigator): |
|---|
| 2419 | n/a | """Animation part of the RawTurtle. |
|---|
| 2420 | n/a | Puts RawTurtle upon a TurtleScreen and provides tools for |
|---|
| 2421 | n/a | its animation. |
|---|
| 2422 | n/a | """ |
|---|
| 2423 | n/a | screens = [] |
|---|
| 2424 | n/a | |
|---|
| 2425 | n/a | def __init__(self, canvas=None, |
|---|
| 2426 | n/a | shape=_CFG["shape"], |
|---|
| 2427 | n/a | undobuffersize=_CFG["undobuffersize"], |
|---|
| 2428 | n/a | visible=_CFG["visible"]): |
|---|
| 2429 | n/a | if isinstance(canvas, _Screen): |
|---|
| 2430 | n/a | self.screen = canvas |
|---|
| 2431 | n/a | elif isinstance(canvas, TurtleScreen): |
|---|
| 2432 | n/a | if canvas not in RawTurtle.screens: |
|---|
| 2433 | n/a | RawTurtle.screens.append(canvas) |
|---|
| 2434 | n/a | self.screen = canvas |
|---|
| 2435 | n/a | elif isinstance(canvas, (ScrolledCanvas, Canvas)): |
|---|
| 2436 | n/a | for screen in RawTurtle.screens: |
|---|
| 2437 | n/a | if screen.cv == canvas: |
|---|
| 2438 | n/a | self.screen = screen |
|---|
| 2439 | n/a | break |
|---|
| 2440 | n/a | else: |
|---|
| 2441 | n/a | self.screen = TurtleScreen(canvas) |
|---|
| 2442 | n/a | RawTurtle.screens.append(self.screen) |
|---|
| 2443 | n/a | else: |
|---|
| 2444 | n/a | raise TurtleGraphicsError("bad cavas argument %s" % canvas) |
|---|
| 2445 | n/a | |
|---|
| 2446 | n/a | screen = self.screen |
|---|
| 2447 | n/a | TNavigator.__init__(self, screen.mode()) |
|---|
| 2448 | n/a | TPen.__init__(self) |
|---|
| 2449 | n/a | screen._turtles.append(self) |
|---|
| 2450 | n/a | self.drawingLineItem = screen._createline() |
|---|
| 2451 | n/a | self.turtle = _TurtleImage(screen, shape) |
|---|
| 2452 | n/a | self._poly = None |
|---|
| 2453 | n/a | self._creatingPoly = False |
|---|
| 2454 | n/a | self._fillitem = self._fillpath = None |
|---|
| 2455 | n/a | self._shown = visible |
|---|
| 2456 | n/a | self._hidden_from_screen = False |
|---|
| 2457 | n/a | self.currentLineItem = screen._createline() |
|---|
| 2458 | n/a | self.currentLine = [self._position] |
|---|
| 2459 | n/a | self.items = [self.currentLineItem] |
|---|
| 2460 | n/a | self.stampItems = [] |
|---|
| 2461 | n/a | self._undobuffersize = undobuffersize |
|---|
| 2462 | n/a | self.undobuffer = Tbuffer(undobuffersize) |
|---|
| 2463 | n/a | self._update() |
|---|
| 2464 | n/a | |
|---|
| 2465 | n/a | def reset(self): |
|---|
| 2466 | n/a | """Delete the turtle's drawings and restore its default values. |
|---|
| 2467 | n/a | |
|---|
| 2468 | n/a | No argument. |
|---|
| 2469 | n/a | , |
|---|
| 2470 | n/a | Delete the turtle's drawings from the screen, re-center the turtle |
|---|
| 2471 | n/a | and set variables to the default values. |
|---|
| 2472 | n/a | |
|---|
| 2473 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2474 | n/a | >>> turtle.position() |
|---|
| 2475 | n/a | (0.00,-22.00) |
|---|
| 2476 | n/a | >>> turtle.heading() |
|---|
| 2477 | n/a | 100.0 |
|---|
| 2478 | n/a | >>> turtle.reset() |
|---|
| 2479 | n/a | >>> turtle.position() |
|---|
| 2480 | n/a | (0.00,0.00) |
|---|
| 2481 | n/a | >>> turtle.heading() |
|---|
| 2482 | n/a | 0.0 |
|---|
| 2483 | n/a | """ |
|---|
| 2484 | n/a | TNavigator.reset(self) |
|---|
| 2485 | n/a | TPen._reset(self) |
|---|
| 2486 | n/a | self._clear() |
|---|
| 2487 | n/a | self._drawturtle() |
|---|
| 2488 | n/a | self._update() |
|---|
| 2489 | n/a | |
|---|
| 2490 | n/a | def setundobuffer(self, size): |
|---|
| 2491 | n/a | """Set or disable undobuffer. |
|---|
| 2492 | n/a | |
|---|
| 2493 | n/a | Argument: |
|---|
| 2494 | n/a | size -- an integer or None |
|---|
| 2495 | n/a | |
|---|
| 2496 | n/a | If size is an integer an empty undobuffer of given size is installed. |
|---|
| 2497 | n/a | Size gives the maximum number of turtle-actions that can be undone |
|---|
| 2498 | n/a | by the undo() function. |
|---|
| 2499 | n/a | If size is None, no undobuffer is present. |
|---|
| 2500 | n/a | |
|---|
| 2501 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2502 | n/a | >>> turtle.setundobuffer(42) |
|---|
| 2503 | n/a | """ |
|---|
| 2504 | n/a | if size is None: |
|---|
| 2505 | n/a | self.undobuffer = None |
|---|
| 2506 | n/a | else: |
|---|
| 2507 | n/a | self.undobuffer = Tbuffer(size) |
|---|
| 2508 | n/a | |
|---|
| 2509 | n/a | def undobufferentries(self): |
|---|
| 2510 | n/a | """Return count of entries in the undobuffer. |
|---|
| 2511 | n/a | |
|---|
| 2512 | n/a | No argument. |
|---|
| 2513 | n/a | |
|---|
| 2514 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2515 | n/a | >>> while undobufferentries(): |
|---|
| 2516 | n/a | undo() |
|---|
| 2517 | n/a | """ |
|---|
| 2518 | n/a | if self.undobuffer is None: |
|---|
| 2519 | n/a | return 0 |
|---|
| 2520 | n/a | return self.undobuffer.nr_of_items() |
|---|
| 2521 | n/a | |
|---|
| 2522 | n/a | def _clear(self): |
|---|
| 2523 | n/a | """Delete all of pen's drawings""" |
|---|
| 2524 | n/a | self._fillitem = self._fillpath = None |
|---|
| 2525 | n/a | for item in self.items: |
|---|
| 2526 | n/a | self.screen._delete(item) |
|---|
| 2527 | n/a | self.currentLineItem = self.screen._createline() |
|---|
| 2528 | n/a | self.currentLine = [] |
|---|
| 2529 | n/a | if self._drawing: |
|---|
| 2530 | n/a | self.currentLine.append(self._position) |
|---|
| 2531 | n/a | self.items = [self.currentLineItem] |
|---|
| 2532 | n/a | self.clearstamps() |
|---|
| 2533 | n/a | self.setundobuffer(self._undobuffersize) |
|---|
| 2534 | n/a | |
|---|
| 2535 | n/a | |
|---|
| 2536 | n/a | def clear(self): |
|---|
| 2537 | n/a | """Delete the turtle's drawings from the screen. Do not move turtle. |
|---|
| 2538 | n/a | |
|---|
| 2539 | n/a | No arguments. |
|---|
| 2540 | n/a | |
|---|
| 2541 | n/a | Delete the turtle's drawings from the screen. Do not move turtle. |
|---|
| 2542 | n/a | State and position of the turtle as well as drawings of other |
|---|
| 2543 | n/a | turtles are not affected. |
|---|
| 2544 | n/a | |
|---|
| 2545 | n/a | Examples (for a Turtle instance named turtle): |
|---|
| 2546 | n/a | >>> turtle.clear() |
|---|
| 2547 | n/a | """ |
|---|
| 2548 | n/a | self._clear() |
|---|
| 2549 | n/a | self._update() |
|---|
| 2550 | n/a | |
|---|
| 2551 | n/a | def _update_data(self): |
|---|
| 2552 | n/a | self.screen._incrementudc() |
|---|
| 2553 | n/a | if self.screen._updatecounter != 0: |
|---|
| 2554 | n/a | return |
|---|
| 2555 | n/a | if len(self.currentLine)>1: |
|---|
| 2556 | n/a | self.screen._drawline(self.currentLineItem, self.currentLine, |
|---|
| 2557 | n/a | self._pencolor, self._pensize) |
|---|
| 2558 | n/a | |
|---|
| 2559 | n/a | def _update(self): |
|---|
| 2560 | n/a | """Perform a Turtle-data update. |
|---|
| 2561 | n/a | """ |
|---|
| 2562 | n/a | screen = self.screen |
|---|
| 2563 | n/a | if screen._tracing == 0: |
|---|
| 2564 | n/a | return |
|---|
| 2565 | n/a | elif screen._tracing == 1: |
|---|
| 2566 | n/a | self._update_data() |
|---|
| 2567 | n/a | self._drawturtle() |
|---|
| 2568 | n/a | screen._update() # TurtleScreenBase |
|---|
| 2569 | n/a | screen._delay(screen._delayvalue) # TurtleScreenBase |
|---|
| 2570 | n/a | else: |
|---|
| 2571 | n/a | self._update_data() |
|---|
| 2572 | n/a | if screen._updatecounter == 0: |
|---|
| 2573 | n/a | for t in screen.turtles(): |
|---|
| 2574 | n/a | t._drawturtle() |
|---|
| 2575 | n/a | screen._update() |
|---|
| 2576 | n/a | |
|---|
| 2577 | n/a | def tracer(self, flag=None, delay=None): |
|---|
| 2578 | n/a | """Turns turtle animation on/off and set delay for update drawings. |
|---|
| 2579 | n/a | |
|---|
| 2580 | n/a | Optional arguments: |
|---|
| 2581 | n/a | n -- nonnegative integer |
|---|
| 2582 | n/a | delay -- nonnegative integer |
|---|
| 2583 | n/a | |
|---|
| 2584 | n/a | If n is given, only each n-th regular screen update is really performed. |
|---|
| 2585 | n/a | (Can be used to accelerate the drawing of complex graphics.) |
|---|
| 2586 | n/a | Second arguments sets delay value (see RawTurtle.delay()) |
|---|
| 2587 | n/a | |
|---|
| 2588 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2589 | n/a | >>> turtle.tracer(8, 25) |
|---|
| 2590 | n/a | >>> dist = 2 |
|---|
| 2591 | n/a | >>> for i in range(200): |
|---|
| 2592 | n/a | turtle.fd(dist) |
|---|
| 2593 | n/a | turtle.rt(90) |
|---|
| 2594 | n/a | dist += 2 |
|---|
| 2595 | n/a | """ |
|---|
| 2596 | n/a | return self.screen.tracer(flag, delay) |
|---|
| 2597 | n/a | |
|---|
| 2598 | n/a | def _color(self, args): |
|---|
| 2599 | n/a | return self.screen._color(args) |
|---|
| 2600 | n/a | |
|---|
| 2601 | n/a | def _colorstr(self, args): |
|---|
| 2602 | n/a | return self.screen._colorstr(args) |
|---|
| 2603 | n/a | |
|---|
| 2604 | n/a | def _cc(self, args): |
|---|
| 2605 | n/a | """Convert colortriples to hexstrings. |
|---|
| 2606 | n/a | """ |
|---|
| 2607 | n/a | if isinstance(args, str): |
|---|
| 2608 | n/a | return args |
|---|
| 2609 | n/a | try: |
|---|
| 2610 | n/a | r, g, b = args |
|---|
| 2611 | n/a | except: |
|---|
| 2612 | n/a | raise TurtleGraphicsError("bad color arguments: %s" % str(args)) |
|---|
| 2613 | n/a | if self.screen._colormode == 1.0: |
|---|
| 2614 | n/a | r, g, b = [round(255.0*x) for x in (r, g, b)] |
|---|
| 2615 | n/a | if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)): |
|---|
| 2616 | n/a | raise TurtleGraphicsError("bad color sequence: %s" % str(args)) |
|---|
| 2617 | n/a | return "#%02x%02x%02x" % (r, g, b) |
|---|
| 2618 | n/a | |
|---|
| 2619 | n/a | def clone(self): |
|---|
| 2620 | n/a | """Create and return a clone of the turtle. |
|---|
| 2621 | n/a | |
|---|
| 2622 | n/a | No argument. |
|---|
| 2623 | n/a | |
|---|
| 2624 | n/a | Create and return a clone of the turtle with same position, heading |
|---|
| 2625 | n/a | and turtle properties. |
|---|
| 2626 | n/a | |
|---|
| 2627 | n/a | Example (for a Turtle instance named mick): |
|---|
| 2628 | n/a | mick = Turtle() |
|---|
| 2629 | n/a | joe = mick.clone() |
|---|
| 2630 | n/a | """ |
|---|
| 2631 | n/a | screen = self.screen |
|---|
| 2632 | n/a | self._newLine(self._drawing) |
|---|
| 2633 | n/a | |
|---|
| 2634 | n/a | turtle = self.turtle |
|---|
| 2635 | n/a | self.screen = None |
|---|
| 2636 | n/a | self.turtle = None # too make self deepcopy-able |
|---|
| 2637 | n/a | |
|---|
| 2638 | n/a | q = deepcopy(self) |
|---|
| 2639 | n/a | |
|---|
| 2640 | n/a | self.screen = screen |
|---|
| 2641 | n/a | self.turtle = turtle |
|---|
| 2642 | n/a | |
|---|
| 2643 | n/a | q.screen = screen |
|---|
| 2644 | n/a | q.turtle = _TurtleImage(screen, self.turtle.shapeIndex) |
|---|
| 2645 | n/a | |
|---|
| 2646 | n/a | screen._turtles.append(q) |
|---|
| 2647 | n/a | ttype = screen._shapes[self.turtle.shapeIndex]._type |
|---|
| 2648 | n/a | if ttype == "polygon": |
|---|
| 2649 | n/a | q.turtle._item = screen._createpoly() |
|---|
| 2650 | n/a | elif ttype == "image": |
|---|
| 2651 | n/a | q.turtle._item = screen._createimage(screen._shapes["blank"]._data) |
|---|
| 2652 | n/a | elif ttype == "compound": |
|---|
| 2653 | n/a | q.turtle._item = [screen._createpoly() for item in |
|---|
| 2654 | n/a | screen._shapes[self.turtle.shapeIndex]._data] |
|---|
| 2655 | n/a | q.currentLineItem = screen._createline() |
|---|
| 2656 | n/a | q._update() |
|---|
| 2657 | n/a | return q |
|---|
| 2658 | n/a | |
|---|
| 2659 | n/a | def shape(self, name=None): |
|---|
| 2660 | n/a | """Set turtle shape to shape with given name / return current shapename. |
|---|
| 2661 | n/a | |
|---|
| 2662 | n/a | Optional argument: |
|---|
| 2663 | n/a | name -- a string, which is a valid shapename |
|---|
| 2664 | n/a | |
|---|
| 2665 | n/a | Set turtle shape to shape with given name or, if name is not given, |
|---|
| 2666 | n/a | return name of current shape. |
|---|
| 2667 | n/a | Shape with name must exist in the TurtleScreen's shape dictionary. |
|---|
| 2668 | n/a | Initially there are the following polygon shapes: |
|---|
| 2669 | n/a | 'arrow', 'turtle', 'circle', 'square', 'triangle', 'classic'. |
|---|
| 2670 | n/a | To learn about how to deal with shapes see Screen-method register_shape. |
|---|
| 2671 | n/a | |
|---|
| 2672 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2673 | n/a | >>> turtle.shape() |
|---|
| 2674 | n/a | 'arrow' |
|---|
| 2675 | n/a | >>> turtle.shape("turtle") |
|---|
| 2676 | n/a | >>> turtle.shape() |
|---|
| 2677 | n/a | 'turtle' |
|---|
| 2678 | n/a | """ |
|---|
| 2679 | n/a | if name is None: |
|---|
| 2680 | n/a | return self.turtle.shapeIndex |
|---|
| 2681 | n/a | if not name in self.screen.getshapes(): |
|---|
| 2682 | n/a | raise TurtleGraphicsError("There is no shape named %s" % name) |
|---|
| 2683 | n/a | self.turtle._setshape(name) |
|---|
| 2684 | n/a | self._update() |
|---|
| 2685 | n/a | |
|---|
| 2686 | n/a | def shapesize(self, stretch_wid=None, stretch_len=None, outline=None): |
|---|
| 2687 | n/a | """Set/return turtle's stretchfactors/outline. Set resizemode to "user". |
|---|
| 2688 | n/a | |
|---|
| 2689 | n/a | Optinonal arguments: |
|---|
| 2690 | n/a | stretch_wid : positive number |
|---|
| 2691 | n/a | stretch_len : positive number |
|---|
| 2692 | n/a | outline : positive number |
|---|
| 2693 | n/a | |
|---|
| 2694 | n/a | Return or set the pen's attributes x/y-stretchfactors and/or outline. |
|---|
| 2695 | n/a | Set resizemode to "user". |
|---|
| 2696 | n/a | If and only if resizemode is set to "user", the turtle will be displayed |
|---|
| 2697 | n/a | stretched according to its stretchfactors: |
|---|
| 2698 | n/a | stretch_wid is stretchfactor perpendicular to orientation |
|---|
| 2699 | n/a | stretch_len is stretchfactor in direction of turtles orientation. |
|---|
| 2700 | n/a | outline determines the width of the shapes's outline. |
|---|
| 2701 | n/a | |
|---|
| 2702 | n/a | Examples (for a Turtle instance named turtle): |
|---|
| 2703 | n/a | >>> turtle.resizemode("user") |
|---|
| 2704 | n/a | >>> turtle.shapesize(5, 5, 12) |
|---|
| 2705 | n/a | >>> turtle.shapesize(outline=8) |
|---|
| 2706 | n/a | """ |
|---|
| 2707 | n/a | if stretch_wid is stretch_len is outline is None: |
|---|
| 2708 | n/a | stretch_wid, stretch_len = self._stretchfactor |
|---|
| 2709 | n/a | return stretch_wid, stretch_len, self._outlinewidth |
|---|
| 2710 | n/a | if stretch_wid is not None: |
|---|
| 2711 | n/a | if stretch_len is None: |
|---|
| 2712 | n/a | stretchfactor = stretch_wid, stretch_wid |
|---|
| 2713 | n/a | else: |
|---|
| 2714 | n/a | stretchfactor = stretch_wid, stretch_len |
|---|
| 2715 | n/a | elif stretch_len is not None: |
|---|
| 2716 | n/a | stretchfactor = self._stretchfactor[0], stretch_len |
|---|
| 2717 | n/a | else: |
|---|
| 2718 | n/a | stretchfactor = self._stretchfactor |
|---|
| 2719 | n/a | if outline is None: |
|---|
| 2720 | n/a | outline = self._outlinewidth |
|---|
| 2721 | n/a | self.pen(resizemode="user", |
|---|
| 2722 | n/a | stretchfactor=stretchfactor, outline=outline) |
|---|
| 2723 | n/a | |
|---|
| 2724 | n/a | def settiltangle(self, angle): |
|---|
| 2725 | n/a | """Rotate the turtleshape to point in the specified direction |
|---|
| 2726 | n/a | |
|---|
| 2727 | n/a | Optional argument: |
|---|
| 2728 | n/a | angle -- number |
|---|
| 2729 | n/a | |
|---|
| 2730 | n/a | Rotate the turtleshape to point in the direction specified by angle, |
|---|
| 2731 | n/a | regardless of its current tilt-angle. DO NOT change the turtle's |
|---|
| 2732 | n/a | heading (direction of movement). |
|---|
| 2733 | n/a | |
|---|
| 2734 | n/a | |
|---|
| 2735 | n/a | Examples (for a Turtle instance named turtle): |
|---|
| 2736 | n/a | >>> turtle.shape("circle") |
|---|
| 2737 | n/a | >>> turtle.shapesize(5,2) |
|---|
| 2738 | n/a | >>> turtle.settiltangle(45) |
|---|
| 2739 | n/a | >>> stamp() |
|---|
| 2740 | n/a | >>> turtle.fd(50) |
|---|
| 2741 | n/a | >>> turtle.settiltangle(-45) |
|---|
| 2742 | n/a | >>> stamp() |
|---|
| 2743 | n/a | >>> turtle.fd(50) |
|---|
| 2744 | n/a | """ |
|---|
| 2745 | n/a | tilt = -angle * self._degreesPerAU * self._angleOrient |
|---|
| 2746 | n/a | tilt = (tilt * math.pi / 180.0) % (2*math.pi) |
|---|
| 2747 | n/a | self.pen(resizemode="user", tilt=tilt) |
|---|
| 2748 | n/a | |
|---|
| 2749 | n/a | def tiltangle(self): |
|---|
| 2750 | n/a | """Return the current tilt-angle. |
|---|
| 2751 | n/a | |
|---|
| 2752 | n/a | No argument. |
|---|
| 2753 | n/a | |
|---|
| 2754 | n/a | Return the current tilt-angle, i. e. the angle between the |
|---|
| 2755 | n/a | orientation of the turtleshape and the heading of the turtle |
|---|
| 2756 | n/a | (its direction of movement). |
|---|
| 2757 | n/a | |
|---|
| 2758 | n/a | Examples (for a Turtle instance named turtle): |
|---|
| 2759 | n/a | >>> turtle.shape("circle") |
|---|
| 2760 | n/a | >>> turtle.shapesize(5,2) |
|---|
| 2761 | n/a | >>> turtle.tilt(45) |
|---|
| 2762 | n/a | >>> turtle.tiltangle() |
|---|
| 2763 | n/a | >>> |
|---|
| 2764 | n/a | """ |
|---|
| 2765 | n/a | tilt = -self._tilt * (180.0/math.pi) * self._angleOrient |
|---|
| 2766 | n/a | return (tilt / self._degreesPerAU) % self._fullcircle |
|---|
| 2767 | n/a | |
|---|
| 2768 | n/a | def tilt(self, angle): |
|---|
| 2769 | n/a | """Rotate the turtleshape by angle. |
|---|
| 2770 | n/a | |
|---|
| 2771 | n/a | Argument: |
|---|
| 2772 | n/a | angle - a number |
|---|
| 2773 | n/a | |
|---|
| 2774 | n/a | Rotate the turtleshape by angle from its current tilt-angle, |
|---|
| 2775 | n/a | but do NOT change the turtle's heading (direction of movement). |
|---|
| 2776 | n/a | |
|---|
| 2777 | n/a | Examples (for a Turtle instance named turtle): |
|---|
| 2778 | n/a | >>> turtle.shape("circle") |
|---|
| 2779 | n/a | >>> turtle.shapesize(5,2) |
|---|
| 2780 | n/a | >>> turtle.tilt(30) |
|---|
| 2781 | n/a | >>> turtle.fd(50) |
|---|
| 2782 | n/a | >>> turtle.tilt(30) |
|---|
| 2783 | n/a | >>> turtle.fd(50) |
|---|
| 2784 | n/a | """ |
|---|
| 2785 | n/a | self.settiltangle(angle + self.tiltangle()) |
|---|
| 2786 | n/a | |
|---|
| 2787 | n/a | def _polytrafo(self, poly): |
|---|
| 2788 | n/a | """Computes transformed polygon shapes from a shape |
|---|
| 2789 | n/a | according to current position and heading. |
|---|
| 2790 | n/a | """ |
|---|
| 2791 | n/a | screen = self.screen |
|---|
| 2792 | n/a | p0, p1 = self._position |
|---|
| 2793 | n/a | e0, e1 = self._orient |
|---|
| 2794 | n/a | e = Vec2D(e0, e1 * screen.yscale / screen.xscale) |
|---|
| 2795 | n/a | e0, e1 = (1.0 / abs(e)) * e |
|---|
| 2796 | n/a | return [(p0+(e1*x+e0*y)/screen.xscale, p1+(-e0*x+e1*y)/screen.yscale) |
|---|
| 2797 | n/a | for (x, y) in poly] |
|---|
| 2798 | n/a | |
|---|
| 2799 | n/a | def _drawturtle(self): |
|---|
| 2800 | n/a | """Manages the correct rendering of the turtle with respect to |
|---|
| 2801 | n/a | its shape, resizemode, stretch and tilt etc.""" |
|---|
| 2802 | n/a | screen = self.screen |
|---|
| 2803 | n/a | shape = screen._shapes[self.turtle.shapeIndex] |
|---|
| 2804 | n/a | ttype = shape._type |
|---|
| 2805 | n/a | titem = self.turtle._item |
|---|
| 2806 | n/a | if self._shown and screen._updatecounter == 0 and screen._tracing > 0: |
|---|
| 2807 | n/a | self._hidden_from_screen = False |
|---|
| 2808 | n/a | tshape = shape._data |
|---|
| 2809 | n/a | if ttype == "polygon": |
|---|
| 2810 | n/a | if self._resizemode == "noresize": |
|---|
| 2811 | n/a | w = 1 |
|---|
| 2812 | n/a | shape = tshape |
|---|
| 2813 | n/a | else: |
|---|
| 2814 | n/a | if self._resizemode == "auto": |
|---|
| 2815 | n/a | lx = ly = max(1, self._pensize/5.0) |
|---|
| 2816 | n/a | w = self._pensize |
|---|
| 2817 | n/a | tiltangle = 0 |
|---|
| 2818 | n/a | elif self._resizemode == "user": |
|---|
| 2819 | n/a | lx, ly = self._stretchfactor |
|---|
| 2820 | n/a | w = self._outlinewidth |
|---|
| 2821 | n/a | tiltangle = self._tilt |
|---|
| 2822 | n/a | shape = [(lx*x, ly*y) for (x, y) in tshape] |
|---|
| 2823 | n/a | t0, t1 = math.sin(tiltangle), math.cos(tiltangle) |
|---|
| 2824 | n/a | shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape] |
|---|
| 2825 | n/a | shape = self._polytrafo(shape) |
|---|
| 2826 | n/a | fc, oc = self._fillcolor, self._pencolor |
|---|
| 2827 | n/a | screen._drawpoly(titem, shape, fill=fc, outline=oc, |
|---|
| 2828 | n/a | width=w, top=True) |
|---|
| 2829 | n/a | elif ttype == "image": |
|---|
| 2830 | n/a | screen._drawimage(titem, self._position, tshape) |
|---|
| 2831 | n/a | elif ttype == "compound": |
|---|
| 2832 | n/a | lx, ly = self._stretchfactor |
|---|
| 2833 | n/a | w = self._outlinewidth |
|---|
| 2834 | n/a | for item, (poly, fc, oc) in zip(titem, tshape): |
|---|
| 2835 | n/a | poly = [(lx*x, ly*y) for (x, y) in poly] |
|---|
| 2836 | n/a | poly = self._polytrafo(poly) |
|---|
| 2837 | n/a | screen._drawpoly(item, poly, fill=self._cc(fc), |
|---|
| 2838 | n/a | outline=self._cc(oc), width=w, top=True) |
|---|
| 2839 | n/a | else: |
|---|
| 2840 | n/a | if self._hidden_from_screen: |
|---|
| 2841 | n/a | return |
|---|
| 2842 | n/a | if ttype == "polygon": |
|---|
| 2843 | n/a | screen._drawpoly(titem, ((0, 0), (0, 0), (0, 0)), "", "") |
|---|
| 2844 | n/a | elif ttype == "image": |
|---|
| 2845 | n/a | screen._drawimage(titem, self._position, |
|---|
| 2846 | n/a | screen._shapes["blank"]._data) |
|---|
| 2847 | n/a | elif ttype == "compound": |
|---|
| 2848 | n/a | for item in titem: |
|---|
| 2849 | n/a | screen._drawpoly(item, ((0, 0), (0, 0), (0, 0)), "", "") |
|---|
| 2850 | n/a | self._hidden_from_screen = True |
|---|
| 2851 | n/a | |
|---|
| 2852 | n/a | ############################## stamp stuff ############################### |
|---|
| 2853 | n/a | |
|---|
| 2854 | n/a | def stamp(self): |
|---|
| 2855 | n/a | """Stamp a copy of the turtleshape onto the canvas and return its id. |
|---|
| 2856 | n/a | |
|---|
| 2857 | n/a | No argument. |
|---|
| 2858 | n/a | |
|---|
| 2859 | n/a | Stamp a copy of the turtle shape onto the canvas at the current |
|---|
| 2860 | n/a | turtle position. Return a stamp_id for that stamp, which can be |
|---|
| 2861 | n/a | used to delete it by calling clearstamp(stamp_id). |
|---|
| 2862 | n/a | |
|---|
| 2863 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2864 | n/a | >>> turtle.color("blue") |
|---|
| 2865 | n/a | >>> turtle.stamp() |
|---|
| 2866 | n/a | 13 |
|---|
| 2867 | n/a | >>> turtle.fd(50) |
|---|
| 2868 | n/a | """ |
|---|
| 2869 | n/a | screen = self.screen |
|---|
| 2870 | n/a | shape = screen._shapes[self.turtle.shapeIndex] |
|---|
| 2871 | n/a | ttype = shape._type |
|---|
| 2872 | n/a | tshape = shape._data |
|---|
| 2873 | n/a | if ttype == "polygon": |
|---|
| 2874 | n/a | stitem = screen._createpoly() |
|---|
| 2875 | n/a | if self._resizemode == "noresize": |
|---|
| 2876 | n/a | w = 1 |
|---|
| 2877 | n/a | shape = tshape |
|---|
| 2878 | n/a | else: |
|---|
| 2879 | n/a | if self._resizemode == "auto": |
|---|
| 2880 | n/a | lx = ly = max(1, self._pensize/5.0) |
|---|
| 2881 | n/a | w = self._pensize |
|---|
| 2882 | n/a | tiltangle = 0 |
|---|
| 2883 | n/a | elif self._resizemode == "user": |
|---|
| 2884 | n/a | lx, ly = self._stretchfactor |
|---|
| 2885 | n/a | w = self._outlinewidth |
|---|
| 2886 | n/a | tiltangle = self._tilt |
|---|
| 2887 | n/a | shape = [(lx*x, ly*y) for (x, y) in tshape] |
|---|
| 2888 | n/a | t0, t1 = math.sin(tiltangle), math.cos(tiltangle) |
|---|
| 2889 | n/a | shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape] |
|---|
| 2890 | n/a | shape = self._polytrafo(shape) |
|---|
| 2891 | n/a | fc, oc = self._fillcolor, self._pencolor |
|---|
| 2892 | n/a | screen._drawpoly(stitem, shape, fill=fc, outline=oc, |
|---|
| 2893 | n/a | width=w, top=True) |
|---|
| 2894 | n/a | elif ttype == "image": |
|---|
| 2895 | n/a | stitem = screen._createimage("") |
|---|
| 2896 | n/a | screen._drawimage(stitem, self._position, tshape) |
|---|
| 2897 | n/a | elif ttype == "compound": |
|---|
| 2898 | n/a | stitem = [] |
|---|
| 2899 | n/a | for element in tshape: |
|---|
| 2900 | n/a | item = screen._createpoly() |
|---|
| 2901 | n/a | stitem.append(item) |
|---|
| 2902 | n/a | stitem = tuple(stitem) |
|---|
| 2903 | n/a | lx, ly = self._stretchfactor |
|---|
| 2904 | n/a | w = self._outlinewidth |
|---|
| 2905 | n/a | for item, (poly, fc, oc) in zip(stitem, tshape): |
|---|
| 2906 | n/a | poly = [(lx*x, ly*y) for (x, y) in poly] |
|---|
| 2907 | n/a | poly = self._polytrafo(poly) |
|---|
| 2908 | n/a | screen._drawpoly(item, poly, fill=self._cc(fc), |
|---|
| 2909 | n/a | outline=self._cc(oc), width=w, top=True) |
|---|
| 2910 | n/a | self.stampItems.append(stitem) |
|---|
| 2911 | n/a | self.undobuffer.push(("stamp", stitem)) |
|---|
| 2912 | n/a | return stitem |
|---|
| 2913 | n/a | |
|---|
| 2914 | n/a | def _clearstamp(self, stampid): |
|---|
| 2915 | n/a | """does the work for clearstamp() and clearstamps() |
|---|
| 2916 | n/a | """ |
|---|
| 2917 | n/a | if stampid in self.stampItems: |
|---|
| 2918 | n/a | if isinstance(stampid, tuple): |
|---|
| 2919 | n/a | for subitem in stampid: |
|---|
| 2920 | n/a | self.screen._delete(subitem) |
|---|
| 2921 | n/a | else: |
|---|
| 2922 | n/a | self.screen._delete(stampid) |
|---|
| 2923 | n/a | self.stampItems.remove(stampid) |
|---|
| 2924 | n/a | # Delete stampitem from undobuffer if necessary |
|---|
| 2925 | n/a | # if clearstamp is called directly. |
|---|
| 2926 | n/a | item = ("stamp", stampid) |
|---|
| 2927 | n/a | buf = self.undobuffer |
|---|
| 2928 | n/a | if item not in buf.buffer: |
|---|
| 2929 | n/a | return |
|---|
| 2930 | n/a | index = buf.buffer.index(item) |
|---|
| 2931 | n/a | buf.buffer.remove(item) |
|---|
| 2932 | n/a | if index <= buf.ptr: |
|---|
| 2933 | n/a | buf.ptr = (buf.ptr - 1) % buf.bufsize |
|---|
| 2934 | n/a | buf.buffer.insert((buf.ptr+1)%buf.bufsize, [None]) |
|---|
| 2935 | n/a | |
|---|
| 2936 | n/a | def clearstamp(self, stampid): |
|---|
| 2937 | n/a | """Delete stamp with given stampid |
|---|
| 2938 | n/a | |
|---|
| 2939 | n/a | Argument: |
|---|
| 2940 | n/a | stampid - an integer, must be return value of previous stamp() call. |
|---|
| 2941 | n/a | |
|---|
| 2942 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2943 | n/a | >>> turtle.color("blue") |
|---|
| 2944 | n/a | >>> astamp = turtle.stamp() |
|---|
| 2945 | n/a | >>> turtle.fd(50) |
|---|
| 2946 | n/a | >>> turtle.clearstamp(astamp) |
|---|
| 2947 | n/a | """ |
|---|
| 2948 | n/a | self._clearstamp(stampid) |
|---|
| 2949 | n/a | self._update() |
|---|
| 2950 | n/a | |
|---|
| 2951 | n/a | def clearstamps(self, n=None): |
|---|
| 2952 | n/a | """Delete all or first/last n of turtle's stamps. |
|---|
| 2953 | n/a | |
|---|
| 2954 | n/a | Optional argument: |
|---|
| 2955 | n/a | n -- an integer |
|---|
| 2956 | n/a | |
|---|
| 2957 | n/a | If n is None, delete all of pen's stamps, |
|---|
| 2958 | n/a | else if n > 0 delete first n stamps |
|---|
| 2959 | n/a | else if n < 0 delete last n stamps. |
|---|
| 2960 | n/a | |
|---|
| 2961 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 2962 | n/a | >>> for i in range(8): |
|---|
| 2963 | n/a | turtle.stamp(); turtle.fd(30) |
|---|
| 2964 | n/a | ... |
|---|
| 2965 | n/a | >>> turtle.clearstamps(2) |
|---|
| 2966 | n/a | >>> turtle.clearstamps(-2) |
|---|
| 2967 | n/a | >>> turtle.clearstamps() |
|---|
| 2968 | n/a | """ |
|---|
| 2969 | n/a | if n is None: |
|---|
| 2970 | n/a | toDelete = self.stampItems[:] |
|---|
| 2971 | n/a | elif n >= 0: |
|---|
| 2972 | n/a | toDelete = self.stampItems[:n] |
|---|
| 2973 | n/a | else: |
|---|
| 2974 | n/a | toDelete = self.stampItems[n:] |
|---|
| 2975 | n/a | for item in toDelete: |
|---|
| 2976 | n/a | self._clearstamp(item) |
|---|
| 2977 | n/a | self._update() |
|---|
| 2978 | n/a | |
|---|
| 2979 | n/a | def _goto(self, end): |
|---|
| 2980 | n/a | """Move the pen to the point end, thereby drawing a line |
|---|
| 2981 | n/a | if pen is down. All other methodes for turtle movement depend |
|---|
| 2982 | n/a | on this one. |
|---|
| 2983 | n/a | """ |
|---|
| 2984 | n/a | ## Version mit undo-stuff |
|---|
| 2985 | n/a | go_modes = ( self._drawing, |
|---|
| 2986 | n/a | self._pencolor, |
|---|
| 2987 | n/a | self._pensize, |
|---|
| 2988 | n/a | isinstance(self._fillpath, list)) |
|---|
| 2989 | n/a | screen = self.screen |
|---|
| 2990 | n/a | undo_entry = ("go", self._position, end, go_modes, |
|---|
| 2991 | n/a | (self.currentLineItem, |
|---|
| 2992 | n/a | self.currentLine[:], |
|---|
| 2993 | n/a | screen._pointlist(self.currentLineItem), |
|---|
| 2994 | n/a | self.items[:]) |
|---|
| 2995 | n/a | ) |
|---|
| 2996 | n/a | if self.undobuffer: |
|---|
| 2997 | n/a | self.undobuffer.push(undo_entry) |
|---|
| 2998 | n/a | start = self._position |
|---|
| 2999 | n/a | if self._speed and screen._tracing == 1: |
|---|
| 3000 | n/a | diff = (end-start) |
|---|
| 3001 | n/a | diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2 |
|---|
| 3002 | n/a | nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed)) |
|---|
| 3003 | n/a | delta = diff * (1.0/nhops) |
|---|
| 3004 | n/a | for n in range(1, nhops): |
|---|
| 3005 | n/a | if n == 1: |
|---|
| 3006 | n/a | top = True |
|---|
| 3007 | n/a | else: |
|---|
| 3008 | n/a | top = False |
|---|
| 3009 | n/a | self._position = start + delta * n |
|---|
| 3010 | n/a | if self._drawing: |
|---|
| 3011 | n/a | screen._drawline(self.drawingLineItem, |
|---|
| 3012 | n/a | (start, self._position), |
|---|
| 3013 | n/a | self._pencolor, self._pensize, top) |
|---|
| 3014 | n/a | self._update() |
|---|
| 3015 | n/a | if self._drawing: |
|---|
| 3016 | n/a | screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)), |
|---|
| 3017 | n/a | fill="", width=self._pensize) |
|---|
| 3018 | n/a | # Turtle now at end, |
|---|
| 3019 | n/a | if self._drawing: # now update currentLine |
|---|
| 3020 | n/a | self.currentLine.append(end) |
|---|
| 3021 | n/a | if isinstance(self._fillpath, list): |
|---|
| 3022 | n/a | self._fillpath.append(end) |
|---|
| 3023 | n/a | ###### vererbung!!!!!!!!!!!!!!!!!!!!!! |
|---|
| 3024 | n/a | self._position = end |
|---|
| 3025 | n/a | if self._creatingPoly: |
|---|
| 3026 | n/a | self._poly.append(end) |
|---|
| 3027 | n/a | if len(self.currentLine) > 42: # 42! answer to the ultimate question |
|---|
| 3028 | n/a | # of life, the universe and everything |
|---|
| 3029 | n/a | self._newLine() |
|---|
| 3030 | n/a | self._update() #count=True) |
|---|
| 3031 | n/a | |
|---|
| 3032 | n/a | def _undogoto(self, entry): |
|---|
| 3033 | n/a | """Reverse a _goto. Used for undo() |
|---|
| 3034 | n/a | """ |
|---|
| 3035 | n/a | old, new, go_modes, coodata = entry |
|---|
| 3036 | n/a | drawing, pc, ps, filling = go_modes |
|---|
| 3037 | n/a | cLI, cL, pl, items = coodata |
|---|
| 3038 | n/a | screen = self.screen |
|---|
| 3039 | n/a | if abs(self._position - new) > 0.5: |
|---|
| 3040 | n/a | print "undogoto: HALLO-DA-STIMMT-WAS-NICHT!" |
|---|
| 3041 | n/a | # restore former situation |
|---|
| 3042 | n/a | self.currentLineItem = cLI |
|---|
| 3043 | n/a | self.currentLine = cL |
|---|
| 3044 | n/a | |
|---|
| 3045 | n/a | if pl == [(0, 0), (0, 0)]: |
|---|
| 3046 | n/a | usepc = "" |
|---|
| 3047 | n/a | else: |
|---|
| 3048 | n/a | usepc = pc |
|---|
| 3049 | n/a | screen._drawline(cLI, pl, fill=usepc, width=ps) |
|---|
| 3050 | n/a | |
|---|
| 3051 | n/a | todelete = [i for i in self.items if (i not in items) and |
|---|
| 3052 | n/a | (screen._type(i) == "line")] |
|---|
| 3053 | n/a | for i in todelete: |
|---|
| 3054 | n/a | screen._delete(i) |
|---|
| 3055 | n/a | self.items.remove(i) |
|---|
| 3056 | n/a | |
|---|
| 3057 | n/a | start = old |
|---|
| 3058 | n/a | if self._speed and screen._tracing == 1: |
|---|
| 3059 | n/a | diff = old - new |
|---|
| 3060 | n/a | diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2 |
|---|
| 3061 | n/a | nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed)) |
|---|
| 3062 | n/a | delta = diff * (1.0/nhops) |
|---|
| 3063 | n/a | for n in range(1, nhops): |
|---|
| 3064 | n/a | if n == 1: |
|---|
| 3065 | n/a | top = True |
|---|
| 3066 | n/a | else: |
|---|
| 3067 | n/a | top = False |
|---|
| 3068 | n/a | self._position = new + delta * n |
|---|
| 3069 | n/a | if drawing: |
|---|
| 3070 | n/a | screen._drawline(self.drawingLineItem, |
|---|
| 3071 | n/a | (start, self._position), |
|---|
| 3072 | n/a | pc, ps, top) |
|---|
| 3073 | n/a | self._update() |
|---|
| 3074 | n/a | if drawing: |
|---|
| 3075 | n/a | screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)), |
|---|
| 3076 | n/a | fill="", width=ps) |
|---|
| 3077 | n/a | # Turtle now at position old, |
|---|
| 3078 | n/a | self._position = old |
|---|
| 3079 | n/a | ## if undo is done during crating a polygon, the last vertex |
|---|
| 3080 | n/a | ## will be deleted. if the polygon is entirel deleted, |
|---|
| 3081 | n/a | ## creatigPoly will be set to False. |
|---|
| 3082 | n/a | ## Polygons created before the last one will not be affected by undo() |
|---|
| 3083 | n/a | if self._creatingPoly: |
|---|
| 3084 | n/a | if len(self._poly) > 0: |
|---|
| 3085 | n/a | self._poly.pop() |
|---|
| 3086 | n/a | if self._poly == []: |
|---|
| 3087 | n/a | self._creatingPoly = False |
|---|
| 3088 | n/a | self._poly = None |
|---|
| 3089 | n/a | if filling: |
|---|
| 3090 | n/a | if self._fillpath == []: |
|---|
| 3091 | n/a | self._fillpath = None |
|---|
| 3092 | n/a | print "Unwahrscheinlich in _undogoto!" |
|---|
| 3093 | n/a | elif self._fillpath is not None: |
|---|
| 3094 | n/a | self._fillpath.pop() |
|---|
| 3095 | n/a | self._update() #count=True) |
|---|
| 3096 | n/a | |
|---|
| 3097 | n/a | def _rotate(self, angle): |
|---|
| 3098 | n/a | """Turns pen clockwise by angle. |
|---|
| 3099 | n/a | """ |
|---|
| 3100 | n/a | if self.undobuffer: |
|---|
| 3101 | n/a | self.undobuffer.push(("rot", angle, self._degreesPerAU)) |
|---|
| 3102 | n/a | angle *= self._degreesPerAU |
|---|
| 3103 | n/a | neworient = self._orient.rotate(angle) |
|---|
| 3104 | n/a | tracing = self.screen._tracing |
|---|
| 3105 | n/a | if tracing == 1 and self._speed > 0: |
|---|
| 3106 | n/a | anglevel = 3.0 * self._speed |
|---|
| 3107 | n/a | steps = 1 + int(abs(angle)/anglevel) |
|---|
| 3108 | n/a | delta = 1.0*angle/steps |
|---|
| 3109 | n/a | for _ in range(steps): |
|---|
| 3110 | n/a | self._orient = self._orient.rotate(delta) |
|---|
| 3111 | n/a | self._update() |
|---|
| 3112 | n/a | self._orient = neworient |
|---|
| 3113 | n/a | self._update() |
|---|
| 3114 | n/a | |
|---|
| 3115 | n/a | def _newLine(self, usePos=True): |
|---|
| 3116 | n/a | """Closes current line item and starts a new one. |
|---|
| 3117 | n/a | Remark: if current line became too long, animation |
|---|
| 3118 | n/a | performance (via _drawline) slowed down considerably. |
|---|
| 3119 | n/a | """ |
|---|
| 3120 | n/a | if len(self.currentLine) > 1: |
|---|
| 3121 | n/a | self.screen._drawline(self.currentLineItem, self.currentLine, |
|---|
| 3122 | n/a | self._pencolor, self._pensize) |
|---|
| 3123 | n/a | self.currentLineItem = self.screen._createline() |
|---|
| 3124 | n/a | self.items.append(self.currentLineItem) |
|---|
| 3125 | n/a | else: |
|---|
| 3126 | n/a | self.screen._drawline(self.currentLineItem, top=True) |
|---|
| 3127 | n/a | self.currentLine = [] |
|---|
| 3128 | n/a | if usePos: |
|---|
| 3129 | n/a | self.currentLine = [self._position] |
|---|
| 3130 | n/a | |
|---|
| 3131 | n/a | def fill(self, flag=None): |
|---|
| 3132 | n/a | """Call fill(True) before drawing a shape to fill, fill(False) when done. |
|---|
| 3133 | n/a | |
|---|
| 3134 | n/a | Optional argument: |
|---|
| 3135 | n/a | flag -- True/False (or 1/0 respectively) |
|---|
| 3136 | n/a | |
|---|
| 3137 | n/a | Call fill(True) before drawing the shape you want to fill, |
|---|
| 3138 | n/a | and fill(False) when done. |
|---|
| 3139 | n/a | When used without argument: return fillstate (True if filling, |
|---|
| 3140 | n/a | False else) |
|---|
| 3141 | n/a | |
|---|
| 3142 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3143 | n/a | >>> turtle.fill(True) |
|---|
| 3144 | n/a | >>> turtle.forward(100) |
|---|
| 3145 | n/a | >>> turtle.left(90) |
|---|
| 3146 | n/a | >>> turtle.forward(100) |
|---|
| 3147 | n/a | >>> turtle.left(90) |
|---|
| 3148 | n/a | >>> turtle.forward(100) |
|---|
| 3149 | n/a | >>> turtle.left(90) |
|---|
| 3150 | n/a | >>> turtle.forward(100) |
|---|
| 3151 | n/a | >>> turtle.fill(False) |
|---|
| 3152 | n/a | """ |
|---|
| 3153 | n/a | filling = isinstance(self._fillpath, list) |
|---|
| 3154 | n/a | if flag is None: |
|---|
| 3155 | n/a | return filling |
|---|
| 3156 | n/a | screen = self.screen |
|---|
| 3157 | n/a | entry1 = entry2 = () |
|---|
| 3158 | n/a | if filling: |
|---|
| 3159 | n/a | if len(self._fillpath) > 2: |
|---|
| 3160 | n/a | self.screen._drawpoly(self._fillitem, self._fillpath, |
|---|
| 3161 | n/a | fill=self._fillcolor) |
|---|
| 3162 | n/a | entry1 = ("dofill", self._fillitem) |
|---|
| 3163 | n/a | if flag: |
|---|
| 3164 | n/a | self._fillitem = self.screen._createpoly() |
|---|
| 3165 | n/a | self.items.append(self._fillitem) |
|---|
| 3166 | n/a | self._fillpath = [self._position] |
|---|
| 3167 | n/a | entry2 = ("beginfill", self._fillitem) # , self._fillpath) |
|---|
| 3168 | n/a | self._newLine() |
|---|
| 3169 | n/a | else: |
|---|
| 3170 | n/a | self._fillitem = self._fillpath = None |
|---|
| 3171 | n/a | if self.undobuffer: |
|---|
| 3172 | n/a | if entry1 == (): |
|---|
| 3173 | n/a | if entry2 != (): |
|---|
| 3174 | n/a | self.undobuffer.push(entry2) |
|---|
| 3175 | n/a | else: |
|---|
| 3176 | n/a | if entry2 == (): |
|---|
| 3177 | n/a | self.undobuffer.push(entry1) |
|---|
| 3178 | n/a | else: |
|---|
| 3179 | n/a | self.undobuffer.push(["seq", entry1, entry2]) |
|---|
| 3180 | n/a | self._update() |
|---|
| 3181 | n/a | |
|---|
| 3182 | n/a | def begin_fill(self): |
|---|
| 3183 | n/a | """Called just before drawing a shape to be filled. |
|---|
| 3184 | n/a | |
|---|
| 3185 | n/a | No argument. |
|---|
| 3186 | n/a | |
|---|
| 3187 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3188 | n/a | >>> turtle.begin_fill() |
|---|
| 3189 | n/a | >>> turtle.forward(100) |
|---|
| 3190 | n/a | >>> turtle.left(90) |
|---|
| 3191 | n/a | >>> turtle.forward(100) |
|---|
| 3192 | n/a | >>> turtle.left(90) |
|---|
| 3193 | n/a | >>> turtle.forward(100) |
|---|
| 3194 | n/a | >>> turtle.left(90) |
|---|
| 3195 | n/a | >>> turtle.forward(100) |
|---|
| 3196 | n/a | >>> turtle.end_fill() |
|---|
| 3197 | n/a | """ |
|---|
| 3198 | n/a | self.fill(True) |
|---|
| 3199 | n/a | |
|---|
| 3200 | n/a | def end_fill(self): |
|---|
| 3201 | n/a | """Fill the shape drawn after the call begin_fill(). |
|---|
| 3202 | n/a | |
|---|
| 3203 | n/a | No argument. |
|---|
| 3204 | n/a | |
|---|
| 3205 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3206 | n/a | >>> turtle.begin_fill() |
|---|
| 3207 | n/a | >>> turtle.forward(100) |
|---|
| 3208 | n/a | >>> turtle.left(90) |
|---|
| 3209 | n/a | >>> turtle.forward(100) |
|---|
| 3210 | n/a | >>> turtle.left(90) |
|---|
| 3211 | n/a | >>> turtle.forward(100) |
|---|
| 3212 | n/a | >>> turtle.left(90) |
|---|
| 3213 | n/a | >>> turtle.forward(100) |
|---|
| 3214 | n/a | >>> turtle.end_fill() |
|---|
| 3215 | n/a | """ |
|---|
| 3216 | n/a | self.fill(False) |
|---|
| 3217 | n/a | |
|---|
| 3218 | n/a | def dot(self, size=None, *color): |
|---|
| 3219 | n/a | """Draw a dot with diameter size, using color. |
|---|
| 3220 | n/a | |
|---|
| 3221 | n/a | Optional argumentS: |
|---|
| 3222 | n/a | size -- an integer >= 1 (if given) |
|---|
| 3223 | n/a | color -- a colorstring or a numeric color tuple |
|---|
| 3224 | n/a | |
|---|
| 3225 | n/a | Draw a circular dot with diameter size, using color. |
|---|
| 3226 | n/a | If size is not given, the maximum of pensize+4 and 2*pensize is used. |
|---|
| 3227 | n/a | |
|---|
| 3228 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3229 | n/a | >>> turtle.dot() |
|---|
| 3230 | n/a | >>> turtle.fd(50); turtle.dot(20, "blue"); turtle.fd(50) |
|---|
| 3231 | n/a | """ |
|---|
| 3232 | n/a | #print "dot-1:", size, color |
|---|
| 3233 | n/a | if not color: |
|---|
| 3234 | n/a | if isinstance(size, (str, tuple)): |
|---|
| 3235 | n/a | color = self._colorstr(size) |
|---|
| 3236 | n/a | size = self._pensize + max(self._pensize, 4) |
|---|
| 3237 | n/a | else: |
|---|
| 3238 | n/a | color = self._pencolor |
|---|
| 3239 | n/a | if not size: |
|---|
| 3240 | n/a | size = self._pensize + max(self._pensize, 4) |
|---|
| 3241 | n/a | else: |
|---|
| 3242 | n/a | if size is None: |
|---|
| 3243 | n/a | size = self._pensize + max(self._pensize, 4) |
|---|
| 3244 | n/a | color = self._colorstr(color) |
|---|
| 3245 | n/a | #print "dot-2:", size, color |
|---|
| 3246 | n/a | if hasattr(self.screen, "_dot"): |
|---|
| 3247 | n/a | item = self.screen._dot(self._position, size, color) |
|---|
| 3248 | n/a | #print "dot:", size, color, "item:", item |
|---|
| 3249 | n/a | self.items.append(item) |
|---|
| 3250 | n/a | if self.undobuffer: |
|---|
| 3251 | n/a | self.undobuffer.push(("dot", item)) |
|---|
| 3252 | n/a | else: |
|---|
| 3253 | n/a | pen = self.pen() |
|---|
| 3254 | n/a | if self.undobuffer: |
|---|
| 3255 | n/a | self.undobuffer.push(["seq"]) |
|---|
| 3256 | n/a | self.undobuffer.cumulate = True |
|---|
| 3257 | n/a | try: |
|---|
| 3258 | n/a | if self.resizemode() == 'auto': |
|---|
| 3259 | n/a | self.ht() |
|---|
| 3260 | n/a | self.pendown() |
|---|
| 3261 | n/a | self.pensize(size) |
|---|
| 3262 | n/a | self.pencolor(color) |
|---|
| 3263 | n/a | self.forward(0) |
|---|
| 3264 | n/a | finally: |
|---|
| 3265 | n/a | self.pen(pen) |
|---|
| 3266 | n/a | if self.undobuffer: |
|---|
| 3267 | n/a | self.undobuffer.cumulate = False |
|---|
| 3268 | n/a | |
|---|
| 3269 | n/a | def _write(self, txt, align, font): |
|---|
| 3270 | n/a | """Performs the writing for write() |
|---|
| 3271 | n/a | """ |
|---|
| 3272 | n/a | item, end = self.screen._write(self._position, txt, align, font, |
|---|
| 3273 | n/a | self._pencolor) |
|---|
| 3274 | n/a | self.items.append(item) |
|---|
| 3275 | n/a | if self.undobuffer: |
|---|
| 3276 | n/a | self.undobuffer.push(("wri", item)) |
|---|
| 3277 | n/a | return end |
|---|
| 3278 | n/a | |
|---|
| 3279 | n/a | def write(self, arg, move=False, align="left", font=("Arial", 8, "normal")): |
|---|
| 3280 | n/a | """Write text at the current turtle position. |
|---|
| 3281 | n/a | |
|---|
| 3282 | n/a | Arguments: |
|---|
| 3283 | n/a | arg -- info, which is to be written to the TurtleScreen |
|---|
| 3284 | n/a | move (optional) -- True/False |
|---|
| 3285 | n/a | align (optional) -- one of the strings "left", "center" or right" |
|---|
| 3286 | n/a | font (optional) -- a triple (fontname, fontsize, fonttype) |
|---|
| 3287 | n/a | |
|---|
| 3288 | n/a | Write text - the string representation of arg - at the current |
|---|
| 3289 | n/a | turtle position according to align ("left", "center" or right") |
|---|
| 3290 | n/a | and with the given font. |
|---|
| 3291 | n/a | If move is True, the pen is moved to the bottom-right corner |
|---|
| 3292 | n/a | of the text. By default, move is False. |
|---|
| 3293 | n/a | |
|---|
| 3294 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3295 | n/a | >>> turtle.write('Home = ', True, align="center") |
|---|
| 3296 | n/a | >>> turtle.write((0,0), True) |
|---|
| 3297 | n/a | """ |
|---|
| 3298 | n/a | if self.undobuffer: |
|---|
| 3299 | n/a | self.undobuffer.push(["seq"]) |
|---|
| 3300 | n/a | self.undobuffer.cumulate = True |
|---|
| 3301 | n/a | end = self._write(str(arg), align.lower(), font) |
|---|
| 3302 | n/a | if move: |
|---|
| 3303 | n/a | x, y = self.pos() |
|---|
| 3304 | n/a | self.setpos(end, y) |
|---|
| 3305 | n/a | if self.undobuffer: |
|---|
| 3306 | n/a | self.undobuffer.cumulate = False |
|---|
| 3307 | n/a | |
|---|
| 3308 | n/a | def begin_poly(self): |
|---|
| 3309 | n/a | """Start recording the vertices of a polygon. |
|---|
| 3310 | n/a | |
|---|
| 3311 | n/a | No argument. |
|---|
| 3312 | n/a | |
|---|
| 3313 | n/a | Start recording the vertices of a polygon. Current turtle position |
|---|
| 3314 | n/a | is first point of polygon. |
|---|
| 3315 | n/a | |
|---|
| 3316 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3317 | n/a | >>> turtle.begin_poly() |
|---|
| 3318 | n/a | """ |
|---|
| 3319 | n/a | self._poly = [self._position] |
|---|
| 3320 | n/a | self._creatingPoly = True |
|---|
| 3321 | n/a | |
|---|
| 3322 | n/a | def end_poly(self): |
|---|
| 3323 | n/a | """Stop recording the vertices of a polygon. |
|---|
| 3324 | n/a | |
|---|
| 3325 | n/a | No argument. |
|---|
| 3326 | n/a | |
|---|
| 3327 | n/a | Stop recording the vertices of a polygon. Current turtle position is |
|---|
| 3328 | n/a | last point of polygon. This will be connected with the first point. |
|---|
| 3329 | n/a | |
|---|
| 3330 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3331 | n/a | >>> turtle.end_poly() |
|---|
| 3332 | n/a | """ |
|---|
| 3333 | n/a | self._creatingPoly = False |
|---|
| 3334 | n/a | |
|---|
| 3335 | n/a | def get_poly(self): |
|---|
| 3336 | n/a | """Return the lastly recorded polygon. |
|---|
| 3337 | n/a | |
|---|
| 3338 | n/a | No argument. |
|---|
| 3339 | n/a | |
|---|
| 3340 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3341 | n/a | >>> p = turtle.get_poly() |
|---|
| 3342 | n/a | >>> turtle.register_shape("myFavouriteShape", p) |
|---|
| 3343 | n/a | """ |
|---|
| 3344 | n/a | ## check if there is any poly? -- 1st solution: |
|---|
| 3345 | n/a | if self._poly is not None: |
|---|
| 3346 | n/a | return tuple(self._poly) |
|---|
| 3347 | n/a | |
|---|
| 3348 | n/a | def getscreen(self): |
|---|
| 3349 | n/a | """Return the TurtleScreen object, the turtle is drawing on. |
|---|
| 3350 | n/a | |
|---|
| 3351 | n/a | No argument. |
|---|
| 3352 | n/a | |
|---|
| 3353 | n/a | Return the TurtleScreen object, the turtle is drawing on. |
|---|
| 3354 | n/a | So TurtleScreen-methods can be called for that object. |
|---|
| 3355 | n/a | |
|---|
| 3356 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3357 | n/a | >>> ts = turtle.getscreen() |
|---|
| 3358 | n/a | >>> ts |
|---|
| 3359 | n/a | <turtle.TurtleScreen object at 0x0106B770> |
|---|
| 3360 | n/a | >>> ts.bgcolor("pink") |
|---|
| 3361 | n/a | """ |
|---|
| 3362 | n/a | return self.screen |
|---|
| 3363 | n/a | |
|---|
| 3364 | n/a | def getturtle(self): |
|---|
| 3365 | n/a | """Return the Turtleobject itself. |
|---|
| 3366 | n/a | |
|---|
| 3367 | n/a | No argument. |
|---|
| 3368 | n/a | |
|---|
| 3369 | n/a | Only reasonable use: as a function to return the 'anonymous turtle': |
|---|
| 3370 | n/a | |
|---|
| 3371 | n/a | Example: |
|---|
| 3372 | n/a | >>> pet = getturtle() |
|---|
| 3373 | n/a | >>> pet.fd(50) |
|---|
| 3374 | n/a | >>> pet |
|---|
| 3375 | n/a | <turtle.Turtle object at 0x0187D810> |
|---|
| 3376 | n/a | >>> turtles() |
|---|
| 3377 | n/a | [<turtle.Turtle object at 0x0187D810>] |
|---|
| 3378 | n/a | """ |
|---|
| 3379 | n/a | return self |
|---|
| 3380 | n/a | |
|---|
| 3381 | n/a | getpen = getturtle |
|---|
| 3382 | n/a | |
|---|
| 3383 | n/a | |
|---|
| 3384 | n/a | ################################################################ |
|---|
| 3385 | n/a | ### screen oriented methods recurring to methods of TurtleScreen |
|---|
| 3386 | n/a | ################################################################ |
|---|
| 3387 | n/a | |
|---|
| 3388 | n/a | def window_width(self): |
|---|
| 3389 | n/a | """ Returns the width of the turtle window. |
|---|
| 3390 | n/a | |
|---|
| 3391 | n/a | No argument. |
|---|
| 3392 | n/a | |
|---|
| 3393 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 3394 | n/a | >>> screen.window_width() |
|---|
| 3395 | n/a | 640 |
|---|
| 3396 | n/a | """ |
|---|
| 3397 | n/a | return self.screen._window_size()[0] |
|---|
| 3398 | n/a | |
|---|
| 3399 | n/a | def window_height(self): |
|---|
| 3400 | n/a | """ Return the height of the turtle window. |
|---|
| 3401 | n/a | |
|---|
| 3402 | n/a | No argument. |
|---|
| 3403 | n/a | |
|---|
| 3404 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 3405 | n/a | >>> screen.window_height() |
|---|
| 3406 | n/a | 480 |
|---|
| 3407 | n/a | """ |
|---|
| 3408 | n/a | return self.screen._window_size()[1] |
|---|
| 3409 | n/a | |
|---|
| 3410 | n/a | def _delay(self, delay=None): |
|---|
| 3411 | n/a | """Set delay value which determines speed of turtle animation. |
|---|
| 3412 | n/a | """ |
|---|
| 3413 | n/a | return self.screen.delay(delay) |
|---|
| 3414 | n/a | |
|---|
| 3415 | n/a | ##### event binding methods ##### |
|---|
| 3416 | n/a | |
|---|
| 3417 | n/a | def onclick(self, fun, btn=1, add=None): |
|---|
| 3418 | n/a | """Bind fun to mouse-click event on this turtle on canvas. |
|---|
| 3419 | n/a | |
|---|
| 3420 | n/a | Arguments: |
|---|
| 3421 | n/a | fun -- a function with two arguments, to which will be assigned |
|---|
| 3422 | n/a | the coordinates of the clicked point on the canvas. |
|---|
| 3423 | n/a | num -- number of the mouse-button defaults to 1 (left mouse button). |
|---|
| 3424 | n/a | add -- True or False. If True, new binding will be added, otherwise |
|---|
| 3425 | n/a | it will replace a former binding. |
|---|
| 3426 | n/a | |
|---|
| 3427 | n/a | Example for the anonymous turtle, i. e. the procedural way: |
|---|
| 3428 | n/a | |
|---|
| 3429 | n/a | >>> def turn(x, y): |
|---|
| 3430 | n/a | left(360) |
|---|
| 3431 | n/a | |
|---|
| 3432 | n/a | >>> onclick(turn) # Now clicking into the turtle will turn it. |
|---|
| 3433 | n/a | >>> onclick(None) # event-binding will be removed |
|---|
| 3434 | n/a | """ |
|---|
| 3435 | n/a | self.screen._onclick(self.turtle._item, fun, btn, add) |
|---|
| 3436 | n/a | self._update() |
|---|
| 3437 | n/a | |
|---|
| 3438 | n/a | def onrelease(self, fun, btn=1, add=None): |
|---|
| 3439 | n/a | """Bind fun to mouse-button-release event on this turtle on canvas. |
|---|
| 3440 | n/a | |
|---|
| 3441 | n/a | Arguments: |
|---|
| 3442 | n/a | fun -- a function with two arguments, to which will be assigned |
|---|
| 3443 | n/a | the coordinates of the clicked point on the canvas. |
|---|
| 3444 | n/a | num -- number of the mouse-button defaults to 1 (left mouse button). |
|---|
| 3445 | n/a | |
|---|
| 3446 | n/a | Example (for a MyTurtle instance named joe): |
|---|
| 3447 | n/a | >>> class MyTurtle(Turtle): |
|---|
| 3448 | n/a | def glow(self,x,y): |
|---|
| 3449 | n/a | self.fillcolor("red") |
|---|
| 3450 | n/a | def unglow(self,x,y): |
|---|
| 3451 | n/a | self.fillcolor("") |
|---|
| 3452 | n/a | |
|---|
| 3453 | n/a | >>> joe = MyTurtle() |
|---|
| 3454 | n/a | >>> joe.onclick(joe.glow) |
|---|
| 3455 | n/a | >>> joe.onrelease(joe.unglow) |
|---|
| 3456 | n/a | ### clicking on joe turns fillcolor red, |
|---|
| 3457 | n/a | ### unclicking turns it to transparent. |
|---|
| 3458 | n/a | """ |
|---|
| 3459 | n/a | self.screen._onrelease(self.turtle._item, fun, btn, add) |
|---|
| 3460 | n/a | self._update() |
|---|
| 3461 | n/a | |
|---|
| 3462 | n/a | def ondrag(self, fun, btn=1, add=None): |
|---|
| 3463 | n/a | """Bind fun to mouse-move event on this turtle on canvas. |
|---|
| 3464 | n/a | |
|---|
| 3465 | n/a | Arguments: |
|---|
| 3466 | n/a | fun -- a function with two arguments, to which will be assigned |
|---|
| 3467 | n/a | the coordinates of the clicked point on the canvas. |
|---|
| 3468 | n/a | num -- number of the mouse-button defaults to 1 (left mouse button). |
|---|
| 3469 | n/a | |
|---|
| 3470 | n/a | Every sequence of mouse-move-events on a turtle is preceded by a |
|---|
| 3471 | n/a | mouse-click event on that turtle. |
|---|
| 3472 | n/a | |
|---|
| 3473 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3474 | n/a | >>> turtle.ondrag(turtle.goto) |
|---|
| 3475 | n/a | |
|---|
| 3476 | n/a | ### Subsequently clicking and dragging a Turtle will |
|---|
| 3477 | n/a | ### move it across the screen thereby producing handdrawings |
|---|
| 3478 | n/a | ### (if pen is down). |
|---|
| 3479 | n/a | """ |
|---|
| 3480 | n/a | self.screen._ondrag(self.turtle._item, fun, btn, add) |
|---|
| 3481 | n/a | |
|---|
| 3482 | n/a | |
|---|
| 3483 | n/a | def _undo(self, action, data): |
|---|
| 3484 | n/a | """Does the main part of the work for undo() |
|---|
| 3485 | n/a | """ |
|---|
| 3486 | n/a | if self.undobuffer is None: |
|---|
| 3487 | n/a | return |
|---|
| 3488 | n/a | if action == "rot": |
|---|
| 3489 | n/a | angle, degPAU = data |
|---|
| 3490 | n/a | self._rotate(-angle*degPAU/self._degreesPerAU) |
|---|
| 3491 | n/a | dummy = self.undobuffer.pop() |
|---|
| 3492 | n/a | elif action == "stamp": |
|---|
| 3493 | n/a | stitem = data[0] |
|---|
| 3494 | n/a | self.clearstamp(stitem) |
|---|
| 3495 | n/a | elif action == "go": |
|---|
| 3496 | n/a | self._undogoto(data) |
|---|
| 3497 | n/a | elif action in ["wri", "dot"]: |
|---|
| 3498 | n/a | item = data[0] |
|---|
| 3499 | n/a | self.screen._delete(item) |
|---|
| 3500 | n/a | self.items.remove(item) |
|---|
| 3501 | n/a | elif action == "dofill": |
|---|
| 3502 | n/a | item = data[0] |
|---|
| 3503 | n/a | self.screen._drawpoly(item, ((0, 0),(0, 0),(0, 0)), |
|---|
| 3504 | n/a | fill="", outline="") |
|---|
| 3505 | n/a | elif action == "beginfill": |
|---|
| 3506 | n/a | item = data[0] |
|---|
| 3507 | n/a | self._fillitem = self._fillpath = None |
|---|
| 3508 | n/a | self.screen._delete(item) |
|---|
| 3509 | n/a | self.items.remove(item) |
|---|
| 3510 | n/a | elif action == "pen": |
|---|
| 3511 | n/a | TPen.pen(self, data[0]) |
|---|
| 3512 | n/a | self.undobuffer.pop() |
|---|
| 3513 | n/a | |
|---|
| 3514 | n/a | def undo(self): |
|---|
| 3515 | n/a | """undo (repeatedly) the last turtle action. |
|---|
| 3516 | n/a | |
|---|
| 3517 | n/a | No argument. |
|---|
| 3518 | n/a | |
|---|
| 3519 | n/a | undo (repeatedly) the last turtle action. |
|---|
| 3520 | n/a | Number of available undo actions is determined by the size of |
|---|
| 3521 | n/a | the undobuffer. |
|---|
| 3522 | n/a | |
|---|
| 3523 | n/a | Example (for a Turtle instance named turtle): |
|---|
| 3524 | n/a | >>> for i in range(4): |
|---|
| 3525 | n/a | turtle.fd(50); turtle.lt(80) |
|---|
| 3526 | n/a | |
|---|
| 3527 | n/a | >>> for i in range(8): |
|---|
| 3528 | n/a | turtle.undo() |
|---|
| 3529 | n/a | """ |
|---|
| 3530 | n/a | if self.undobuffer is None: |
|---|
| 3531 | n/a | return |
|---|
| 3532 | n/a | item = self.undobuffer.pop() |
|---|
| 3533 | n/a | action = item[0] |
|---|
| 3534 | n/a | data = item[1:] |
|---|
| 3535 | n/a | if action == "seq": |
|---|
| 3536 | n/a | while data: |
|---|
| 3537 | n/a | item = data.pop() |
|---|
| 3538 | n/a | self._undo(item[0], item[1:]) |
|---|
| 3539 | n/a | else: |
|---|
| 3540 | n/a | self._undo(action, data) |
|---|
| 3541 | n/a | |
|---|
| 3542 | n/a | turtlesize = shapesize |
|---|
| 3543 | n/a | |
|---|
| 3544 | n/a | RawPen = RawTurtle |
|---|
| 3545 | n/a | |
|---|
| 3546 | n/a | ### Screen - Singleton ######################## |
|---|
| 3547 | n/a | |
|---|
| 3548 | n/a | def Screen(): |
|---|
| 3549 | n/a | """Return the singleton screen object. |
|---|
| 3550 | n/a | If none exists at the moment, create a new one and return it, |
|---|
| 3551 | n/a | else return the existing one.""" |
|---|
| 3552 | n/a | if Turtle._screen is None: |
|---|
| 3553 | n/a | Turtle._screen = _Screen() |
|---|
| 3554 | n/a | return Turtle._screen |
|---|
| 3555 | n/a | |
|---|
| 3556 | n/a | class _Screen(TurtleScreen): |
|---|
| 3557 | n/a | |
|---|
| 3558 | n/a | _root = None |
|---|
| 3559 | n/a | _canvas = None |
|---|
| 3560 | n/a | _title = _CFG["title"] |
|---|
| 3561 | n/a | |
|---|
| 3562 | n/a | def __init__(self): |
|---|
| 3563 | n/a | # XXX there is no need for this code to be conditional, |
|---|
| 3564 | n/a | # as there will be only a single _Screen instance, anyway |
|---|
| 3565 | n/a | # XXX actually, the turtle demo is injecting root window, |
|---|
| 3566 | n/a | # so perhaps the conditional creation of a root should be |
|---|
| 3567 | n/a | # preserved (perhaps by passing it as an optional parameter) |
|---|
| 3568 | n/a | if _Screen._root is None: |
|---|
| 3569 | n/a | _Screen._root = self._root = _Root() |
|---|
| 3570 | n/a | self._root.title(_Screen._title) |
|---|
| 3571 | n/a | self._root.ondestroy(self._destroy) |
|---|
| 3572 | n/a | if _Screen._canvas is None: |
|---|
| 3573 | n/a | width = _CFG["width"] |
|---|
| 3574 | n/a | height = _CFG["height"] |
|---|
| 3575 | n/a | canvwidth = _CFG["canvwidth"] |
|---|
| 3576 | n/a | canvheight = _CFG["canvheight"] |
|---|
| 3577 | n/a | leftright = _CFG["leftright"] |
|---|
| 3578 | n/a | topbottom = _CFG["topbottom"] |
|---|
| 3579 | n/a | self._root.setupcanvas(width, height, canvwidth, canvheight) |
|---|
| 3580 | n/a | _Screen._canvas = self._root._getcanvas() |
|---|
| 3581 | n/a | TurtleScreen.__init__(self, _Screen._canvas) |
|---|
| 3582 | n/a | self.setup(width, height, leftright, topbottom) |
|---|
| 3583 | n/a | |
|---|
| 3584 | n/a | def setup(self, width=_CFG["width"], height=_CFG["height"], |
|---|
| 3585 | n/a | startx=_CFG["leftright"], starty=_CFG["topbottom"]): |
|---|
| 3586 | n/a | """ Set the size and position of the main window. |
|---|
| 3587 | n/a | |
|---|
| 3588 | n/a | Arguments: |
|---|
| 3589 | n/a | width: as integer a size in pixels, as float a fraction of the screen. |
|---|
| 3590 | n/a | Default is 50% of screen. |
|---|
| 3591 | n/a | height: as integer the height in pixels, as float a fraction of the |
|---|
| 3592 | n/a | screen. Default is 75% of screen. |
|---|
| 3593 | n/a | startx: if positive, starting position in pixels from the left |
|---|
| 3594 | n/a | edge of the screen, if negative from the right edge |
|---|
| 3595 | n/a | Default, startx=None is to center window horizontally. |
|---|
| 3596 | n/a | starty: if positive, starting position in pixels from the top |
|---|
| 3597 | n/a | edge of the screen, if negative from the bottom edge |
|---|
| 3598 | n/a | Default, starty=None is to center window vertically. |
|---|
| 3599 | n/a | |
|---|
| 3600 | n/a | Examples (for a Screen instance named screen): |
|---|
| 3601 | n/a | >>> screen.setup (width=200, height=200, startx=0, starty=0) |
|---|
| 3602 | n/a | |
|---|
| 3603 | n/a | sets window to 200x200 pixels, in upper left of screen |
|---|
| 3604 | n/a | |
|---|
| 3605 | n/a | >>> screen.setup(width=.75, height=0.5, startx=None, starty=None) |
|---|
| 3606 | n/a | |
|---|
| 3607 | n/a | sets window to 75% of screen by 50% of screen and centers |
|---|
| 3608 | n/a | """ |
|---|
| 3609 | n/a | if not hasattr(self._root, "set_geometry"): |
|---|
| 3610 | n/a | return |
|---|
| 3611 | n/a | sw = self._root.win_width() |
|---|
| 3612 | n/a | sh = self._root.win_height() |
|---|
| 3613 | n/a | if isinstance(width, float) and 0 <= width <= 1: |
|---|
| 3614 | n/a | width = sw*width |
|---|
| 3615 | n/a | if startx is None: |
|---|
| 3616 | n/a | startx = (sw - width) / 2 |
|---|
| 3617 | n/a | if isinstance(height, float) and 0 <= height <= 1: |
|---|
| 3618 | n/a | height = sh*height |
|---|
| 3619 | n/a | if starty is None: |
|---|
| 3620 | n/a | starty = (sh - height) / 2 |
|---|
| 3621 | n/a | self._root.set_geometry(width, height, startx, starty) |
|---|
| 3622 | n/a | self.update() |
|---|
| 3623 | n/a | |
|---|
| 3624 | n/a | def title(self, titlestring): |
|---|
| 3625 | n/a | """Set title of turtle-window |
|---|
| 3626 | n/a | |
|---|
| 3627 | n/a | Argument: |
|---|
| 3628 | n/a | titlestring -- a string, to appear in the titlebar of the |
|---|
| 3629 | n/a | turtle graphics window. |
|---|
| 3630 | n/a | |
|---|
| 3631 | n/a | This is a method of Screen-class. Not available for TurtleScreen- |
|---|
| 3632 | n/a | objects. |
|---|
| 3633 | n/a | |
|---|
| 3634 | n/a | Example (for a Screen instance named screen): |
|---|
| 3635 | n/a | >>> screen.title("Welcome to the turtle-zoo!") |
|---|
| 3636 | n/a | """ |
|---|
| 3637 | n/a | if _Screen._root is not None: |
|---|
| 3638 | n/a | _Screen._root.title(titlestring) |
|---|
| 3639 | n/a | _Screen._title = titlestring |
|---|
| 3640 | n/a | |
|---|
| 3641 | n/a | def _destroy(self): |
|---|
| 3642 | n/a | root = self._root |
|---|
| 3643 | n/a | if root is _Screen._root: |
|---|
| 3644 | n/a | Turtle._pen = None |
|---|
| 3645 | n/a | Turtle._screen = None |
|---|
| 3646 | n/a | _Screen._root = None |
|---|
| 3647 | n/a | _Screen._canvas = None |
|---|
| 3648 | n/a | TurtleScreen._RUNNING = True |
|---|
| 3649 | n/a | root.destroy() |
|---|
| 3650 | n/a | |
|---|
| 3651 | n/a | def bye(self): |
|---|
| 3652 | n/a | """Shut the turtlegraphics window. |
|---|
| 3653 | n/a | |
|---|
| 3654 | n/a | Example (for a TurtleScreen instance named screen): |
|---|
| 3655 | n/a | >>> screen.bye() |
|---|
| 3656 | n/a | """ |
|---|
| 3657 | n/a | self._destroy() |
|---|
| 3658 | n/a | |
|---|
| 3659 | n/a | def exitonclick(self): |
|---|
| 3660 | n/a | """Go into mainloop until the mouse is clicked. |
|---|
| 3661 | n/a | |
|---|
| 3662 | n/a | No arguments. |
|---|
| 3663 | n/a | |
|---|
| 3664 | n/a | Bind bye() method to mouseclick on TurtleScreen. |
|---|
| 3665 | n/a | If "using_IDLE" - value in configuration dictionary is False |
|---|
| 3666 | n/a | (default value), enter mainloop. |
|---|
| 3667 | n/a | If IDLE with -n switch (no subprocess) is used, this value should be |
|---|
| 3668 | n/a | set to True in turtle.cfg. In this case IDLE's mainloop |
|---|
| 3669 | n/a | is active also for the client script. |
|---|
| 3670 | n/a | |
|---|
| 3671 | n/a | This is a method of the Screen-class and not available for |
|---|
| 3672 | n/a | TurtleScreen instances. |
|---|
| 3673 | n/a | |
|---|
| 3674 | n/a | Example (for a Screen instance named screen): |
|---|
| 3675 | n/a | >>> screen.exitonclick() |
|---|
| 3676 | n/a | |
|---|
| 3677 | n/a | """ |
|---|
| 3678 | n/a | def exitGracefully(x, y): |
|---|
| 3679 | n/a | """Screen.bye() with two dummy-parameters""" |
|---|
| 3680 | n/a | self.bye() |
|---|
| 3681 | n/a | self.onclick(exitGracefully) |
|---|
| 3682 | n/a | if _CFG["using_IDLE"]: |
|---|
| 3683 | n/a | return |
|---|
| 3684 | n/a | try: |
|---|
| 3685 | n/a | mainloop() |
|---|
| 3686 | n/a | except AttributeError: |
|---|
| 3687 | n/a | exit(0) |
|---|
| 3688 | n/a | |
|---|
| 3689 | n/a | |
|---|
| 3690 | n/a | class Turtle(RawTurtle): |
|---|
| 3691 | n/a | """RawTurtle auto-crating (scrolled) canvas. |
|---|
| 3692 | n/a | |
|---|
| 3693 | n/a | When a Turtle object is created or a function derived from some |
|---|
| 3694 | n/a | Turtle method is called a TurtleScreen object is automatically created. |
|---|
| 3695 | n/a | """ |
|---|
| 3696 | n/a | _pen = None |
|---|
| 3697 | n/a | _screen = None |
|---|
| 3698 | n/a | |
|---|
| 3699 | n/a | def __init__(self, |
|---|
| 3700 | n/a | shape=_CFG["shape"], |
|---|
| 3701 | n/a | undobuffersize=_CFG["undobuffersize"], |
|---|
| 3702 | n/a | visible=_CFG["visible"]): |
|---|
| 3703 | n/a | if Turtle._screen is None: |
|---|
| 3704 | n/a | Turtle._screen = Screen() |
|---|
| 3705 | n/a | RawTurtle.__init__(self, Turtle._screen, |
|---|
| 3706 | n/a | shape=shape, |
|---|
| 3707 | n/a | undobuffersize=undobuffersize, |
|---|
| 3708 | n/a | visible=visible) |
|---|
| 3709 | n/a | |
|---|
| 3710 | n/a | Pen = Turtle |
|---|
| 3711 | n/a | |
|---|
| 3712 | n/a | def _getpen(): |
|---|
| 3713 | n/a | """Create the 'anonymous' turtle if not already present.""" |
|---|
| 3714 | n/a | if Turtle._pen is None: |
|---|
| 3715 | n/a | Turtle._pen = Turtle() |
|---|
| 3716 | n/a | return Turtle._pen |
|---|
| 3717 | n/a | |
|---|
| 3718 | n/a | def _getscreen(): |
|---|
| 3719 | n/a | """Create a TurtleScreen if not already present.""" |
|---|
| 3720 | n/a | if Turtle._screen is None: |
|---|
| 3721 | n/a | Turtle._screen = Screen() |
|---|
| 3722 | n/a | return Turtle._screen |
|---|
| 3723 | n/a | |
|---|
| 3724 | n/a | def write_docstringdict(filename="turtle_docstringdict"): |
|---|
| 3725 | n/a | """Create and write docstring-dictionary to file. |
|---|
| 3726 | n/a | |
|---|
| 3727 | n/a | Optional argument: |
|---|
| 3728 | n/a | filename -- a string, used as filename |
|---|
| 3729 | n/a | default value is turtle_docstringdict |
|---|
| 3730 | n/a | |
|---|
| 3731 | n/a | Has to be called explicitely, (not used by the turtle-graphics classes) |
|---|
| 3732 | n/a | The docstring dictionary will be written to the Python script <filname>.py |
|---|
| 3733 | n/a | It is intended to serve as a template for translation of the docstrings |
|---|
| 3734 | n/a | into different languages. |
|---|
| 3735 | n/a | """ |
|---|
| 3736 | n/a | docsdict = {} |
|---|
| 3737 | n/a | |
|---|
| 3738 | n/a | for methodname in _tg_screen_functions: |
|---|
| 3739 | n/a | key = "_Screen."+methodname |
|---|
| 3740 | n/a | docsdict[key] = eval(key).__doc__ |
|---|
| 3741 | n/a | for methodname in _tg_turtle_functions: |
|---|
| 3742 | n/a | key = "Turtle."+methodname |
|---|
| 3743 | n/a | docsdict[key] = eval(key).__doc__ |
|---|
| 3744 | n/a | |
|---|
| 3745 | n/a | f = open("%s.py" % filename,"w") |
|---|
| 3746 | n/a | keys = sorted([x for x in docsdict.keys() |
|---|
| 3747 | n/a | if x.split('.')[1] not in _alias_list]) |
|---|
| 3748 | n/a | f.write('docsdict = {\n\n') |
|---|
| 3749 | n/a | for key in keys[:-1]: |
|---|
| 3750 | n/a | f.write('%s :\n' % repr(key)) |
|---|
| 3751 | n/a | f.write(' """%s\n""",\n\n' % docsdict[key]) |
|---|
| 3752 | n/a | key = keys[-1] |
|---|
| 3753 | n/a | f.write('%s :\n' % repr(key)) |
|---|
| 3754 | n/a | f.write(' """%s\n"""\n\n' % docsdict[key]) |
|---|
| 3755 | n/a | f.write("}\n") |
|---|
| 3756 | n/a | f.close() |
|---|
| 3757 | n/a | |
|---|
| 3758 | n/a | def read_docstrings(lang): |
|---|
| 3759 | n/a | """Read in docstrings from lang-specific docstring dictionary. |
|---|
| 3760 | n/a | |
|---|
| 3761 | n/a | Transfer docstrings, translated to lang, from a dictionary-file |
|---|
| 3762 | n/a | to the methods of classes Screen and Turtle and - in revised form - |
|---|
| 3763 | n/a | to the corresponding functions. |
|---|
| 3764 | n/a | """ |
|---|
| 3765 | n/a | modname = "turtle_docstringdict_%(language)s" % {'language':lang.lower()} |
|---|
| 3766 | n/a | module = __import__(modname) |
|---|
| 3767 | n/a | docsdict = module.docsdict |
|---|
| 3768 | n/a | for key in docsdict: |
|---|
| 3769 | n/a | #print key |
|---|
| 3770 | n/a | try: |
|---|
| 3771 | n/a | eval(key).im_func.__doc__ = docsdict[key] |
|---|
| 3772 | n/a | except: |
|---|
| 3773 | n/a | print "Bad docstring-entry: %s" % key |
|---|
| 3774 | n/a | |
|---|
| 3775 | n/a | _LANGUAGE = _CFG["language"] |
|---|
| 3776 | n/a | |
|---|
| 3777 | n/a | try: |
|---|
| 3778 | n/a | if _LANGUAGE != "english": |
|---|
| 3779 | n/a | read_docstrings(_LANGUAGE) |
|---|
| 3780 | n/a | except ImportError: |
|---|
| 3781 | n/a | print "Cannot find docsdict for", _LANGUAGE |
|---|
| 3782 | n/a | except: |
|---|
| 3783 | n/a | print ("Unknown Error when trying to import %s-docstring-dictionary" % |
|---|
| 3784 | n/a | _LANGUAGE) |
|---|
| 3785 | n/a | |
|---|
| 3786 | n/a | |
|---|
| 3787 | n/a | def getmethparlist(ob): |
|---|
| 3788 | n/a | "Get strings describing the arguments for the given object" |
|---|
| 3789 | n/a | argText1 = argText2 = "" |
|---|
| 3790 | n/a | # bit of a hack for methods - turn it into a function |
|---|
| 3791 | n/a | # but we drop the "self" param. |
|---|
| 3792 | n/a | if type(ob)==types.MethodType: |
|---|
| 3793 | n/a | fob = ob.im_func |
|---|
| 3794 | n/a | argOffset = 1 |
|---|
| 3795 | n/a | else: |
|---|
| 3796 | n/a | fob = ob |
|---|
| 3797 | n/a | argOffset = 0 |
|---|
| 3798 | n/a | # Try and build one for Python defined functions |
|---|
| 3799 | n/a | if type(fob) in [types.FunctionType, types.LambdaType]: |
|---|
| 3800 | n/a | try: |
|---|
| 3801 | n/a | counter = fob.func_code.co_argcount |
|---|
| 3802 | n/a | items2 = list(fob.func_code.co_varnames[argOffset:counter]) |
|---|
| 3803 | n/a | realArgs = fob.func_code.co_varnames[argOffset:counter] |
|---|
| 3804 | n/a | defaults = fob.func_defaults or [] |
|---|
| 3805 | n/a | defaults = list(map(lambda name: "=%s" % repr(name), defaults)) |
|---|
| 3806 | n/a | defaults = [""] * (len(realArgs)-len(defaults)) + defaults |
|---|
| 3807 | n/a | items1 = map(lambda arg, dflt: arg+dflt, realArgs, defaults) |
|---|
| 3808 | n/a | if fob.func_code.co_flags & 0x4: |
|---|
| 3809 | n/a | items1.append("*"+fob.func_code.co_varnames[counter]) |
|---|
| 3810 | n/a | items2.append("*"+fob.func_code.co_varnames[counter]) |
|---|
| 3811 | n/a | counter += 1 |
|---|
| 3812 | n/a | if fob.func_code.co_flags & 0x8: |
|---|
| 3813 | n/a | items1.append("**"+fob.func_code.co_varnames[counter]) |
|---|
| 3814 | n/a | items2.append("**"+fob.func_code.co_varnames[counter]) |
|---|
| 3815 | n/a | argText1 = ", ".join(items1) |
|---|
| 3816 | n/a | argText1 = "(%s)" % argText1 |
|---|
| 3817 | n/a | argText2 = ", ".join(items2) |
|---|
| 3818 | n/a | argText2 = "(%s)" % argText2 |
|---|
| 3819 | n/a | except: |
|---|
| 3820 | n/a | pass |
|---|
| 3821 | n/a | return argText1, argText2 |
|---|
| 3822 | n/a | |
|---|
| 3823 | n/a | def _turtle_docrevise(docstr): |
|---|
| 3824 | n/a | """To reduce docstrings from RawTurtle class for functions |
|---|
| 3825 | n/a | """ |
|---|
| 3826 | n/a | import re |
|---|
| 3827 | n/a | if docstr is None: |
|---|
| 3828 | n/a | return None |
|---|
| 3829 | n/a | turtlename = _CFG["exampleturtle"] |
|---|
| 3830 | n/a | newdocstr = docstr.replace("%s." % turtlename,"") |
|---|
| 3831 | n/a | parexp = re.compile(r' \(.+ %s\):' % turtlename) |
|---|
| 3832 | n/a | newdocstr = parexp.sub(":", newdocstr) |
|---|
| 3833 | n/a | return newdocstr |
|---|
| 3834 | n/a | |
|---|
| 3835 | n/a | def _screen_docrevise(docstr): |
|---|
| 3836 | n/a | """To reduce docstrings from TurtleScreen class for functions |
|---|
| 3837 | n/a | """ |
|---|
| 3838 | n/a | import re |
|---|
| 3839 | n/a | if docstr is None: |
|---|
| 3840 | n/a | return None |
|---|
| 3841 | n/a | screenname = _CFG["examplescreen"] |
|---|
| 3842 | n/a | newdocstr = docstr.replace("%s." % screenname,"") |
|---|
| 3843 | n/a | parexp = re.compile(r' \(.+ %s\):' % screenname) |
|---|
| 3844 | n/a | newdocstr = parexp.sub(":", newdocstr) |
|---|
| 3845 | n/a | return newdocstr |
|---|
| 3846 | n/a | |
|---|
| 3847 | n/a | ## The following mechanism makes all methods of RawTurtle and Turtle available |
|---|
| 3848 | n/a | ## as functions. So we can enhance, change, add, delete methods to these |
|---|
| 3849 | n/a | ## classes and do not need to change anything here. |
|---|
| 3850 | n/a | |
|---|
| 3851 | n/a | |
|---|
| 3852 | n/a | for methodname in _tg_screen_functions: |
|---|
| 3853 | n/a | pl1, pl2 = getmethparlist(eval('_Screen.' + methodname)) |
|---|
| 3854 | n/a | if pl1 == "": |
|---|
| 3855 | n/a | print ">>>>>>", pl1, pl2 |
|---|
| 3856 | n/a | continue |
|---|
| 3857 | n/a | defstr = ("def %(key)s%(pl1)s: return _getscreen().%(key)s%(pl2)s" % |
|---|
| 3858 | n/a | {'key':methodname, 'pl1':pl1, 'pl2':pl2}) |
|---|
| 3859 | n/a | exec defstr |
|---|
| 3860 | n/a | eval(methodname).__doc__ = _screen_docrevise(eval('_Screen.'+methodname).__doc__) |
|---|
| 3861 | n/a | |
|---|
| 3862 | n/a | for methodname in _tg_turtle_functions: |
|---|
| 3863 | n/a | pl1, pl2 = getmethparlist(eval('Turtle.' + methodname)) |
|---|
| 3864 | n/a | if pl1 == "": |
|---|
| 3865 | n/a | print ">>>>>>", pl1, pl2 |
|---|
| 3866 | n/a | continue |
|---|
| 3867 | n/a | defstr = ("def %(key)s%(pl1)s: return _getpen().%(key)s%(pl2)s" % |
|---|
| 3868 | n/a | {'key':methodname, 'pl1':pl1, 'pl2':pl2}) |
|---|
| 3869 | n/a | exec defstr |
|---|
| 3870 | n/a | eval(methodname).__doc__ = _turtle_docrevise(eval('Turtle.'+methodname).__doc__) |
|---|
| 3871 | n/a | |
|---|
| 3872 | n/a | |
|---|
| 3873 | n/a | done = mainloop = TK.mainloop |
|---|
| 3874 | n/a | del pl1, pl2, defstr |
|---|
| 3875 | n/a | |
|---|
| 3876 | n/a | if __name__ == "__main__": |
|---|
| 3877 | n/a | def switchpen(): |
|---|
| 3878 | n/a | if isdown(): |
|---|
| 3879 | n/a | pu() |
|---|
| 3880 | n/a | else: |
|---|
| 3881 | n/a | pd() |
|---|
| 3882 | n/a | |
|---|
| 3883 | n/a | def demo1(): |
|---|
| 3884 | n/a | """Demo of old turtle.py - module""" |
|---|
| 3885 | n/a | reset() |
|---|
| 3886 | n/a | tracer(True) |
|---|
| 3887 | n/a | up() |
|---|
| 3888 | n/a | backward(100) |
|---|
| 3889 | n/a | down() |
|---|
| 3890 | n/a | # draw 3 squares; the last filled |
|---|
| 3891 | n/a | width(3) |
|---|
| 3892 | n/a | for i in range(3): |
|---|
| 3893 | n/a | if i == 2: |
|---|
| 3894 | n/a | fill(1) |
|---|
| 3895 | n/a | for _ in range(4): |
|---|
| 3896 | n/a | forward(20) |
|---|
| 3897 | n/a | left(90) |
|---|
| 3898 | n/a | if i == 2: |
|---|
| 3899 | n/a | color("maroon") |
|---|
| 3900 | n/a | fill(0) |
|---|
| 3901 | n/a | up() |
|---|
| 3902 | n/a | forward(30) |
|---|
| 3903 | n/a | down() |
|---|
| 3904 | n/a | width(1) |
|---|
| 3905 | n/a | color("black") |
|---|
| 3906 | n/a | # move out of the way |
|---|
| 3907 | n/a | tracer(False) |
|---|
| 3908 | n/a | up() |
|---|
| 3909 | n/a | right(90) |
|---|
| 3910 | n/a | forward(100) |
|---|
| 3911 | n/a | right(90) |
|---|
| 3912 | n/a | forward(100) |
|---|
| 3913 | n/a | right(180) |
|---|
| 3914 | n/a | down() |
|---|
| 3915 | n/a | # some text |
|---|
| 3916 | n/a | write("startstart", 1) |
|---|
| 3917 | n/a | write("start", 1) |
|---|
| 3918 | n/a | color("red") |
|---|
| 3919 | n/a | # staircase |
|---|
| 3920 | n/a | for i in range(5): |
|---|
| 3921 | n/a | forward(20) |
|---|
| 3922 | n/a | left(90) |
|---|
| 3923 | n/a | forward(20) |
|---|
| 3924 | n/a | right(90) |
|---|
| 3925 | n/a | # filled staircase |
|---|
| 3926 | n/a | tracer(True) |
|---|
| 3927 | n/a | fill(1) |
|---|
| 3928 | n/a | for i in range(5): |
|---|
| 3929 | n/a | forward(20) |
|---|
| 3930 | n/a | left(90) |
|---|
| 3931 | n/a | forward(20) |
|---|
| 3932 | n/a | right(90) |
|---|
| 3933 | n/a | fill(0) |
|---|
| 3934 | n/a | # more text |
|---|
| 3935 | n/a | |
|---|
| 3936 | n/a | def demo2(): |
|---|
| 3937 | n/a | """Demo of some new features.""" |
|---|
| 3938 | n/a | speed(1) |
|---|
| 3939 | n/a | st() |
|---|
| 3940 | n/a | pensize(3) |
|---|
| 3941 | n/a | setheading(towards(0, 0)) |
|---|
| 3942 | n/a | radius = distance(0, 0)/2.0 |
|---|
| 3943 | n/a | rt(90) |
|---|
| 3944 | n/a | for _ in range(18): |
|---|
| 3945 | n/a | switchpen() |
|---|
| 3946 | n/a | circle(radius, 10) |
|---|
| 3947 | n/a | write("wait a moment...") |
|---|
| 3948 | n/a | while undobufferentries(): |
|---|
| 3949 | n/a | undo() |
|---|
| 3950 | n/a | reset() |
|---|
| 3951 | n/a | lt(90) |
|---|
| 3952 | n/a | colormode(255) |
|---|
| 3953 | n/a | laenge = 10 |
|---|
| 3954 | n/a | pencolor("green") |
|---|
| 3955 | n/a | pensize(3) |
|---|
| 3956 | n/a | lt(180) |
|---|
| 3957 | n/a | for i in range(-2, 16): |
|---|
| 3958 | n/a | if i > 0: |
|---|
| 3959 | n/a | begin_fill() |
|---|
| 3960 | n/a | fillcolor(255-15*i, 0, 15*i) |
|---|
| 3961 | n/a | for _ in range(3): |
|---|
| 3962 | n/a | fd(laenge) |
|---|
| 3963 | n/a | lt(120) |
|---|
| 3964 | n/a | laenge += 10 |
|---|
| 3965 | n/a | lt(15) |
|---|
| 3966 | n/a | speed((speed()+1)%12) |
|---|
| 3967 | n/a | end_fill() |
|---|
| 3968 | n/a | |
|---|
| 3969 | n/a | lt(120) |
|---|
| 3970 | n/a | pu() |
|---|
| 3971 | n/a | fd(70) |
|---|
| 3972 | n/a | rt(30) |
|---|
| 3973 | n/a | pd() |
|---|
| 3974 | n/a | color("red","yellow") |
|---|
| 3975 | n/a | speed(0) |
|---|
| 3976 | n/a | fill(1) |
|---|
| 3977 | n/a | for _ in range(4): |
|---|
| 3978 | n/a | circle(50, 90) |
|---|
| 3979 | n/a | rt(90) |
|---|
| 3980 | n/a | fd(30) |
|---|
| 3981 | n/a | rt(90) |
|---|
| 3982 | n/a | fill(0) |
|---|
| 3983 | n/a | lt(90) |
|---|
| 3984 | n/a | pu() |
|---|
| 3985 | n/a | fd(30) |
|---|
| 3986 | n/a | pd() |
|---|
| 3987 | n/a | shape("turtle") |
|---|
| 3988 | n/a | |
|---|
| 3989 | n/a | tri = getturtle() |
|---|
| 3990 | n/a | tri.resizemode("auto") |
|---|
| 3991 | n/a | turtle = Turtle() |
|---|
| 3992 | n/a | turtle.resizemode("auto") |
|---|
| 3993 | n/a | turtle.shape("turtle") |
|---|
| 3994 | n/a | turtle.reset() |
|---|
| 3995 | n/a | turtle.left(90) |
|---|
| 3996 | n/a | turtle.speed(0) |
|---|
| 3997 | n/a | turtle.up() |
|---|
| 3998 | n/a | turtle.goto(280, 40) |
|---|
| 3999 | n/a | turtle.lt(30) |
|---|
| 4000 | n/a | turtle.down() |
|---|
| 4001 | n/a | turtle.speed(6) |
|---|
| 4002 | n/a | turtle.color("blue","orange") |
|---|
| 4003 | n/a | turtle.pensize(2) |
|---|
| 4004 | n/a | tri.speed(6) |
|---|
| 4005 | n/a | setheading(towards(turtle)) |
|---|
| 4006 | n/a | count = 1 |
|---|
| 4007 | n/a | while tri.distance(turtle) > 4: |
|---|
| 4008 | n/a | turtle.fd(3.5) |
|---|
| 4009 | n/a | turtle.lt(0.6) |
|---|
| 4010 | n/a | tri.setheading(tri.towards(turtle)) |
|---|
| 4011 | n/a | tri.fd(4) |
|---|
| 4012 | n/a | if count % 20 == 0: |
|---|
| 4013 | n/a | turtle.stamp() |
|---|
| 4014 | n/a | tri.stamp() |
|---|
| 4015 | n/a | switchpen() |
|---|
| 4016 | n/a | count += 1 |
|---|
| 4017 | n/a | tri.write("CAUGHT! ", font=("Arial", 16, "bold"), align="right") |
|---|
| 4018 | n/a | tri.pencolor("black") |
|---|
| 4019 | n/a | tri.pencolor("red") |
|---|
| 4020 | n/a | |
|---|
| 4021 | n/a | def baba(xdummy, ydummy): |
|---|
| 4022 | n/a | clearscreen() |
|---|
| 4023 | n/a | bye() |
|---|
| 4024 | n/a | |
|---|
| 4025 | n/a | time.sleep(2) |
|---|
| 4026 | n/a | |
|---|
| 4027 | n/a | while undobufferentries(): |
|---|
| 4028 | n/a | tri.undo() |
|---|
| 4029 | n/a | turtle.undo() |
|---|
| 4030 | n/a | tri.fd(50) |
|---|
| 4031 | n/a | tri.write(" Click me!", font = ("Courier", 12, "bold") ) |
|---|
| 4032 | n/a | tri.onclick(baba, 1) |
|---|
| 4033 | n/a | |
|---|
| 4034 | n/a | demo1() |
|---|
| 4035 | n/a | demo2() |
|---|
| 4036 | n/a | exitonclick() |
|---|